Revision as of 17:13, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 451222764 of page 2-Aminotetralin for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 17:14, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 443314418 of page 2-Arachidonoylglycerol for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{chembox |
|
| verifiedrevid = 407810685 |
|
| verifiedrevid = 443313506 |
|
|
| ImageFile = 2ag.svg |
|
| IUPAC_name = 1,2,3,4-tetrahydronaphthalen-2-amine |
|
|
|
| ImageSize = 250px |
|
| image = 2-Aminotetralin.png |
|
|
|
| IUPACName = 1,3-Dihydroxy-2-propanyl (5Z,8Z,11Z,14Z)-5,8,11,14-eicosatetraenoate |
|
|
|
|
|
| OtherNames = 2-AG, 2-arachidonoylglycerol |
|
<!--Clinical data--> |
|
|
|
| Section1 = {{Chembox Identifiers |
|
| tradename = |
|
|
|
| InChI = 1/C23H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-22(20-24)21-25/h6-7,9-10,12-13,15-16,22,24-25H,2-5,8,11,14,17-21H2,1H3/b7-6-,10-9-,13-12-,16-15- |
|
| pregnancy_category = |
|
|
|
| InChIKey = RCRCTBLIHCHWDZ-DOFZRALJBN |
|
| legal_status = Uncontrolled |
|
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number = <!-- blanked - oldvalue: 2954-50-9 --> |
|
|
| ATC_prefix = none |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 34677 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 31912 |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 30294 |
|
| ChEMBL = 122972 |
|
|
|
|
<!--Chemical data--> |
|
|
| C=10 | H=13 | N=1 |
|
|
| molecular_weight = 147.217 g/mol |
|
|
| smiles = C1CC2=CC=CC=C2CC1N |
|
|
| InChI = 1/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2 |
|
|
| InChIKey = LCGFVWKNXLRFIF-UHFFFAOYAA |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2 |
|
| StdInChI = 1S/C23H38O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)27-22(20-24)21-25/h6-7,9-10,12-13,15-16,22,24-25H,2-5,8,11,14,17-21H2,1H3/b7-6-,10-9-,13-12-,16-15- |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = LCGFVWKNXLRFIF-UHFFFAOYSA-N |
|
| StdInChIKey = RCRCTBLIHCHWDZ-DOFZRALJSA-N |
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 53847-30-6 --> |
|
⚫ |
| PubChem = 5282280 |
|
|
| IUPHAR_ligand = 729 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 52392 |
|
|
| SMILES = O=C(OC(CO)CO)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC |
|
|
| MeSHName = |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4445451 |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>23</sub>H<sub>38</sub>O<sub>4</sub> |
|
|
| MolarMass = 378.3 g/mol |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| Solubility = |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |