Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 12:24, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474003222 of page Ursolic_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 12:24, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474000857 of page Trimethylamine_N-oxide for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| Name=Trimethylamine ''N''-oxide
| Verifiedfields = changed
| verifiedrevid = 470615425
| Watchedfields = changed
| ImageFile_Ref = {{chemboximage|correct|??}}
| verifiedrevid = 441366398
| ImageFile=Trimethylaminoxid.svg
| Name = Ursolic acid
|ImageSize= 150
| ImageFile = Ursolic acid.svg
|PIN= ''N'',''N''-dimethylmethanamine oxide
| ImageSize = 250px
|IUPACName= trimethylamine oxide
| ImageName =
|OtherNames= trimethylamine oxide, TMAO, TMANO
| IUPACName = (1''S'',2''R'',4a''S'',6a''R'',6a''S'',6b''R'',8a''R'',10''S'',12a''R'',14b''S'')-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1''H''-picene-4a-carboxylic acid<ref name="pubchem">{{PubChem|64945}}</ref>
|Section1={{Chembox Identifiers
| OtherNames = Prunol, Malol, ''beta''-Ursolic acid, NSC4060, CCRIS 7123, TOS-BB-0966, 3-''beta''-hydroxyurs-12-en-28-oic acid<ref name="pubchem"/>
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Section1 = {{Chembox Identifiers
| PubChem = 64945 | ChemSpiderID = 1113
| ChEMBL_Ref = {{ebicite|correct|EBI}} | UNII_Ref = {{fdacite|correct|FDA}}
| ChEMBL = 169 | UNII = FLD0K1SJ1A
| ChEBI_Ref = {{ebicite|changed|EBI}} | KEGG_Ref = {{keggcite|correct|kegg}}
| ChEBI = 9908 | KEGG = C01104
| InChI = 1/C3H9NO/c1-4(2,3)5/h1-3H3
| SMILES = O=C(O)54(/C3=C/C1(CC21(C)CC(O)C2(C)C)(C)3(C)CC4)(C)(C)CC5
| InChIKey = UYPYRKYUKCHHIB-UHFFFAOYAU
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 58472
| InChI = 1/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1
| InChIKey = WCGUUGGRBIKTOS-GPOJBZKABB
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C3H9NO/c1-4(2,3)5/h1-3H3
| StdInChI = 1S/C30H48O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WCGUUGGRBIKTOS-GPOJBZKASA-N | StdInChIKey = UYPYRKYUKCHHIB-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 77-52-1 | CASNo= 1184-78-7
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS = | PubChem= 1145
| ChEBI_Ref = {{ebicite|correct|EBI}}
}}
| ChEBI = 15724
| Section2 = {{Chembox Properties
| C=30|H=48|O=3 | SMILES = C(C)(C)
}}
| Appearance =
|Section2={{Chembox Properties
| Density =
| C=3 | H = 9 | N = 1 | O = 1
| Solubility =
| MolarMass=75.11
| MeltingPt =
| Appearance= colourless solid
| BoilingPt =
| pKa = | Density=
| MeltingPt= 220–222 °C (hydrate: 96 °C)
| pKb =
| Viscosity = | BoilingPt=
| Solubility= good
}}
| Section3 = {{Chembox Structure
| MolShape =
| Coordination =
| CrystalStruct =
| Dipole =
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards =
| FlashPt =
| RPhrases =
| SPhrases =
}}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherCpds =
}} }}
}} }}

Revision as of 12:24, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 474000857 of page Trimethylamine_N-oxide with values updated to verified values.
Trimethylamine N-oxide
Names
IUPAC name trimethylamine oxide
Preferred IUPAC name N,N-dimethylmethanamine oxide
Other names trimethylamine oxide, TMAO, TMANO
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
KEGG
PubChem CID
UNII
InChI
  • InChI=1S/C3H9NO/c1-4(2,3)5/h1-3H3Key: UYPYRKYUKCHHIB-UHFFFAOYSA-N
  • InChI=1/C3H9NO/c1-4(2,3)5/h1-3H3Key: UYPYRKYUKCHHIB-UHFFFAOYAU
SMILES
  • C(C)(C)
Properties
Chemical formula C3H9NO
Molar mass 75.11
Appearance colourless solid
Melting point 220–222 °C (hydrate: 96 °C)
Solubility in water good
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound