| Revision as of 18:07, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456503475 of page 4-Aminoquinoline for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 18:07, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 472075761 of page 4-Aminosalicylic_acid for the Chem/Drugbox validation project (updated: 'DrugBank').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Chembox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 456502257 |
|
| verifiedrevid = 456502374 |
|
|
| IUPAC_name = 4-amino-2-hydroxy-benzoic acid |
|
| ImageFile = 4-aminoquinoline.svg |
|
|
|
| image = P-Aminosalicylic acid.svg |
|
| ImageSize = 150px |
|
|
|
| width = 180 |
|
| IUPACName = quinolin-4-amine |
|
|
|
| image2 = 4-Aminosalicylic acid 3d structure vander.png |
|
| OtherNames = |
|
|
|
|
|
| Section1 = {{Chembox Identifiers |
|
|
|
<!--Clinical data--> |
|
| CASNo = <!-- blanked - oldvalue: 578-68-7 --> |
|
|
|
| tradename = |
| ⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
| pregnancy_category = C |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 58146 |
|
| legal_UK = POM |
|
|
| routes_of_administration = Oral |
| ⚫ |
| PubChem = 68476 |
|
|
|
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| ChemSpiderID = 61751 |
|
|
|
| bioavailability = |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| protein_bound = 50–60% |
| ⚫ |
| UNII = GTE5P5L97N |
|
|
|
| metabolism = ] |
|
|
| elimination_half-life = |
|
|
| excretion = ] |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 65-49-6 |
|
|
| CAS_supplemental = |
|
|
| ATC_prefix = J04 |
|
|
| ATC_suffix = AA01 |
|
|
| ATC_supplemental = |
|
⚫ |
| PubChem = 4649 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00233 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = 4488 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = 5B2658E0N2 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00162 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEBI = 27565 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL = 1169 |
|
|
| NIAID_ChemDB = 020064 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=7 | H=7 | N=1 | O=3 |
|
|
| molecular_weight = 153.135 g/mol |
|
|
| smiles = O=C(O)c1ccc(cc1O)N |
|
|
| InChI = 1/C7H7NO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,8H2,(H,10,11) |
|
|
| InChIKey = WUBBRNOQWQTFEX-UHFFFAOYAO |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H8N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H2,10,11) |
|
| StdInChI = 1S/C7H7NO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,8H2,(H,10,11) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = FQYRLEXKXQRZDH-UHFFFAOYSA-N |
|
| StdInChIKey = WUBBRNOQWQTFEX-UHFFFAOYSA-N |
|
|
| melting_point = 150.5 |
|
| SMILES = n1ccc(c2ccccc12)N |
|
|
| InChI = InChI=1S/C9H8N2/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-6H,(H2,10,11) |
|
|
}} |
|
|
| Section2 = {{Chembox Properties |
|
|
| C=9|H=8|N=2 |
|
|
| Appearance = |
|
|
| Density = |
|
|
| MeltingPt = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
|
}} |
|
|
| Section3 = {{Chembox Hazards |
|
|
| MainHazards = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
}} |
|
|
}} |
|
}} |
