Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:38, 15 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475007563 of page Silicon_monoxide for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey').← Previous edit		Revision as of 12:38, 15 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476320526 of page Boric_acid for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{Chembox		{{Chembox
		⚫	\| verifiedrevid = 464184931
	\| Verifiedfields = changed
			\| ImageFileL1_Ref = {{chemboximage\|correct\|??}}
⚫	\| verifiedrevid = ~~464361931~~
			\| ImageFileL1 = Boric-acid-2D.png
	\| PIN = Silicon monoxide
			\| ImageSizeL1 = 100px
⚫	\| ~~Section1~~ = {{Chembox ~~Identifiers~~
			\| ImageNameL1 = Structural formula
	\| InChI = 1/OSi/c1-2
			\| ImageFileR1 = Boric-acid-3D-vdW.png
	\| InChIKey = LIVNPJMFVYWSIS-UHFFFAOYAO
			\| ImageSizeR1 = 120px
	\| InChI1 = 1S/OSi/c1-2
			\| ImageNameR1 = Space-filling model
	\| InChIKey1 = LIVNPJMFVYWSIS-UHFFFAOYSA-N
			\| ImageFile2 = Boric acid.jpg
	\| CASNo = 10097-28-6
			\| ImageSize2 = 150px
⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| ImageName2 = Boric acid crystals
⚫	\| PubChem = ~~66241~~
			\| IUPACName = Boric acid<br />Trihydroxidoboron<!-- This second IUPAC name has not been validated -->
	\| PubChem_Ref = {{Pubchemcite \| correct \| PubChem}}
			\| OtherNames = Orthoboric acid,<br/>Boracic acid,<br/>Sassolite,<br/>Optibor,<br/>Borofax
⚫	\| ChemSpiderID = ~~59626~~
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| Section1 = {{Chembox Identifiers
			\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
		⚫	\| ChemSpiderID = 7346
⚫	\| EINECS = 233-~~232~~-8
		⚫	\| PubChem = 7628
	\| MeSHName = Silicon+monoxide
			\| SMILES1 = B(O)(O)O
⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
			\| ChEMBL_Ref = {{ebicite\|correct\|EBI}}
⚫	\| ChEBI = ~~30588~~
	\| ~~SMILES~~ = #		\| ChEMBL = 42403
	\| StdInChI_Ref = {{stdinchicite\|~~changed~~\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChI = 1S/~~OSi~~/c1-2		\| StdInChI = 1S/BH3O3/c2-1(3)4/h2-4H
	\| StdInChIKey_Ref = {{stdinchicite\|~~changed~~\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~LIVNPJMFVYWSIS~~-UHFFFAOYSA-N		\| StdInChIKey = KGBXLFKZBHKPEV-UHFFFAOYSA-N
	\| ~~Gmelin~~ = ~~382}}~~		\| CASNo = 10043-35-3
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
⚫	\| Section2 = {{Chembox Properties
		⚫	\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| Formula = SiO
		⚫	\| ChEBI = 33118
	\| MolarMass = 44.08 g/mol
			\| SMILES = OB(O)O
⚫	\| Appearance = ~~brown-black~~ ~~glassy~~ solid
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
⚫	\| Density = 2.13 g/cm<sup>3</sup>
			\| UNII = R57ZHV85D4
⚫	\| MeltingPtC = ~~1702~~
			\| KEGG_Ref = {{keggcite\|correct\|kegg}}
⚫	\| BoilingPtC = ~~1880~~
			\| KEGG = D01089
	\| Solubility = insoluble
			\| InChI=1/BH3O3/c2-1(3)4/h2-4H
			\| InChIKey = KGBXLFKZBHKPEV-UHFFFAOYAI
		⚫	\| EINECS = 233-139-2
		⚫	}}
		⚫	\| Section2 = {{Chembox Properties
			\| H = 3 \| B = 1 \| O = 3
		⚫	\| Appearance = White crystalline solid
		⚫	\| Density = 1.435 g/cm<sup>3</sup>
			\| Solubility = 2.52 g/100 mL (0 °C) <br> 4.72 g/100 mL (20 °C) <br> 5.7 g/100 mL (25 °C) <br> 19.10 g/100 mL (80 °C) <br> 27.53 g/100 mL (100 °C)
			\| SolubleOther = Soluble in lower ]s <br> moderately soluble in ] <br> very slightly soluble in ]
			\| Solvent = other solvents
		⚫	\| MeltingPtC = 170.9
		⚫	\| BoilingPtC = 300
			\| pKa = 9.24 (''see text'')
			}}
		⚫	\| Section3 = {{Chembox Structure
			\| MolShape = Trigonal planar
			\| Dipole = Zero
	}}		}}
	\| Section7 = {{Chembox Hazards		\| Section7 = {{Chembox Hazards
			\| EUClass = Harmful ('''Xn''')<br/>Repr. Cat. 2
	\| ExternalMSDS =
	\| ~~EUIndex~~ = ~~Not~~ ~~listed~~		\| RPhrases = {{R60}} {{R61}}
	\| ~~EUClass~~ =		\| SPhrases = {{S53}} {{S45}}
	\| RPhrases =
	\| SPhrases =
	\| MainHazards =
	\| NFPA-H = 1		\| NFPA-H = 1
	\| NFPA-F = 0		\| NFPA-F = 0
	\| NFPA-R = 0		\| NFPA-R = 0
	\| ~~NFPA-O~~ =		\| FlashPt = Non-flammable.
			\| LD50 = 2660 mg/kg, oral (rat)
	\| FlashPt = Non-flammable
	}}		}}
	\| Section8 = {{Chembox Related		\| Section8 = {{Chembox Related
	\| ~~OtherAnions~~ = ]<br />]<br />]		\| OtherCpds = ]<br/>]}}
	\| OtherCations = ]<br />]<br />]<br />]
	\| OtherFunctn = ]
	\| Function = ] ]s
	\| OtherCpds =
⚫	}}
	}}		}}