Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions

< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively ← Previous edit Next edit →Content deleted Content addedVisual WikitextInline

Revision as of 12:40, 15 February 2012 editBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473541292 of page Paromomycin_sulfate for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit		Revision as of 12:40, 15 February 2012 edit undoBeetstra (talk \| contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 476064991 of page Copper(II)_chloride for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1:		Line 1:
	{{ambox \| text = This page contains a copy of the infobox ({{tl\|~~drugbox~~}}) taken from revid of page ] with values updated to verified values.}}		{{ambox \| text = This page contains a copy of the infobox ({{tl\|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{~~Drugbox~~		{{chembox
	\| Verifiedfields = changed		\| Verifiedfields = changed
			\| Watchedfields = changed
	\| verifiedrevid = ~~464185118~~		\| verifiedrevid = 460120755
	\| IUPAC_name = (2''R'',3''S'',4''R'',5''R'',6''S'')-5-amino-6-<br>oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-<br>3-hydroxy-cyclohexyl]oxy-2-(hydroxymethyl)oxane-3,4-diol
			\| ImageFile = Tolbachite-3D-balls.png
	\| image = Paromomycin structure.svg
			\| ImageCaption = Anhydrous
	\| width = 300
			\| ImageFile1 = Copper(II) chloride.jpg
	\| drug_name = Paromomycin
			\| ImageCaption1 = Anhydrous

			\| ImageFile2 = Cupric chloride.jpg
	<!--Clinical data-->
			\| ImageCaption2 = Dihydrate
	\| tradename =
			\| IUPACName = Copper(II) chloride<br />Copper dichloride
	\| Drugs.com = {{drugs.com\|monograph\|paromomycin-sulfate}}
			\| OtherNames = Cupric chloride
	\| MedlinePlus = a601098
			\| Section1 = {{Chembox Identifiers
	\| pregnancy_US = B
	\| legal_status = Rx only <small>]</small>
	\| routes_of_administration = Oral, ]

	<!--Pharmacokinetic data-->
	\| bioavailability = None
	\| metabolism = None
	\| elimination_half-life = ?
	\| excretion = Fecal

	<!--Identifiers-->
⚫	\| ~~CAS_number_Ref~~ = {{cascite\|correct\|??}}
	\| CAS_number = 1263-89-4
	\| ATC_prefix = A07
	\| ATC_suffix = AA06
⚫	\| PubChem = ~~441375~~
	\| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}}
	\| DrugBank = DB01421
	\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}		\| ChemSpiderID_Ref = {{chemspidercite\|correct\|chemspider}}
	\| ChemSpiderID = ~~390117~~		\| ChemSpiderID = 148374
	\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}		\| ChEMBL_Ref = {{ebicite\|changed\|EBI}}
	\| ChEMBL = <!-- blanked - oldvalue: ~~370143~~ -->		\| ChEMBL = <!-- blanked - oldvalue: 1200553 -->
			\| UNII_Ref = {{fdacite\|correct\|FDA}}
	\| C=23 \| H=47 \| N=5 \| O=18 \| S=1
			\| UNII = P484053J2Y
	\| molecular_weight = 615.629 g/mol
			\| InChI = 1/2ClH.Cu/h2*1H;/q;;+2/p-2/rCl2Cu/c1-3-2
	\| smiles = O=S(=O)(O)O.O(3(O2O(CO)(O1O(CN)(O)(O)1N)2O)(O)(N)C3N)4O((O)(O)4N)CO
			\| ChEBI_Ref = {{ebicite\|correct\|EBI}}
	\| InChI = 1/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1
			\| ChEBI = 49553
	\| InChIKey = LJRDOKAZOAKLDU-UDXJMMFXBW
			\| SMILES = ClCl
			\| InChIKey = ORTQZVOHEJQUHG-LRIOHBSEAE
			\| InChI1 = 1/2ClH.Cu/h2*1H;/q;;+2/p-2
			\| InChIKey1 = ORTQZVOHEJQUHG-NUQVWONBAE
			\| SMILES1 = ..
	\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChI_Ref = {{stdinchicite\|correct\|chemspider}}
			\| StdInChI = 1S/2ClH.Cu/h2*1H;/q;;+2/p-2
	\| StdInChI = 1S/C23H45N5O14.H2O4S/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22;1-5(2,3)4/h5-23,29-36H,1-4,24-28H2;(H2,1,2,3,4)/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+;/m1./s1
	\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}		\| StdInChIKey_Ref = {{stdinchicite\|correct\|chemspider}}
	\| StdInChIKey = ~~LJRDOKAZOAKLDU~~-~~UDXJMMFXSA~~-N		\| StdInChIKey = ORTQZVOHEJQUHG-UHFFFAOYSA-L
			\| CASNo = 7447-39-4
		⚫	\| CASNo_Ref = {{cascite\|correct\|CAS}}
			\| CASOther = <br/>10125-13-0 (dihydrate)
		⚫	\| PubChem = 24014
			\| RTECS = GL7000000
			}}
			\| Section2 = {{Chembox Properties
			\| Formula = CuCl<sub>2</sub>
			\| MolarMass = 134.45 g/mol (anhydrous)<br/>170.48 g/mol (dihydrate)
			\| Appearance = yellow-brown solid (anhydrous)<br/>blue-green solid (dihydrate)
			\| Odor = odorless
			\| Density = 3.386 g/cm<sup>3</sup> (anhydrous) <br /> 2.51 g/cm<sup>3</sup> (dihydrate)
			\| Solubility = 70.6 g/100 mL (0 °C) <br> 75.7 g/100 mL (25 °C) <br> 107.9 g/100 mL (100 °C)
			\| SolubleOther = ''methanol:'' <br> 68 g/ 100 mL (15 °C) <hr> ''ethanol:'' <br> 53 g/100 mL (15 °C) <br> soluble in ]
			\| MeltingPt = 498 °C (anhydrous) <br /> 100 °C (dehydration of dihydrate)
			\| BoilingPt = 993 °C (anhydrous, decomp)
			}}
			\| Section3 = {{Chembox Structure
			\| Coordination = ]
			\| CrystalStruct = distorted ]
			}}
			\| Section7 = {{Chembox Hazards
			\| ExternalMSDS =
			\| NFPA-H = 2
			\| NFPA-F = 0
			\| NFPA-R = 1
			\| EUClass = Not listed
			\| FlashPt = Non-flammable
			}}
			\| Section8 = {{Chembox Related
			\| OtherAnions = ]<br/>]
			\| OtherCations = ]<br/>]<br/>]
			}}
	}}		}}

Revision as of 12:40, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 476064991 of page Copper(II)_chloride with values updated to verified values.

WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Names
Anhydrous
Anhydrous
Dihydrate
IUPAC names Copper(II) chloride Copper dichloride
Other names Cupric chloride
Identifiers
CAS Number	7447-39-4
3D model (JSmol)	Interactive image Interactive image
ChEBI	CHEBI:49553
ChemSpider	148374
PubChem CID	24014
RTECS number	GL7000000
UNII	P484053J2Y
InChI InChI=1S/2ClH.Cu/h21H;/q;;+2/p-2Key: ORTQZVOHEJQUHG-UHFFFAOYSA-L InChI=1/2ClH.Cu/h21H;/q;;+2/p-2/rCl2Cu/c1-3-2Key: ORTQZVOHEJQUHG-LRIOHBSEAE InChI=1/2ClH.Cu/h2*1H;/q;;+2/p-2Key: ORTQZVOHEJQUHG-NUQVWONBAE
SMILES ClCl ..
Properties
Chemical formula	CuCl₂
Molar mass	134.45 g/mol (anhydrous) 170.48 g/mol (dihydrate)
Appearance	yellow-brown solid (anhydrous) blue-green solid (dihydrate)
Odor	odorless
Density	3.386 g/cm (anhydrous) 2.51 g/cm (dihydrate)
Melting point	498 °C (anhydrous) 100 °C (dehydration of dihydrate)
Boiling point	993 °C (anhydrous, decomp)
Solubility in water	70.6 g/100 mL (0 °C) 75.7 g/100 mL (25 °C) 107.9 g/100 mL (100 °C)
Solubility	methanol: 68 g/ 100 mL (15 °C) ethanol: 53 g/100 mL (15 °C) soluble in acetone
Structure
Crystal structure	distorted CdI₂ structure
Coordination geometry	Octahedral
Hazards
NFPA 704 (fire diamond)	2 0 1
Flash point	Non-flammable
Related compounds
Other anions	Copper(II) fluoride Copper(II) bromide
Other cations	Copper(I) chloride Silver chloride Gold(III) chloride
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references

Chemical compound