Revision as of 15:17, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 468172549 of page 2-Bromo-LSD for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 15:17, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465322370 of page 2-Bromobutane for the Chem/Drugbox validation project (updated: '').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 456499147 |
|
| verifiedrevid = 413108754 |
|
|
|References=<ref> at ]</ref> |
|
| IUPAC_name = (6aR,9R)-5-bromo-N,N-diethyl-7-methyl-4,6,6a,7,8,9-hexahydroindoloquinoline-9-carboxamide |
|
|
|
|ImageFile=2-Bromobutane.png |
|
| image = 2-bromo-LSD_structure.svg |
|
|
|
|ImageSize=150px |
|
|
|
|
|
|IUPACName=2-Bromobutane |
|
<!--Clinical data--> |
|
|
|
|OtherNames=''sec''-Butylbromide |
|
| tradename = |
|
|
|
|Section1={{Chembox Identifiers |
|
| legal_AU = |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| legal_CA = |
|
|
| legal_UK = |
|
| ChemSpiderID = 6306 |
|
|
| InChI = 1/C4H9Br/c1-3-4(2)5/h4H,3H2,1-2H3 |
|
| legal_status = Not scheduled (USA, Germany, EU precursors) <ref></ref> |
|
|
|
| InChIKey = UPSXAPQYNGXVBF-UHFFFAOYAN |
|
| routes_of_administration = |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
|
⚫ |
| ChEMBL = 156276 |
|
<!--Pharmacokinetic data--> |
|
|
| metabolism = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
|
| CAS_number = <!-- blanked - oldvalue: 478-84-2 --> |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 9765 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C4H9Br/c1-3-4(2)5/h4H,3H2,1-2H3 |
|
| StdInChI = 1S/C20H24BrN3O/c1-4-24(5-2)20(25)12-9-14-13-7-6-8-16-18(13)15(19(21)22-16)10-17(14)23(3)11-12/h6-9,12,17,22H,4-5,10-11H2,1-3H3/t12-,17-/m1/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VKRAXSZEDRWLAG-SJKOYZFVSA-N |
|
| StdInChIKey = UPSXAPQYNGXVBF-UHFFFAOYSA-N |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=78-76-2 |
⚫ |
| ChEMBL = 274384 |
|
|
| PubChem = 10171 |
|
| PubChem=6554 |
|
|
| SMILES = BrC(C)CC |
|
|
|
|
|
}} |
|
<!--Chemical data--> |
|
|
|
|Section2={{Chembox Properties |
|
| C=20 | H=24 | Br=1 | N=3 | O=1 |
|
|
|
| Formula=C<sub>4</sub>H<sub>9</sub>Br |
|
| molecular_weight = 402.328 g/mol |
|
|
|
| MolarMass=137.02 g/mol |
|
| smiles = CCN(CC)C(=O)1CN(2CC3=C(NC4=CC=CC(=C34)C2=C1)Br)C |
|
|
|
| Appearance= |
|
| synonyms = 2-bromolysergic acid diethylamide,<br>BOL-148 |
|
|
|
| Density=1.255 g/mL |
|
|
| MeltingPt=-112 |
|
|
| BoilingPtC=91 |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |