Revision as of 14:09, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470395667 of page Triiodothyronine for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 14:09, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456598474 of page Trilostane for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 416111658 |
|
| verifiedrevid = 402696562 |
|
| ImageFile = (S)-Triiodthyronine Structural Formulae.png |
|
|
|
| IUPAC_name = (4α,5α,17β)-3,17-dihydroxy-4,5-epoxyandrost-2-ene-2-carbonitrile |
|
| ImageSize = 250px |
|
|
|
| image = Trilostane.svg |
|
| ImageFile1 = T3-3D-balls.png |
|
|
|
|
|
| ImageSize1 = |
|
|
|
<!--Clinical data--> |
|
| IUPACName = ''(2S)''-2-amino-3- propanoic acid |
|
|
|
| tradename = |
|
| OtherNames = triiodothyronine<br>T<sub>3</sub><br>3,3',5-triiodo-<small>L</small>-thyronine |
|
|
|
| Drugs.com = {{drugs.com|monograph|tigan}} |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| ChemSpiderID = 5707 |
|
|
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 06LU7C9H1V |
|
| legal_UK = POM |
|
|
| legal_status = Veterinary use<small> (U.S.)</small> |
|
| InChI = 1/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1 |
|
|
|
| routes_of_administration = oral |
|
| InChIKey = AUYYCJSJGJYCDS-LBPRGKRZBY |
|
|
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
<!--Pharmacokinetic data--> |
|
| ChEMBL = 1544 |
|
|
|
| metabolism = Hepatic |
|
|
| elimination_half-life = 8 hours |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 13647-35-3 --> |
|
|
| ATC_prefix = H02 |
|
|
| ATC_suffix = CA01 |
|
⚫ |
| PubChem = 656583 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB01108 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 570949 |
|
⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = L0FPV48Q5R |
|
⚫ |
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = D01180 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 32260 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = <!-- blanked - oldvalue: 1200907 --> |
|
|
| C=20 | H=27 | N=1 | O=3 |
|
|
| molecular_weight = 329.433 g/mol |
|
|
| smiles = N#C\C4=C(/O)5O35(2(1((O)CC1)(C)CC2)CC3)(C)C4 |
|
|
| InChI = 1/C20H27NO3/c1-18-7-6-14-12(13(18)3-4-15(18)22)5-8-20-17(24-20)16(23)11(10-21)9-19(14,20)2/h12-15,17,22-23H,3-9H2,1-2H3/t12-,13-,14-,15-,17+,18-,19+,20+/m0/s1 |
|
|
| InChIKey = KVJXBPDAXMEYOA-CXANFOAXBX |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1 |
|
| StdInChI = 1S/C20H27NO3/c1-18-7-6-14-12(13(18)3-4-15(18)22)5-8-20-17(24-20)16(23)11(10-21)9-19(14,20)2/h12-15,17,22-23H,3-9H2,1-2H3/t12-,13-,14-,15-,17+,18-,19+,20+/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = AUYYCJSJGJYCDS-LBPRGKRZSA-N |
|
| StdInChIKey = KVJXBPDAXMEYOA-CXANFOAXSA-N |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo = 6893-02-3 |
|
⚫ |
| PubChem = |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB00279 |
|
⚫ |
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
⚫ |
| ChEBI = 18258 |
|
|
| SMILES = c1cc(c(cc1Oc2c(cc(cc2I)C(C(=O)O)N)I)I)O |
|
|
| MeSHName = |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>15</sub>H<sub>12</sub>I<sub>3</sub>NO<sub>4</sub> |
|
|
| MolarMass = 650.9776 g mol<sup>−1</sup> |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| Solubility = |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |