Revision as of 16:31, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456598584 of page Zafirlukast for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 16:31, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 466286376 of page Zaleplon for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 420280181 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = ''N''-(3-(3-cyanopyrazolo pyrimidin-7-yl)phenyl)-''N''- ethylacetamide |
⚫ |
| verifiedrevid = 415866192 |
|
|
|
| image = Zaleplon Structural Formulae V.1.svg |
|
| IUPAC_name = cyclopentyl 3-{2-methoxy-4-benzyl}-1-methyl-1''H''-indol-5-ylcarbamate |
|
|
⚫ |
| width = 140 |
|
| image = Zafirlukast.svg |
|
⚫ |
| width = 250 |
|
|
| image2 = Zafirlukast 3D ball-and-stick.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Accolate |
|
| tradename = Sonata |
|
| Drugs.com = {{drugs.com|monograph|zafirlukast}} |
|
| Drugs.com = {{drugs.com|monograph|zaleplon}} |
|
| MedlinePlus = a697007 |
|
| MedlinePlus = a601251 |
|
|
| pregnancy_US = C |
|
| pregnancy_category = B1 <small>(Australia)</small>, B <small>(United States)</small> |
|
|
|
| legal_US = Schedule IV |
|
| legal_status = ] <small>(UK)</small> |
|
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = Unknown |
|
| bioavailability = 30% (oral) |
|
⚫ |
| metabolism = ] |
|
| protein_bound = 99% |
|
|
⚫ |
| elimination_half-life = 1 hour |
⚫ |
| metabolism = ] (]-mediated) |
|
|
⚫ |
| excretion = ] |
⚫ |
| elimination_half-life = 10 hours |
|
⚫ |
| excretion = Biliary |
|
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 107753-78-6 |
|
| CAS_number = 151319-34-5 |
|
| ATC_prefix = R03 |
|
| ATC_prefix = N05 |
|
| ATC_suffix = DC01 |
|
| ATC_suffix = CF03 |
|
| PubChem = 5717 |
|
| PubChem = 5719 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00549 |
|
| DrugBank = DB00962 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5515 |
|
| ChemSpiderID = 5517 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = XZ629S5L50 |
|
| UNII = S62U433RMH |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00411 |
|
| KEGG = D00530 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI = 10100 |
|
| ChEBI = 10102 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 603 |
|
| ChEMBL = 1521 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=31 | H=33 | N=3 | O=6 | S=1 |
|
| C=17 | H=15 | N=5 | O=1 |
|
| molecular_weight = 575.676 ]/] |
|
| molecular_weight = 305.34 |
|
| smiles = O=S(=O)(c1ccccc1C)NC(=O)c2ccc(c(OC)c2)Cc4c3cc(ccc3n(c4)C)NC(=O)OC5CCCC5 |
|
| smiles = O=C(N(c3cccc(c1ccnc2c(C#N)cnn12)c3)CC)C |
|
| InChI = 1/C31H33N3O6S/c1-20-8-4-7-11-29(20)41(37,38)33-30(35)22-13-12-21(28(17-22)39-3)16-23-19-34(2)27-15-14-24(18-26(23)27)32-31(36)40-25-9-5-6-10-25/h4,7-8,11-15,17-19,25H,5-6,9-10,16H2,1-3H3,(H,32,36)(H,33,35) |
|
| InChI = 1/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
|
| InChIKey = YEEZWCHGZNKEEK-UHFFFAOYAR |
|
| InChIKey = HUNXMJYCHXQEGX-UHFFFAOYAO |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C31H33N3O6S/c1-20-8-4-7-11-29(20)41(37,38)33-30(35)22-13-12-21(28(17-22)39-3)16-23-19-34(2)27-15-14-24(18-26(23)27)32-31(36)40-25-9-5-6-10-25/h4,7-8,11-15,17-19,25H,5-6,9-10,16H2,1-3H3,(H,32,36)(H,33,35) |
|
| StdInChI = 1S/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YEEZWCHGZNKEEK-UHFFFAOYSA-N |
|
| StdInChIKey = HUNXMJYCHXQEGX-UHFFFAOYSA-N |
|
}} |
|
}} |