Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 13:43, 10 January 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 447809152 of page Tolpropamine for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit		Revision as of 13:43, 10 January 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 456670924 of page Tolterodine for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|drugbox}}) taken from revid of page ] with values updated to verified values.}}
	{{Drugbox		{{Drugbox
			\| Verifiedfields = changed
	\| verifiedrevid = ~~437200296~~		\| verifiedrevid = 409297754
	\| IUPAC_name = ''N,N''-dimethyl-3-(4-methylphenyl)-3-phenylpropan-1-amine
			\| IUPAC_name = (''R'')-2--4-methylphenol
	\| image = Tolpropamine.svg
			\| image = Tolterodin Structural Formulae.png
			\| width = 250

	<!--Clinical data-->		<!--Clinical data-->
	\| tradename =		\| tradename = Detrol
			\| Drugs.com = {{drugs.com\|monograph\|detrol}}
			\| MedlinePlus = a699026
	\| pregnancy_category =		\| pregnancy_category =
	\| legal_status =		\| legal_status =
Line 12:		Line 16:

	<!--Pharmacokinetic data-->		<!--Pharmacokinetic data-->
	\| bioavailability =		\| bioavailability = 77%
	\| protein_bound =		\| protein_bound = Approximately 96.3%.
	\| metabolism =		\| metabolism =
	\| elimination_half-life =		\| elimination_half-life = 1.9-3.7 hours
	\| excretion =

	<!--Identifiers-->		<!--Identifiers-->
			\| CASNo_Ref = {{cascite\|correct\|CAS}}
	\| CAS_number = <!-- blanked - oldvalue: 5632-44-0 -->
	\| ~~CAS_supplemental~~ = {{~~CAS~~\|~~3354-67-4~~}}		\| CAS_number_Ref = {{cascite\|correct\|??}}
			\| CAS_number = 124937-51-5
	\| ATC_prefix = D04
	\| ~~ATC_suffix~~ = ~~AA12~~		\| ATC_prefix = G04
	\| ~~PubChem~~ = ~~72141~~		\| ATC_suffix = BD07
			\| ATC_supplemental =
			\| PubChem = 443879
			\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
			\| DrugBank = DB01036
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~65115~~		\| ChemSpiderID = 391967
	\| UNII_Ref = {{fdacite\|correct\|FDA}}		\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| UNII = ~~TBZ8909KFS~~		\| UNII = WHE7A56U7K
	\| KEGG_Ref = {{keggcite\|correct\|kegg}}		\| KEGG_Ref = {{keggcite\|correct\|kegg}}
	\| KEGG = ~~D07196~~		\| KEGG = D00646
			\| ChEBI_Ref = {{ebicite\|changed\|EBI}}
			\| ChEBI = 9622
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
			\| ChEMBL = 1382

	<!--Chemical data-->		<!--Chemical data-->
	\| C=18 \| H=23 \| N=1		\| C=22 \| H=31 \| N=1 \| O=1
	\| molecular_weight = ~~253~~.~~382~~ g/mol		\| molecular_weight = 325.488 g/mol
	\| smiles = ~~c1cc~~(~~ccc1C~~(c2ccccc2)CCN(C)C)C		\| smiles = Oc1ccc(cc1(c2ccccc2)CCN(C(C)C)C(C)C)C
	\| InChI = 1/~~C18H23N~~/c1-~~15-9-11-17~~(~~12-10-15~~)18(~~13-14-19~~(2)3)16-7-5-4-6-8-16/h4-12,~~18H~~,13-14H2,1-~~3H3~~		\| InChI = 1/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1
	\| InChIKey = ~~CINROOONPHQHPO~~-~~UHFFFAOYAS~~		\| InChIKey = OOGJQPCLVADCPB-HXUWFJFHBV
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~C18H23N~~/c1-~~15-9-11-17~~(~~12-10-15~~)18(~~13-14-19~~(2)3)16-7-5-4-6-8-16/h4-12,~~18H~~,13-14H2,1-~~3H3~~		\| StdInChI = 1S/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~CINROOONPHQHPO~~-~~UHFFFAOYSA~~-N		\| StdInChIKey = OOGJQPCLVADCPB-HXUWFJFHSA-N
	}}		}}

Revision as of 13:43, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 456670924 of page Tolterodine with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data

Trade names	Detrol
AHFS/Drugs.com	Monograph
MedlinePlus	a699026
ATC code	G04BD07 (WHO)
Pharmacokinetic data
Bioavailability	77%
Protein binding	Approximately 96.3%.
Elimination half-life	1.9-3.7 hours
Identifiers
IUPAC name (R)-2--4-methylphenol
CAS Number	124937-51-5
PubChem CID	443879
DrugBank	DB01036
ChemSpider	391967
UNII	WHE7A56U7K
KEGG	D00646
ChEBI	CHEBI:9622
ChEMBL	ChEMBL1382
Chemical and physical data
Formula	C₂₂H₃₁NO
Molar mass	325.488 g/mol g·mol
3D model (JSmol)	Interactive image
SMILES Oc1ccc(cc1(c2ccccc2)CCN(C(C)C)C(C)C)C
InChI InChI=1S/C22H31NO/c1-16(2)23(17(3)4)14-13-20(19-9-7-6-8-10-19)21-15-18(5)11-12-22(21)24/h6-12,15-17,20,24H,13-14H2,1-5H3/t20-/m1/s1 Key:OOGJQPCLVADCPB-HXUWFJFHSA-N
(what is this?) (verify)