Revision as of 17:18, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 473800123 of page 2-Ethyl-1-butanol for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 17:18, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 465214385 of page 2-Ethylanthraquinone for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{chembox |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443347197 |
|
| verifiedrevid = 413109678 |
|
|
| Name = 2-Ethylanthraquinone |
|
| Reference = <ref name="hand">{{Citation|last=Lide|first=David R.|year=1998|title=Handbook of Chemistry and Physics|edition=87|publication-place=Boca Raton, FL|publisher=CRC Press|isbn=0-8493-0594-2|pages=3-262, 8-106, 15-20}}</ref> |
|
|
| ImageFile = 2-ethyl-1-butanol.PNG |
|
| ImageFile = 2-Ethylanthraquinone.svg |
|
|
| ImageName = Structural formula of 2-Ethylanthraquinone |
⚫ |
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
|
| ImageSize = 160 |
|
| ImageSize = 250px |
|
|
| ImageFile1 = 2-Ethylanthraquinone-3D-balls.png |
|
| ImageName = Skeletal formula of 2-ethyl-1-butanol with some implicit hydrogens shown |
|
|
|
| ImageName1 = Ball-and-stick model |
|
| PIN = 2-Ethyl-1-butanol{{Citation needed|date=January 2012}} |
|
|
|
| ImageSize1 = 230px |
|
| SystematicName = 2-Ethylbutan-1-ol<ref>{{Cite web|title=2-ethyl-1-butanol - Compound Summary|url=http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7358&loc=ec_rcs|work=PubChem Compound|publisher=National Center for Biotechnology Information|accessdate=28 January 2012|location=USA|date=26 March 2005|at=Identification and Related Records}}</ref> |
|
|
|
| OtherNames = 2-Ethyl-9,10-anthracenedione |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
| CASNo = <!-- blanked - oldvalue: 97-95-0 --> |
|
|
⚫ |
| ChemSpiderID = 6514 |
|
| CASNo_Ref = {{cascite|correct|??}} |
|
|
|
| InChI = 1/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
|
| PubChem = 7358 |
|
|
|
| InChIKey = SJEBAWHUJDUKQK-UHFFFAOYAW |
|
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
|
| SMILES = O=C2c1c(cccc1)C(=O)c3c2ccc(c3)CC |
⚫ |
| ChemSpiderID = 7080 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| UNII = 28002VFS3H |
|
| ChEMBL = 42355 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C16H12O2/c1-2-10-7-8-13-14(9-10)16(18)12-6-4-3-5-11(12)15(13)17/h3-9H,2H2,1H3 |
⚫ |
| EINECS = 202-621-4 |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| UNNumber = 2275 |
|
|
⚫ |
| StdInChIKey = SJEBAWHUJDUKQK-UHFFFAOYSA-N |
|
| RTECS = EL3850000 |
|
|
⚫ |
| CASNo_Ref = {{cascite|correct|??}} |
|
| Beilstein = 1731254 |
|
|
⚫ |
| CASNo = <!-- blanked - oldvalue: 84-51-5 --> |
|
| SMILES = CCC(CC)CO |
|
|
⚫ |
| EINECS = 201-535-4 |
|
| StdInChI = 1S/C6H14O/c1-3-6(4-2)5-7/h6-7H,3-5H2,1-2H3 |
|
|
⚫ |
}} |
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = TZYRSLHNPKPEFV-UHFFFAOYSA-N |
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
}} |
|
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>2</sub> |
|
| C = 6 |
|
|
| H = 14 |
|
| MolarMass = 236.27 g/mol |
|
| O = 1 |
|
| MeltingPtC = 105 |
|
|
| BoilingPt = 415.4 @ 760mmHg |
|
| ExactMass = 102.104465070 g mol<sup>−1</sup> |
|
|
|
| Density = 1.231g/cm3 |
|
| Appearance = Colorless, transparent liquid |
|
|
|
| Appearance = white to yellowish crystals or powder |
|
| Density = 830 mg mL<sup>−3</sup> |
|
|
⚫ |
}} |
|
| BoilingPtKL = 418 |
|
|
⚫ |
| Section7 = {{Chembox Hazards |
|
| BoilingPtKH = 424 |
|
|
⚫ |
| SPhrases = {{S24}} {{S25}} |
|
| MeltingPtK = 158.75 |
|
|
⚫ |
| FlashPt = 155.4 °C, |
|
| Solubility = 10 g L<sup>−1</sup> |
|
|
| VaporPressure = 206 Pa |
|
|
| RefractIndex = 1.422 |
|
⚫ |
}} |
|
|
| Section3 = {{Chembox Thermochemistry |
|
|
| HeatCapacity = 246.65 J K<sup>−1</sup> mol<sup>−1</sup> |
|
|
}} |
|
⚫ |
| Section4 = {{Chembox Hazards |
|
|
| GHSPictograms = {{GHS exclamation mark}} |
|
|
| GHSSignalWord = '''WARNING''' |
|
|
| HPhrases = {{H-phrases|302|312}} |
|
|
| PPhrases = {{P-phrases|280}} |
|
|
| EUIndex = 603-051-00-2 |
|
|
| EUClass = {{Hazchem Xn}} |
|
|
| RPhrases = {{R21/22}} |
|
⚫ |
| SPhrases = {{S2}}, {{S36}} |
|
⚫ |
| FlashPt = 58 °C |
|
|
| LD50 = 1.85 g kg<sup>−1</sup> (oral, rat) |
|
|
}} |
|
|
| Section5 = {{Chembox Related |
|
|
| Function = alkanols |
|
|
| OtherFunctn = ] |
|
|
}} |
|
}} |
|
}} |
|
}} |