Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:22, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 468713004 of page Terconazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 12:22, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 441009579 of page Terephthaloyl_chloride for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
⚫ | verifiedrevid = 402682007
| Verifiedfields = changed
⚫ | ImageFile_Ref = {{chemboximage|correct|??}}
⚫ | verifiedrevid = 411404554
| ImageFile = Terephthaloylchloride.png
| IUPAC_name = 1-methoxy]phenyl]- 4-propan-2-yl-piperazine
| ImageName = Skeletal formula
| image = Terconazole.png
| ImageFile1 = Terephthaloyl-chloride-3D-balls.png

| ImageName1 = Ball-and-stick model
<!--Clinical data-->
| IUPACName = Terephthaloyl dichloride
| tradename = Terazol
| OtherNames = 1,4-Benzenedicarbonyl chloride, Benzene-1,4-dicarbonyl chloride, Terephthalic acid dichloride, Terephthaloyl dichloride, p-Phthalyl chloride, TCL
| Drugs.com = {{drugs.com|monograph|terconazole}}
| Section1 = {{Chembox Identifiers
| MedlinePlus = a688022
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| pregnancy_category =
| legal_status = | ChemSpiderID = 7207
| InChI = 1/C8H4Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4H
| routes_of_administration =
| InChIKey = LXEJRKJRKIFVNY-UHFFFAOYAY

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound = 94.9%
| metabolism =
| elimination_half-life =

<!--Identifiers-->
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 67915-31-5
| ATC_prefix = G01
| ATC_suffix = AG02
| ATC_supplemental =
⚫ | PubChem = 441383
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00251
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 390122
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 0KJ2VE664U
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D00888
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1306

<!--Chemical data-->
| C=26 | H=31 | Cl=2 | N=5 | O=3
| molecular_weight = 532.462 g/mol
| smiles = Clc1ccc(c(Cl)c1)4(O(COc3ccc(N2CCN(C(C)C)CC2)cc3)CO4)Cn5ncnc5
| InChI = 1/C26H31Cl2N5O3/c1-19(2)31-9-11-32(12-10-31)21-4-6-22(7-5-21)34-14-23-15-35-26(36-23,16-33-18-29-17-30-33)24-8-3-20(27)13-25(24)28/h3-8,13,17-19,23H,9-12,14-16H2,1-2H3/t23-,26-/m0/s1
| InChIKey = BLSQLHNBWJLIBQ-OZXSUGGEBD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H4Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4H
| StdInChI = 1S/C26H31Cl2N5O3/c1-19(2)31-9-11-32(12-10-31)21-4-6-22(7-5-21)34-14-23-15-35-26(36-23,16-33-18-29-17-30-33)24-8-3-20(27)13-25(24)28/h3-8,13,17-19,23H,9-12,14-16H2,1-2H3/t23-,26-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BLSQLHNBWJLIBQ-OZXSUGGESA-N | StdInChIKey = LXEJRKJRKIFVNY-UHFFFAOYSA-N
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 100-20-9
⚫ | PubChem = 7488
| SMILES = O=C(Cl)c1ccc(C(Cl)=O)cc1
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>8</sub>H<sub>4</sub>Cl<sub>2</sub>O<sub>2</sub>
| MolarMass = 203.02 g/mol
| Appearance =
| Density = 1.34 g/cm<sup>3</sup>
| MeltingPt = 81.5-83 °C
| BoilingPt = 265 °C
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| Autoignition =
}}
}} }}

Revision as of 12:22, 10 January 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 441009579 of page Terephthaloyl_chloride with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Skeletal formula
Ball-and-stick model
Names
IUPAC name Terephthaloyl dichloride
Other names 1,4-Benzenedicarbonyl chloride, Benzene-1,4-dicarbonyl chloride, Terephthalic acid dichloride, Terephthaloyl dichloride, p-Phthalyl chloride, TCL
Identifiers
CAS Number
3D model (JSmol)
ChemSpider
PubChem CID
InChI
  • InChI=1S/C8H4Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4HKey: LXEJRKJRKIFVNY-UHFFFAOYSA-N
  • InChI=1/C8H4Cl2O2/c9-7(11)5-1-2-6(4-3-5)8(10)12/h1-4HKey: LXEJRKJRKIFVNY-UHFFFAOYAY
SMILES
  • O=C(Cl)c1ccc(C(Cl)=O)cc1
Properties
Chemical formula C8H4Cl2O2
Molar mass 203.02 g/mol
Density 1.34 g/cm
Melting point 81.5-83 °C
Boiling point 265 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Chemical compound