Revision as of 13:46, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 465807331 of page Torreyanic_acid for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 13:46, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460518569 of page Tositumomab for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 409083424 |
|
| Watchedfields = changed |
|
|
|
|
⚫ |
| verifiedrevid = 458613030 |
|
|
|
<!--Monoclonal antibody data--> |
|
| IUPAC_name = (2E,2'E)-4,4'-benzoxirenoisochromene-7a,11a(5H,11H)-diyl]bis(2-met hylbut-2-enoic acid) |
|
|
|
| type = mab |
|
| image = torreyanic_acid.png |
|
|
| width = 171 |
|
| mab_type = mab |
|
|
| source = o |
|
|
| target = ] |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|monograph|tositumomab}} |
|
|
| MedlinePlus = a609013 |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
|
| legal_US = <!-- OTC / Rx-only --> |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
⚫ |
| ChemSpiderID = NA |
⚫ |
| CAS_number = <!-- blanked - oldvalue: 176260-42-7 --> |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
⚫ |
| ATC_prefix = none |
|
|
|
| CAS_number = 192391-48-3 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| ATC_prefix = V10 |
|
| StdInChI = 1S/C38H44O12/c1-5-7-9-11-21-23-24-25(28(40)32-36(49-32,29(24)41)15-13-18(3)33(42)43)30(48-21)38-20(17-47-22(26(23)38)12-10-8-6-2)27(39)31-37(50-31,35(38)46)16-14-19(4)34(44)45/h13-14,17,21-23,26,30-32H,5-12,15-16H2,1-4H3,(H,42,43)(H,44,45)/b18-13+,19-14+/t21?,22-,23?,26+,30?,31+,32+,36-,37+,38-/m1/s1 |
|
|
|
| ATC_suffix = XA53 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| ATC_supplemental = (sequential regimen with <sup>131</sup>I form) |
|
| StdInChIKey = DQBVXDMPCDAQGS-YOWCJFHESA-N |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00081 |
⚫ |
| ChemSpiderID = 10307511 |
|
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
|
|
|
| UNII = 0343IGH41U |
|
<!--Chemical data--> |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| C=38 | H=44 | O=12 |
|
|
|
| KEGG = D08622 |
⚫ |
| molecular_weight = 692.7488 g/mol |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| smiles = O2\C=C/4(O)1O1(CO)42O3O((O)(O)3O)CO |
|
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1201604 --> |
|
| InChI = 1/C15H22O10/c16-3-6-9(19)10(20)11(21)14(23-6)24-13-7-5(1-2-22-13)8(18)12-15(7,4-17)25-12/h1-2,5-14,16-21H,3-4H2/t5-,6-,7-,8+,9-,10+,11-,12+,13+,14+,15-/m1/s1 |
|
|
|
| C=6416 | H=9874 | N=1688 | O=1987 | S=44 |
|
| InChIKey = LHDWRKICQLTVDL-PZYDOOQIBS |
|
|
⚫ |
| molecular_weight = 143859.7 g/mol |
|
}} |
|
}} |