Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 17:16, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 399296391 of page 2-Chloro-9,10-bis(phenylethynyl)anthracene for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit Revision as of 17:16, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 415301524 of page 2-Chloro-9,10-diphenylanthracene for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
| verifiedrevid = 399295676 | verifiedrevid = 399296473
| Name = 2-chloro-9,10-diphenyl-anthracene
| ImageFile = 2-Chloro-BPEA.svg
| ImageFile = 2-chloro-9,10-diphenylanthracene.png
| ImageSize = 250px
| ImageSize = 150px
| ImageName = Skeletal formula
| ImageAlt =
| ImageFile1 = 2-Chloro-9,10-bis(phenylethynyl)anthracene-3D-balls.png
| ImageSize1 = 250px | ImageName =
| IUPACName = 2-Chloro-9,10-diphenyl-anthracene
| ImageName1 = Ball-and-stick model
| OtherNames =
| IUPACName = 2-Chloro-9,10-bis(2-phenylethynyl)anthracene
| OtherNames = 2-Chloro-9,10-bis(phenylethynyl)anthracene, 2-Chloro-BPEA
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| Abbreviations =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| InChIKey = PLMFIWDPKYXMGE-UHFFFAOYAZ
| ChemSpiderID = 286153
| InChI = 1/C30H17Cl/c31-24-17-20-29-27(18-15-22-9-3-1-4-10-22)25-13-7-8-14-26(25)28(30(29)21-24)19-16-23-11-5-2-6-12-23/h1-14,17,20-21H
| InChIKey = YDYTTZZBQVZTPY-UHFFFAOYAF
| SMILES1 = Clc5ccc4c(C#Cc1ccccc1)c2ccccc2c(C#Cc3ccccc3)c4c5
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C30H17Cl/c31-24-17-20-29-27(18-15-22-9-3-1-4-10-22)25-13-7-8-14-26(25)28(30(29)21-24)19-16-23-11-5-2-6-12-23/h1-14,17,20-21H | StdInChI = 1S/C26H17Cl/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = YDYTTZZBQVZTPY-UHFFFAOYSA-N | StdInChIKey = PLMFIWDPKYXMGE-UHFFFAOYSA-N
| CASNo = <!-- blanked - oldvalue: 41105-36-6 --> | CASNo =
| PubChem = 323135 | CASNo_Ref =
| CASNos =
| SMILES = c1ccc(cc1)C#Cc2c3ccc(cc3c(c4ccccc42)C#Cc5ccccc5)Cl
| CASOther =
}}
| PubChem =
| EINECS =
| EC-number =
| EINECSCASNO =
| UNNumber =
| DrugBank =
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG =
| MeSHName =
| ChEBI =
| RTECS =
| ATCvet =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =
| SMILES = Clc4ccc3c(c1ccccc1c(c2ccccc2)c3c4)c5ccccc5
| InChI = 1/C26H17Cl/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17H
| Beilstein =
| Gmelin =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID =549193
| 3DMet =}}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| C=26 | H=17 | Cl=1 |
| Formula = C<sub>30</sub>H<sub>17</sub>Cl
| MolarMass = 412.91 g/mol | Appearance =
| Appearance = | Density =
| Density = | MeltingPt =
| Melting_notes =
| MeltingPt = 224 - 226 °C
| BoilingPt = | BoilingPt =
| Solubility = | Boiling_notes =
| Solubility =
}}
| SolubleOther =
| Section3 = {{Chembox Hazards
| Solvent =
| MainHazards = Irritant ('''Xi''')
| RPhrases = {{R36/37/38}} | LogP =
| SPhrases = {{S26}} | VaporPressure =
| FlashPt = | HenryConstant =
| AtmosphericOHRateConstant =
| Autoignition =
}} | pKa =
| pKb = }}
| Section3 = {{Chembox Structure
| CrystalStruct =
| Coordination =
| MolShape = }}
| Section4 = {{Chembox Thermochemistry
| DeltaHf =
| DeltaHc =
| Entropy =
| HeatCapacity = }}
| Section5 = {{Chembox Pharmacology
| AdminRoutes =
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion =
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US = }}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV =
| REFactor = }}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases =
| SPhrases =
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| LD50 =
| PEL = }}
| Section8 = {{Chembox Related
| OtherAnions =
| OtherCations =
| OtherFunctn =
| Function =
| OtherCpds = }}
}} }}

Revision as of 17:16, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 415301524 of page 2-Chloro-9,10-diphenylanthracene with values updated to verified values.
2-chloro-9,10-diphenyl-anthracene
Names
IUPAC name 2-Chloro-9,10-diphenyl-anthracene
Identifiers
3D model (JSmol)
ChemSpider
InChI
  • InChI=1S/C26H17Cl/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17HKey: PLMFIWDPKYXMGE-UHFFFAOYSA-N
  • InChI=1/C26H17Cl/c27-20-15-16-23-24(17-20)26(19-11-5-2-6-12-19)22-14-8-7-13-21(22)25(23)18-9-3-1-4-10-18/h1-17HKey: PLMFIWDPKYXMGE-UHFFFAOYAZ
SMILES
  • Clc4ccc3c(c1ccccc1c(c2ccccc2)c3c4)c5ccccc5
Properties
Chemical formula C26H17Cl
Molar mass 364.87 g·mol
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkverify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic