| Revision as of 16:31, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 466286376 of page Zaleplon for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Revision as of 16:31, 10 January 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456828693 of page Zalutumumab for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 420280181 |
|
| verifiedrevid = 447746222 |
|
|
| image = |
|
| IUPAC_name = ''N''-(3-(3-cyanopyrazolo pyrimidin-7-yl)phenyl)-''N''- ethylacetamide |
|
|
|
|
|
| image = Zaleplon Structural Formulae V.1.svg |
|
|
|
<!--Monoclonal antibody data--> |
|
| width = 140 |
|
|
|
| type = mab |
|
|
| mab_type = mab |
|
|
| source = u |
|
|
| target = ] |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = Sonata |
|
| tradename = |
|
|
| pregnancy_AU = |
|
| Drugs.com = {{drugs.com|monograph|zaleplon}} |
|
|
| MedlinePlus = a601251 |
|
| pregnancy_US = |
|
| pregnancy_US = C |
|
| pregnancy_category = |
|
| legal_US = Schedule IV |
|
| legal_AU = |
|
|
| legal_CA = |
| ⚫ |
| routes_of_administration = Oral |
|
|
|
| legal_UK = |
|
|
| legal_US = |
|
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = 30% (oral) |
|
| bioavailability = |
|
|
| protein_bound = |
|
| metabolism = ] |
|
| metabolism = |
|
| elimination_half-life = 1 hour |
|
| elimination_half-life = |
|
| excretion = ] |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 151319-34-5 |
|
| CAS_number = <!-- blanked - oldvalue: 667901-13-5 --> |
|
| ATC_prefix = N05 |
|
| ATC_prefix = none |
|
| ATC_suffix = CF03 |
|
| ATC_suffix = |
|
| PubChem = 5719 |
|
| PubChem = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB00962 |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID = 5517 |
|
| ChemSpiderID = NA |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = S62U433RMH |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00530 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 10102 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1521 |
|
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=17 | H=15 | N=5 | O=1 |
|
| C=6512 | H=10074 | N=1734 | O=2032 | S=46 |
|
| molecular_weight = 305.34 |
|
| molecular_weight = 148 ] |
|
| smiles = O=C(N(c3cccc(c1ccnc2c(C#N)cnn12)c3)CC)C |
|
|
| InChI = 1/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
|
|
| InChIKey = HUNXMJYCHXQEGX-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C17H15N5O/c1-3-21(12(2)23)15-6-4-5-13(9-15)16-7-8-19-17-14(10-18)11-20-22(16)17/h4-9,11H,3H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = HUNXMJYCHXQEGX-UHFFFAOYSA-N |
|
|
}} |
|
}} |
