Revision as of 12:39, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 473571864 of page Meglumine_antimoniate for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 12:39, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 473571622 of page Sodium_stibogluconate for the Chem/Drugbox validation project (updated: 'UNII', 'ChEMBL', 'CAS_number').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 462102030 |
|
| verifiedrevid = 464404127 |
|
| IUPAC_name = Hydroxy-dioxostiborane; (2''R'',3''R'',4''R'',5''S'')-6-methylaminohexane-1,2,3,4,5-pentol |
|
| IUPAC_name = 2,4:2',4'-O-(oxydistibylidyne)bis |
|
| image = Meglumine antimoniate major component 3D.png |
|
| image = Sodium Stibogluconate.png |
|
|
| width = 300px |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|CONS|meglumine_antimoniate}} |
|
| Drugs.com = {{drugs.com|international|sodium-stibogluconate}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_UK = POM |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = IV only |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 133-51-7 --> |
|
| CAS_number = <!-- blanked - oldvalue: 16037-91-5 --> |
|
| ATC_prefix = P01 |
|
| ATC_prefix = P01 |
|
| ATC_suffix = CB01 |
|
| ATC_suffix = CB02 |
|
| ATC_supplemental = {{ATCvet|P51|AB01}} |
|
| ATC_supplemental = {{ATCvet|P51|AB02}} |
|
| PubChem = 64953 |
|
| PubChem = 16685683 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = DB05630 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 58479 |
|
| ChemSpiderID = 21106382 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = <!-- blanked - oldvalue: V083S0159D --> |
|
| ChEMBL = 239129 |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
⚫ |
| NIAID_ChemDB = 008733 |
|
|
|
| KEGG = D00582 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = <!-- blanked - oldvalue: 367144 --> |
|
⚫ |
| NIAID_ChemDB = 007935 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = Variable |
|
| chemical_formula = |
|
|
| C=12 | H=38 | Na=3 | O=26 | C=2 |
|
|
|
|
| molecular_weight = Variable |
|
| molecular_weight = 910.9 |
|
| smiles = O=(=O)O.O((O)(O)(O)CNC)CO |
|
| smiles = ...O=2(O1(=O)OC((O)CO)(O)(O1)C()=O)O((O)(O2)C()=O)(O)CO |
|
| InChI = 1/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1/rC7H17NO5.HO3Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;1-4(2)3/h4-13H,2-3H2,1H3;(H,1,2,3)/t4-,5+,6+,7+;/m0./s1 |
|
| InChI = 1/2C6H10O7.3Na.3O.2Sb/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;;;;;;;;/h2*2-5,7-8,10H,1H2,(H,12,13);;;;;;;;/q2*-2;3*+1;;;;2*+2/p-2/t2-,3?,4+,5-;2-,3-,4+,5-;;;;;;;;/m11......../s1/rC12H20O17Sb2.3Na/c13-1-3(15)7-5(17)9(11(19)20)27-30(23,25-7)29-31(24)26-8(4(16)2-14)6(18)10(28-31)12(21)22;;;/h3-10,13-18H,1-2H2,(H,19,20)(H,21,22);;;/q;3*+1/p-2/t3-,4-,5+,6+,7-,8?,9-,10-;;;/m1.../s1 |
|
| InChIKey = XOGYVDXPYVPAAQ-IZBHJHIBBT |
|
| InChIKey = RTLKTTNTVTVWPV-CIGDLYFHBG |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C7H17NO5.H2O.2O.Sb/c1-8-2-4(10)6(12)7(13)5(11)3-9;;;;/h4-13H,2-3H2,1H3;1H2;;;/q;;;;+1/p-1/t4-,5+,6+,7+;;;;/m0..../s1 |
|
| StdInChI = 1S/2C6H10O7.3Na.3O.2Sb/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;;;;;;;;/h2*2-5,7-8,10H,1H2,(H,12,13);;;;;;;;/q2*-2;3*+1;;;;2*+2/p-2/t2-,3?,4+,5-;2-,3-,4+,5-;;;;;;;;/m11......../s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = XOGYVDXPYVPAAQ-SESJOKTNSA-M |
|
| StdInChIKey = RTLKTTNTVTVWPV-UQCYVGCHSA-L |
|
}} |
|
}} |