| Revision as of 12:29, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477073532 of page Styrene for the Chem/Drugbox validation project (updated: 'KEGG').← Previous edit |
Revision as of 12:35, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 477105089 of page Sumatriptan for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 470474818 |
|
| Watchedfields = changed |
|
|
|
| IUPAC_name = 1-- N-methyl-methanesulfonamide |
| ⚫ |
| verifiedrevid = 461937052 |
|
|
|
| image = Sumatriptan.svg |
|
| Name = Styrene |
|
|
|
|
|
| ImageFile = Styrene.svg |
|
|
|
<!--Clinical data--> |
|
| ImageSize = 150px |
|
|
|
| tradename = Imitrex |
|
| ImageFile1 = Styrene-from-xtal-2001-3D-balls.png |
|
|
|
| Drugs.com = {{drugs.com|monograph|sumatriptan}} |
|
| ImageSize1 =180px |
|
|
|
| licence_US = Sumatriptan |
|
| ImageName = Styrene |
|
|
|
| pregnancy_category = C |
|
| PIN = Phenylethene |
|
|
|
| routes_of_administration = tablet, subcutaneous injection, nasal spray |
|
| SystematicName = Ethenylbenzene |
|
|
|
|
|
| OtherNames = Vinyl benzene; cinnamene; styrol; phenylethene; diarex HF 77; styrolene; styropol; vinylbenzene |
|
|
|
<!--Pharmacokinetic data--> |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| bioavailability = 15% (oral)/ 96% (s.c) |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| protein_bound = 14%-21% |
|
| UNII = 44LJ2U959V |
|
|
|
| metabolism = ] |
|
|
| elimination_half-life = 2.5 hours |
|
|
| excretion = 60% ]; 40% ] |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 103628-46-2 |
|
|
| ATC_prefix = N02 |
|
|
| ATC_suffix = CC01 |
|
⚫ |
| PubChem = 5358 |
|
|
| IUPHAR_ligand = 54 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00669 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7220 |
|
| ChemSpiderID = 5165 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| ChEBI = 27452 |
|
| UNII = 8R78F6L9VO |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00451 |
|
| StdInChI = 1S/C8H8/c1-2-8-6-4-3-5-7-8/h2-7H,1H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 10650 |
| ⚫ |
| StdInChIKey = PPBRXRYQALVLMV-UHFFFAOYSA-N |
|
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| SMILES = c1ccccc1C=C |
|
|
⚫ |
| ChEMBL = 128 |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
|
|
| CASNo = 100-42-5 |
|
|
|
<!--Chemical data--> |
|
| RTECS = WL3675000 |
|
|
|
| C=14 | H=21 | N=3 | O=2 | S=1 |
| ⚫ |
| PubChem = 7501 |
|
|
|
| molecular_weight = 295.402 g/mol |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
| smiles = O=S(=O)(NC)Cc1cc2c(cc1)ncc2CCN(C)C |
| ⚫ |
| ChEMBL = 285235 |
|
|
|
| InChI = 1/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
|
| InChIKey = KQKPFRSPSRPDEB-UHFFFAOYAF |
|
| KEGG = <!-- blanked - oldvalue: C07083 --> |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
}} |
|
|
|
| StdInChI = 1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3 |
|
| Section2 = {{Chembox Properties |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| Formula = C<sub>8</sub>H<sub>8</sub> |
|
|
⚫ |
| StdInChIKey = KQKPFRSPSRPDEB-UHFFFAOYSA-N |
|
| MolarMass = 104.15 g/mol |
|
|
| Appearance = colorless oily liquid |
|
|
| Density = 0.909 g/cm³ |
|
|
| Solubility =< 1% |
|
|
| MeltingPtC = -30 |
|
|
| BoilingPtC = 145 |
|
|
| Viscosity = 0.762 c] at 20 °C |
|
|
| RefractIndex = 1.5469 |
|
|
}} |
|
|
| Section3 = {{Chembox Structure |
|
|
| Dipole = 0.13 ] |
|
|
}} |
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| MainHazards = flammable, toxic |
|
|
| FlashPt = 31 °C |
|
|
| NFPA-F = 3 |
|
|
| NFPA-H = 2 |
|
|
| NFPA-R = 2 |
|
|
| NFPA-O = ? |
|
|
| RPhrases = {{R10}} {{R36}} |
|
|
| SPhrases = {{S38}} {{S20}} {{S23}} |
|
|
}} |
|
|
| Section8 = {{Chembox Other |
|
|
| Function = styrenes |
|
|
| OtherFunctn = ]<br />] |
|
|
| Function = ] compounds |
|
|
| OtherFunctn = ]}} |
|
|
}} |
|
}} |
