Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:59, 10 January 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 460466915 of page Thiethylperazine for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit		Revision as of 13:00, 10 January 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 465715899 of page Thiirane for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{Chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
			\| Watchedfields = changed
	\| verifiedrevid = 410150244
			\| verifiedrevid = 433987901
	\| IUPAC_name = 2-(ethylthio)-10--10''H''-phenothiazine
			\| ImageFile2 = Ethylene-sulfide-3D-balls.png
	\| image = Thiethylperazine structure.png
			\| ImageFile2_Ref = {{chemboximage\|correct\|??}}

			\| ImageSize2 = 121
	<!--Clinical data-->
			\| ImageName2 = Ball and model of thiirane
	\| tradename =
			\| ImageFileL1 = Ethylene-sulfide-2D-skeletal.png
	\| Drugs.com = {{drugs.com\|CONS\|thiethylperazine}}
			\| ImageFileL1_Ref = {{chemboximage\|correct\|??}}
	\| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
			\| ImageSizeL1 = 121
	\| pregnancy_US = <!-- A / B / C / D / X -->
			\| ImageNameL1 = Skeletal formula of thiirane
	\| pregnancy_category =
			\| ImageFileR1 = Ethylene-sulfide-3D-vdW.png
	\| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
			\| ImageFileR1_Ref = {{chemboximage\|correct\|??}}
	\| legal_UK = <!-- GSL / P / POM / CD -->
			\| ImageSizeR1 = 121
	\| legal_US = <!-- OTC / Rx-only -->
			\| ImageNameR1 = Spacefill model of thiirane
	\| legal_status =
			\| SystematicName = Thiirane<ref name = "thiirane (CHEBI:30977)" >{{Cite web\|url = http://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:30977\|title = thiirane (CHEBI:30977)\|work = Chemical Entities of Biological Interest (ChEBI)\|location = UK\|publisher = European Bioinformatics Institute}}</ref>
	\| routes_of_administration =
			\| OtherNames = 2,3-Dihydrothiirene<ref name = "thiirane (CHEBI:30977)" /><br />

			Ethylene sulfide<ref name = "thiirane (CHEBI:30977)" /><br />
	<!--Pharmacokinetic data-->
			Thiacyclopropane<ref name = "thiirane (CHEBI:30977)" />
	\| bioavailability =
			\| Section1 = {{Chembox Identifiers
	\| protein_bound = 60%
			\| CASNo = 420-12-2
	\| metabolism =
			\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| elimination_half-life =
			\| PubChem = 9865
	\| excretion =
			\| PubChem_Ref = {{Pubchemcite\|correct\|pubchem}}

			\| ChemSpiderID = 9481
	<!--Identifiers-->
			\| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}}
	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| EINECS = 206-993-9
	\| CAS_number_Ref = {{cascite\|correct\|??}}
	\| ~~CAS_number~~ = ~~1420-55-9~~		\| UNNumber = 1992
			\| KEGG = <!-- blanked - oldvalue: C19419 -->
	\| ATC_prefix = R06
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| ATC_suffix = AD03
			\| MeSHName = ethylene+sulfide
	\| ATC_supplemental =
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
	\| PubChem = 5440
			\| ChEBI = 30977
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| ~~DrugBank~~ = ~~DB00372~~		\| RTECS = KX3500000
			\| Beilstein = 102379
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ~~ChemSpiderID~~ = ~~5245~~		\| Gmelin = 1278
			\| SMILES = C1CS1
	\| UNII_Ref = {{fdacite\|correct\|FDA}}
			\| StdInChI = 1S/C2H4S/c1-2-3-1/h1-2H2
	\| UNII = 8ETK1WAF6R
	\| ~~KEGG_Ref~~ = {{~~keggcite~~\|~~correct~~\|~~kegg~~}}		\| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}}
			\| StdInChIKey = VOVUARRWDCVURC-UHFFFAOYSA-N
	\| KEGG = D02354
	\| ~~ChEBI_Ref~~ = {{~~ebicite~~\|changed\|~~EBI~~}}		\| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}}
			}}
	\| ChEBI = 9544
			\| Section2 = {{Chembox Properties
	\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
	\| ~~ChEMBL~~ = ~~1378~~		\| C = 2
			\| H = 4

			\| S = 1
	<!--Chemical data-->
			\| ExactMass = 60.003370818 g mol<sup>−1</sup>
	\| C=22 \| H=29 \| N=3 \| S=2
			\| Appearance = Pale, yellow liquid
	\| molecular_weight = 399.618 g/mol
			\| Density = 1.01 g cm<sup>−3</sup>
	\| smiles = S(c2cc1N(c3c(Sc1cc2)cccc3)CCCN4CCN(C)CC4)CC
			\| MeltingPtC = -109
	\| InChI = 1/C22H29N3S2/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24/h4-5,7-10,17H,3,6,11-16H2,1-2H3
			\| BoilingPtK = 329
	\| InChIKey = XCTYLCDETUVOIP-UHFFFAOYAY
			\| VaporPressure = 28.6 kPa (at 20 °C)
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			}}
	\| StdInChI = 1S/C22H29N3S2/c1-3-26-18-9-10-22-20(17-18)25(19-7-4-5-8-21(19)27-22)12-6-11-24-15-13-23(2)14-16-24/h4-5,7-10,17H,3,6,11-16H2,1-2H3
			\| Section4 = {{Chembox Thermochemistry
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
			\| DeltaHf = 51-53 kJ mol<sup>-1</sup>
	\| StdInChIKey = XCTYLCDETUVOIP-UHFFFAOYSA-N
			\| DeltaHc = -2.0126 MJ mol<sup>-1</sup>
			}}
			\| Section5 = {{Chembox Hazards
			\| GHSPictograms = {{GHS flame}} {{GHS corrosion}} {{GHS skull and crossbones}}
			\| GHSSignalWord = '''DANGER'''
			\| HPhrases = {{H-phrases\|225\|301\|318\|331}}
			\| PPhrases = {{P-phrases\|210\|261\|280\|301+310\|305+351+338\|311}}
			\| EUClass = {{Hazchem F}} {{Hazchem T}}
			\| RPhrases = {{R11}}, {{R23/25}}, {{R41}}
			\| SPhrases = {{S16}}, {{S36/37/39}}, {{S45}}
			\| NFPA-F = 4
			\| NFPA-H = 3
			\| NFPA-R = 2
			\| FlashPt = 10 °C
			}}
			\| Section6 = {{Chembox Related
			\| Function = ]
			\| OtherFunctn = ]<br />]<br />]
			}}
	}}		}}