Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 16:07, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 463575770 of page Voriconazole for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 16:07, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 469158051 of page Vorinostat for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
⚫ | verifiedrevid = 419990921
| Verifiedfields = changed
| IUPAC_name = ''N''-hydroxy-''N''<nowiki>'</nowiki>-phenyl-octanediamide
⚫ | verifiedrevid = 440449598
⚫ | image = Vorinostat.svg
| IUPAC_name = (2''R'',3''S'')-2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1''H''-1,2,4-triazol-1-yl)butan-2-ol
⚫ | image = Voriconazole.png


<!--Clinical data--> <!--Clinical data-->
| tradename = Vfend | tradename = Zolinza
| Drugs.com = {{drugs.com|monograph|voriconazole}} | Drugs.com = {{drugs.com|monograph|vorinostat}}
| MedlinePlus = a605022 | MedlinePlus = a607050
| licence_US = Vorinostat
| licence_EU = Vfend <!-- EMEA requires brand name -->
| licence_US = Voriconazole <!-- FDA may use generic name --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_category = D | pregnancy_US = D
| pregnancy_category =
⚫ | legal_status = Rx-only
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
⚫ | routes_of_administration = IV, oral
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = Rx-only
⚫ | legal_status =
⚫ | routes_of_administration = Oral


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 96% | bioavailability =
| protein_bound = 58% | protein_bound = 71%
| metabolism = ] cytochrome P450 enzymes ], ], ] | metabolism = ] ] and ]<br>] system not involved
| elimination_half-life = Dose-dependent | elimination_half-life = 2 hours
| excretion = ] (negligible)


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 137234-62-9 | CAS_number = 149647-78-9
| ATC_prefix = J02 | ATC_prefix = L01
| ATC_suffix = AC03 | ATC_suffix = XX38
⚫ | PubChem = 5311
| ATC_supplemental =
⚫ | PubChem = 71616
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00582 | DrugBank = DB02546
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 64684 | ChemSpiderID = 5120
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = JFU09I87TR | UNII = 58IFB293JI
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00578 | KEGG = D06320
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 10023
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 638 | ChEMBL = 98


<!--Chemical data--> <!--Chemical data-->
| C=16 | H=14 | F=3 | N=5 | O=1 | C=14 | H=20 | N=2 | O=3
| molecular_weight = 349.311 g/mol | molecular_weight = 264.32 g/mol
| smiles = Fc1cncnc1((O)(c2ccc(F)cc2F)Cn3ncnc3)C | smiles = O=C(Nc1ccccc1)CCCCCCC(=O)NO
| InChI = 1/C16H14F3N5O/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18/h2-5,7-10,25H,6H2,1H3/t10-,16+/m0/s1 | InChI = 1/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18)
| InChIKey = BCEHBSKCWLPMDN-MGPLVRAMBL | InChIKey = WAEXFXRVDQXREF-UHFFFAOYAY
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H14F3N5O/c1-10(15-14(19)5-20-7-22-15)16(25,6-24-9-21-8-23-24)12-3-2-11(17)4-13(12)18/h2-5,7-10,25H,6H2,1H3/t10-,16+/m0/s1 | StdInChI = 1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = BCEHBSKCWLPMDN-MGPLVRAMSA-N | StdInChIKey = WAEXFXRVDQXREF-UHFFFAOYSA-N
}} }}

Revision as of 16:07, 10 January 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 469158051 of page Vorinostat with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
Trade namesZolinza
AHFS/Drugs.comMonograph
MedlinePlusa607050
License data
Routes of
administration		Oral
ATC code
Legal status
Legal status
Pharmacokinetic data
Protein binding71%
MetabolismHepatic glucuronidation and oxidation
CYP system not involved
Elimination half-life2 hours
ExcretionRenal (negligible)
Identifiers
IUPAC name
  • N-hydroxy-N'-phenyl-octanediamide
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC14H20N2O3
Molar mass264.32 g/mol g·mol
3D model (JSmol)
SMILES
  • O=C(Nc1ccccc1)CCCCCCC(=O)NO
InChI
  • InChI=1S/C14H20N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-5,8-9,19H,1-2,6-7,10-11H2,(H,15,17)(H,16,18)
  • Key:WAEXFXRVDQXREF-UHFFFAOYSA-N
  (verify)