Revision as of 13:28, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 444228706 of page Thyronine for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 13:29, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447822269 of page Tiadenol for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 444227735 |
|
| verifiedrevid = 443582176 |
|
| Name=<small>L</small>-Thyronine |
|
|
|
| IUPAC_name = 2,2'-diethanol |
|
|ImageFile=Thyronine.png |
|
|
|
| image = Tiadenol.png |
|
|ImageSize=200px |
|
|
|
|
|
|IUPACName=(2''S'')-2-amino-3-propanoic acid |
|
|
|
<!--Clinical data--> |
|
|OtherNames=4-(4-hydroxyphenoxy)-<small>L</small>-phenylalanine |
|
|
|
| tradename = |
|
|Section1={{Chembox Identifiers |
|
|
|
| Drugs.com = {{drugs.com|international|tiadenol}} |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
⚫ |
| ChemSpiderID = 4574450 |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| InChI = 1/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19)/t14-/m0/s1 |
|
|
|
| pregnancy_category = |
|
| InChIKey = KKCIOUWDFWQUBT-AWEZNQCLBR |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 6964-20-1 --> |
|
|
| ATC_prefix = C10 |
|
|
| ATC_suffix = AX03 |
|
⚫ |
| PubChem = 23403 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 21885 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 22251270CX |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D07191 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=14 | H=30 | O=2 | S=2 |
|
|
| molecular_weight = 294.519 g/mol |
|
|
| smiles = OCCSCCCCCCCCCCSCCO |
|
|
| InChI = 1/C14H30O2S2/c15-9-13-17-11-7-5-3-1-2-4-6-8-12-18-14-10-16/h15-16H,1-14H2 |
|
|
| InChIKey = WRCITXQNXAIKLR-UHFFFAOYAW |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H15NO4/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13/h1-8,14,17H,9,16H2,(H,18,19)/t14-/m0/s1 |
|
| StdInChI = 1S/C14H30O2S2/c15-9-13-17-11-7-5-3-1-2-4-6-8-12-18-14-10-16/h15-16H,1-14H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KKCIOUWDFWQUBT-AWEZNQCLSA-N |
|
| StdInChIKey = WRCITXQNXAIKLR-UHFFFAOYSA-N |
|
|
| synonyms = <small>2-({10-decyl}sulfanyl)ethan-1-ol</small> |
⚫ |
| CASNo = <!-- blanked - oldvalue: 1596-67-4 --> |
|
⚫ |
| PubChem=5461103 |
|
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 30662 |
|
|
| SMILES = O=C(O)(N)Cc2ccc(Oc1ccc(O)cc1)cc2 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>15</sub>H<sub>15</sub>NO<sub>4</sub> |
|
|
| MolarMass=273.28 g/mol |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |