Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 13:49, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 470770203 of page Ethyl_acetate for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 13:50, 15 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 475776710 of page Sodium_acetate for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 443743534 | verifiedrevid = 464392486
| Name = Ethyl acetate | Name = Sodium acetate
| ImageFile = Sodium-acetate-2D-skeletal.png
| ImageFile1 = Ethyl acetate2.svg
| ImageSize1 = 160px | ImageSize = 150px
| ImageName1 = Skeletal formula | ImageName = Sodium acetate
| ImageFile2 = Ethyl-acetate-3D-balls.png | IUPACName = Sodium acetate
| ImageFileL1 = Acetate-anion-3D-balls.png
| ImageSize2 = 200px
| ImageSizeL1 = 120px
| ImageName2 = Ball-and-stick model
| IUPACName = Ethyl acetate | ImageNameL1 = Ball-and-stick model of the acetate anion
| ImageFileR1 = Sodium-3D.png
⚫ | SystematicName = Ethyl ethanoate
| ImageSizeR1 = 90px
| OtherNames = Ethyl ester</br>Acetic ester</br>Ester of ethanol
| ImageNameR1 = The sodium cation
| ImageFile2 = Acetate de sodium hydraté.jpg
⚫ | SystematicName = Sodium ethanoate
| OtherNames = Hot ice (Sodium acetate trihydrate)
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 27750
⚫ | SMILES = O=C(OCC)C
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 8525
⚫ | PubChem = 8857
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 76845O8NMZ | UNII = NVG71ZZ7P0
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D02319
| InChI = 1/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3
| InChIKey = XEKOWRVHYACXOJ-UHFFFAOYAD
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 14152 | ChEMBL = 1354
| InChI = 1/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
| InChIKey = VMHLLURERBWHNL-REWHXWOFAT
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
⚫ | ChEBI = 32954
⚫ | SMILES = .C(=O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 | StdInChI = 1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XEKOWRVHYACXOJ-UHFFFAOYSA-N | StdInChIKey = VMHLLURERBWHNL-UHFFFAOYSA-M
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 141-78-6 | CASNo = 127-09-3
| RTECS = AH5425000 | CASNo1 = 6131-90-4
| CASNo1_Comment = (trihydrate)
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 29105
⚫ | PubChem = 517045
| RTECS = AJ4300010 (anhydrous) <br> AJ4580000
| ATCCode_prefix = B05
| ATCCode_suffix = XA08
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Na = 1 | C = 2| H = 3 | O = 2
| Formula = C<sub>4</sub>H<sub>8</sub>O<sub>2</sub>
| MolarMass = 88.105 g/mol | MolarMass = 82.0343 g/mol (anhydrous) <br> 136.0799 g/mol (trihydrate)
| Appearance = colorless liquid | Appearance = White deliquescent powder <br> odorless
| Density = 0.897 g/cm³, liquid | Density = 1.528 g/cm<sup>3</sup> <br> 1.45 g/cm<sup>3</sup> (trihydrate)
| Solubility = 8.3 g/100 mL (20&nbsp;°C) | Solubility = 36.2 g/100 ml (0°C) <br> 46.4 g/100 mL (20°C) <br> 139 g/100 mL (60°C) <br> 170.15 g/100 mL (100°C)
| Solvent = ],</br> ], ],</br> ] | SolubleOther = soluble in ] (5.3 g/100 mL (trihydrate)
| MeltingPt = 324 °C (anhydrous) <br> 58 °C (trihydrate)
| SolubleOther = Miscible
| BoilingPt = 881.4 °C (anhydrous) <br> 122 °C (trihydrate)(decomposes)
| MeltingPtC = −83.6
| BoilingPtC = 77.1 | pKb = 9.25
⚫ | RefractIndex = 1.464
| Viscosity = 0.426 ] at 25&nbsp;°C
⚫ | RefractIndex = 1.3720
}} }}
| Section3 = {{Chembox Structure | Section3 = {{Chembox Structure
| Dipole = 1.78 ] | CrystalStruct = ]
| Dipole =
}} }}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| ExternalMSDS = | ExternalMSDS =
| MainHazards = Flammable (F),<br />Irritant (Xi) | MainHazards = Irritant
| NFPA-H = 1 | NFPA-H = 1
| NFPA-F = 3 | NFPA-F = 1
| NFPA-R = | NFPA-R = 0
| NFPA-O =
| RPhrases = {{R11}}, {{R36}}, {{R66}}, {{R67}}
⚫ | FlashPt = 250 °C
| SPhrases = {{S16}}, {{S26}}, {{S33}}
| Autoignition = 607 °C
⚫ | FlashPt = −4&nbsp;°C
| LD50 = 11.3 g/kg, rat
}} }}
| Section8 = {{Chembox Related | Section8 = {{Chembox Related
| OtherAnions = ]<br/>]
| Function = ]s
| OtherFunctn = ],<br />],<br />] | OtherCations = ]<br/>]
| OtherCpds = ],<br />]
}} }}
}} }}

Revision as of 13:50, 15 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 475776710 of page Sodium_acetate with values updated to verified values.
Sodium acetate
Sodium acetate
Ball-and-stick model of the acetate anion
Ball-and-stick model of the acetate anion
The sodium cation
The sodium cation
Names
IUPAC name Sodium acetate
Systematic IUPAC name Sodium ethanoate
Other names Hot ice (Sodium acetate trihydrate)
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
PubChem CID
RTECS number
  • AJ4300010 (anhydrous)
    AJ4580000
UNII
InChI
  • InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1Key: VMHLLURERBWHNL-UHFFFAOYSA-M
  • InChI=1/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1Key: VMHLLURERBWHNL-REWHXWOFAT
SMILES
  • .C(=O)C
Properties
Chemical formula C2H3NaO2
Molar mass 82.0343 g/mol (anhydrous)
136.0799 g/mol (trihydrate)
Appearance White deliquescent powder
odorless
Density 1.528 g/cm
1.45 g/cm (trihydrate)
Melting point 324 °C (anhydrous)
58 °C (trihydrate)
Boiling point 881.4 °C (anhydrous)
122 °C (trihydrate)(decomposes)
Solubility in water 36.2 g/100 ml (0°C)
46.4 g/100 mL (20°C)
139 g/100 mL (60°C)
170.15 g/100 mL (100°C)
Solubility soluble in ethanol (5.3 g/100 mL (trihydrate)
Basicity (pKb) 9.25
Refractive index (nD) 1.464
Structure
Crystal structure monoclinic
Hazards
Occupational safety and health (OHS/OSH):
Main hazards Irritant
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 1: Exposure would cause irritation but only minor residual injury. E.g. turpentineFlammability 1: Must be pre-heated before ignition can occur. Flash point over 93 °C (200 °F). E.g. canola oilInstability 0: Normally stable, even under fire exposure conditions, and is not reactive with water. E.g. liquid nitrogenSpecial hazards (white): no code
1 1 0
Flash point 250 °C
Related compounds
Other anions Sodium formate
Sodium propionate
Other cations Potassium acetate
Calcium acetate
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound