Revision as of 15:53, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 464978773 of page Veratridine for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 15:53, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 467362900 of page Verteporfin for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 402873069 |
|
| verifiedrevid = 402873498 |
|
| ImageFile = Veratridine structure.png |
|
|
|
| IUPAC_name = 3-octacosa-1,3,5,7,9,11(27),12,14,16,18(25),19,21-dodecaen-9-yl]propanoic acid |
|
| ImageSize = 250px |
|
|
|
| image = Verteporfin.svg |
|
| IUPACName = |
|
|
|
|
|
| OtherNames = Veratrine<br>3-Veratroylveracevine |
|
|
|
<!--Clinical data--> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| tradename = |
|
| InChI = 1/C36H51NO11/c1-19-6-11-26-31(3,40)35(43)25(17-37(26)16-19)33(42)18-34-24(32(33,41)15-27(35)38)10-9-23-30(34,2)13-12-28(36(23,44)48-34)47-29(39)20-7-8-21(45-4)22(14-20)46-5/h7-8,14,19,23-28,38,40-44H,6,9-13,15-18H2,1-5H3/t19-,23?,24-,25-,26-,27-,28?,30-,31+,32+,33+,34+,35-,36-/m0/s1 |
|
|
|
| Drugs.com = {{drugs.com|monograph|verteporfin}} |
|
| InChIKey = FVECELJHCSPHKY-XHAQNIINBL |
|
|
|
| MedlinePlus = a607060 |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| pregnancy_category = |
|
| StdInChI = 1S/C36H51NO11/c1-19-6-11-26-31(3,40)35(43)25(17-37(26)16-19)33(42)18-34-24(32(33,41)15-27(35)38)10-9-23-30(34,2)13-12-28(36(23,44)48-34)47-29(39)20-7-8-21(45-4)22(14-20)46-5/h7-8,14,19,23-28,38,40-44H,6,9-13,15-18H2,1-5H3/t19-,23?,24-,25-,26-,27-,28?,30-,31+,32+,33+,34+,35-,36-/m0/s1 |
|
|
|
| legal_status = |
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| routes_of_administration = ] |
⚫ |
| StdInChIKey = FVECELJHCSPHKY-XHAQNIINSA-N |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
|
|
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CASNo = 71-62-5 |
|
|
|
| CAS_number = 129497-78-5 |
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 451227 --> |
|
|
| PubChem = 6280 |
|
| ATC_prefix = S01 |
|
|
| ATC_suffix = LA01 |
|
|
| ATC_supplemental = |
|
|
| PubChem = 5362420 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00460 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID=16498858 |
|
| ChemSpiderID = 21106402 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| IUPHAR_ligand = 2626 |
|
|
|
| UNII = 0X9PA28K43 |
|
| SMILES = COc1ccc(cc1OC)C(=O)OC6CC8(C)C7CC38(C4(O)5CN2C(C)CC2(C)(O)5(O)(O)C34O)O67O |
|
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
}} |
|
|
|
| KEGG = D01162 |
|
| Section2 = {{Chembox Properties |
|
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| Formula = C<sub>36</sub>H<sub>51</sub>NO<sub>11</sub> |
|
|
|
| ChEBI = 60775 |
|
| MolarMass = 673.79 g/mol |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| Appearance = |
|
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1200573 --> |
|
| Density = |
|
|
| MeltingPt = |
|
| C=41 | H=42 | N=4 | O=8 |
|
|
| molecular_weight = 718.794 g/mol |
|
| BoilingPt = |
|
|
|
| smiles = COC(=O)2C(=C\C=C3\c1cc6nc(cc5nc(cc4nc(cc(n1)23C)C(/C)=C4/CCC(=O)OC)c(CCC(O)=O)c5C)C(/C=C)=C6/C)/C(=O)OC |
|
| Solubility = |
|
|
|
| InChI = 1/C41H42N4O8/c1-9-23-20(2)29-17-34-27-13-10-26(39(49)52-7)38(40(50)53-8)41(27,5)35(45-34)19-30-22(4)25(12-15-37(48)51-6)33(44-30)18-32-24(11-14-36(46)47)21(3)28(43-32)16-31(23)42-29/h9-10,13,16-19,38,43,45H,1,11-12,14-15H2,2-8H3,(H,46,47)/b31-16-,33-18-,34-17-,35-19-/t38-,41+/m0/s1 |
|
}} |
|
|
|
| InChIKey = ZCQHFRFEJXRZDF-YWANUUMDBT |
|
| Section3 = {{Chembox Hazards |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| MainHazards = |
|
|
|
| StdInChI = 1S/C41H42N4O8/c1-9-23-20(2)29-17-34-27-13-10-26(39(49)52-7)38(40(50)53-8)41(27,5)35(45-34)19-30-22(4)25(12-15-37(48)51-6)33(44-30)18-32-24(11-14-36(46)47)21(3)28(43-32)16-31(23)42-29/h9-10,13,16-19,38,43,45H,1,11-12,14-15H2,2-8H3,(H,46,47)/b31-16-,33-18-,34-17-,35-19-/t38-,41+/m0/s1 |
|
| FlashPt = |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| Autoignition = |
|
|
⚫ |
| StdInChIKey = ZCQHFRFEJXRZDF-YWANUUMDSA-N |
|
}} |
|
|
}} |
|
}} |