Revision as of 12:24, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474003222 of page Ursolic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 12:24, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474000857 of page Trimethylamine_N-oxide for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{chembox |
|
|
| Name=Trimethylamine ''N''-oxide |
|
| Verifiedfields = changed |
|
|
⚫ |
| verifiedrevid = 470615425 |
|
| Watchedfields = changed |
|
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
⚫ |
| verifiedrevid = 441366398 |
|
|
⚫ |
| ImageFile=Trimethylaminoxid.svg |
|
| Name = Ursolic acid |
|
|
⚫ |
|ImageSize= 150 |
⚫ |
| ImageFile = Ursolic acid.svg |
|
|
|
|PIN= ''N'',''N''-dimethylmethanamine oxide |
⚫ |
| ImageSize = 250px |
|
|
|
|IUPACName= trimethylamine oxide |
|
| ImageName = |
|
|
|
|OtherNames= trimethylamine oxide, TMAO, TMANO |
|
| IUPACName = (1''S'',2''R'',4a''S'',6a''R'',6a''S'',6b''R'',8a''R'',10''S'',12a''R'',14b''S'')-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1''H''-picene-4a-carboxylic acid<ref name="pubchem">{{PubChem|64945}}</ref> |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| OtherNames = Prunol, Malol, ''beta''-Ursolic acid, NSC4060, CCRIS 7123, TOS-BB-0966, 3-''beta''-hydroxyurs-12-en-28-oic acid<ref name="pubchem"/> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| PubChem = 64945 |
|
| ChemSpiderID = 1113 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| ChEMBL = 169 |
|
| UNII = FLD0K1SJ1A |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ChEBI = 9908 |
|
| KEGG = C01104 |
|
|
| InChI = 1/C3H9NO/c1-4(2,3)5/h1-3H3 |
|
| SMILES = O=C(O)54(/C3=C/C1(CC21(C)CC(O)C2(C)C)(C)3(C)CC4)(C)(C)CC5 |
|
|
|
| InChIKey = UYPYRKYUKCHHIB-UHFFFAOYAU |
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 58472 |
|
|
| InChI = 1/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
|
|
| InChIKey = WCGUUGGRBIKTOS-GPOJBZKABB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C3H9NO/c1-4(2,3)5/h1-3H3 |
|
| StdInChI = 1S/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WCGUUGGRBIKTOS-GPOJBZKASA-N |
|
| StdInChIKey = UYPYRKYUKCHHIB-UHFFFAOYSA-N |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 77-52-1 |
|
| CASNo= 1184-78-7 |
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| RTECS = |
|
| PubChem= 1145 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
⚫ |
}} |
|
|
|
| ChEBI = 15724 |
⚫ |
| Section2 = {{Chembox Properties |
|
|
| C=30|H=48|O=3 |
|
| SMILES = C(C)(C) |
|
⚫ |
}} |
⚫ |
| Appearance = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| Density = |
|
|
|
| C=3 | H = 9 | N = 1 | O = 1 |
⚫ |
| Solubility = |
|
|
|
| MolarMass=75.11 |
|
| MeltingPt = |
|
|
⚫ |
| Appearance= colourless solid |
|
| BoilingPt = |
|
|
| pKa = |
|
| Density= |
|
|
| MeltingPt= 220–222 °C (hydrate: 96 °C) |
|
| pKb = |
|
|
| Viscosity = |
|
| BoilingPt= |
|
⚫ |
| Solubility= good |
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| MolShape = |
|
|
| Coordination = |
|
|
| CrystalStruct = |
|
|
| Dipole = |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
}} |
|
|
| Section8 = {{Chembox Related |
|
|
| OtherAnions = |
|
|
| OtherCations = |
|
|
| OtherCpds = |
|
|
}} |
|
}} |
|
}} |
|
}} |