Revision as of 19:46, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473513948 of page Acemetacin for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit | Revision as of 19:46, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 466628188 of page Acenaphthene for the Chem/Drugbox validation project (updated: 'KEGG').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{ |
{{chembox | ||
| |
| Verifiedfields = changed | ||
| verifiedrevid = |
| verifiedrevid = 456662235 | ||
| ImageFileL1 = Acenaphthene.svg | |||
| IUPAC_name = 2-acetyl]oxyacetic acid | |||
| ImageSizeL1 = 120px | |||
| image = acemetacin.svg | |||
| ImageAltL1 = Skeletal formula | |||
| ImageFileR1 = Acenaphthene-3D-balls.png | |||
<!--Clinical data--> | |||
| |
| ImageSizeR1 = 120px | ||
| ImageAltR1 = Ball-and-stick model | |||
| Drugs.com = {{drugs.com|international|acemetacin}} | |||
| IUPACName = 1,2-Dihydroacenaphthylene | |||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
| OtherNames = 1,8-Ethylenenaphthalene<br/>''peri''-Ethylenenaphthalene<br/>Naphthyleneethylene | |||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
| Section1 = {{Chembox Identifiers | |||
| pregnancy_category = | |||
| InChIKey = CWRYPZZKDGJXCA-UHFFFAOYAW | |||
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | |||
| SMILES1 = c1cc2cccc3c2c(c1)CC3 | |||
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| legal_UK = POM | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| legal_status = | |||
| routes_of_administration = | |||
<!--Pharmacokinetic data--> | |||
| bioavailability = | |||
| protein_bound = | |||
| metabolism = | |||
| elimination_half-life = | |||
| excretion = | |||
<!--Identifiers--> | |||
| CAS_number_Ref = {{cascite|correct|??}} | |||
| CAS_number = <!-- blanked - oldvalue: 53164-05-9 --> | |||
| ATC_prefix = M01 | |||
| ATC_suffix = AB11 | |||
| PubChem = 1981 | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | |||
| DrugBank = | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 1904 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = 5V141XK28X | |||
| KEGG_Ref = {{keggcite|correct|kegg}} | |||
| KEGG = D01582 | |||
| ChEMBL_Ref = {{ebicite|correct|EBI}} | |||
| ChEMBL = 189171 | |||
<!--Chemical data--> | |||
| C=21 | H=18 | Cl=1 | N=1 | O=6 | |||
| molecular_weight = 415.82372 g/mol | |||
| smiles = Clc1ccc(cc1)C(=O)n3c2ccc(OC)cc2c(c3C)CC(=O)OCC(=O)O | |||
| InChI = 1/C21H18ClNO6/c1-12-16(10-20(26)29-11-19(24)25)17-9-15(28-2)7-8-18(17)23(12)21(27)13-3-5-14(22)6-4-13/h3-9H,10-11H2,1-2H3,(H,24,25) | |||
| InChIKey = FSQKKOOTNAMONP-UHFFFAOYAI | |||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChI = 1S/ |
| StdInChI = 1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2 | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | ||
| StdInChIKey = |
| StdInChIKey = CWRYPZZKDGJXCA-UHFFFAOYSA-N | ||
| CASNo = 83-32-9 | |||
| CASNo_Ref = {{cascite|correct|CAS}} | |||
| EINECS = 201-469-6 | |||
| PubChem = 6734 | |||
| UNII_Ref = {{fdacite|correct|FDA}} | |||
| UNII = V8UT1GAC5Y | |||
| ChEBI_Ref = {{ebicite|correct|EBI}} | |||
| ChEBI = 22154 | |||
| SMILES = c2cc1cccc3c1c(c2)CC3 | |||
| InChI = 1/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2 | |||
| RTECS = AB1000000 | |||
| UNNumber = 3077 | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | |||
| ChemSpiderID = 6478 | |||
| KEGG_Ref = {{keggcite|changed|kegg}} | |||
| KEGG = <!-- blanked - oldvalue: C19312 --> | |||
}} | |||
| Section2 = {{Chembox Properties | |||
| C=12 | H=10 | |||
| Appearance = White or pale yellow crystalline powder | |||
| Density = 1.024 g/cm<sup>3</sup> | |||
| MeltingPtC = 93.4 | |||
| BoilingPtC = 279 | |||
| Solubility = 0.4 mg/100 ml | |||
| Solubility1 = slight | |||
| Solvent1 = ethanol | |||
| Solubility2 = slight | |||
| Solvent2 = chloroform | |||
| Solubility3 = very soluble | |||
| Solvent3 = benzene | |||
| Solubility4 = soluble | |||
| Solvent4 = acetic acid | |||
| Density = 1.222 | |||
}} | |||
| Section7 = {{Chembox Hazards | |||
| ExternalMSDS = | |||
| EUIndex = Not listed | |||
| NFPA-H = 2 | |||
| NFPA-F = 1 | |||
| NFPA-R = 1 | |||
| NFPA-O = | |||
| RPhrases = | |||
| SPhrases = | |||
| FlashPt = 135 °C | |||
| Autoignition = >450 °C | |||
}} | |||
}} | }} |
Revision as of 19:46, 16 February 2012
This page contains a copy of the infobox ({{chembox}}) taken from revid 466628188 of page Acenaphthene with values updated to verified values. |
| |||
Names | |||
---|---|---|---|
IUPAC name 1,2-Dihydroacenaphthylene | |||
Other names
1,8-Ethylenenaphthalene peri-Ethylenenaphthalene Naphthyleneethylene | |||
Identifiers | |||
CAS Number | |||
3D model (JSmol) | |||
ChEBI | |||
ChemSpider | |||
EC Number |
| ||
PubChem CID | |||
RTECS number |
| ||
UNII | |||
UN number | 3077 | ||
InChI
| |||
SMILES
| |||
Properties | |||
Chemical formula | C12H10 | ||
Molar mass | 154.212 g·mol | ||
Appearance | White or pale yellow crystalline powder | ||
Density | 1.222 | ||
Melting point | 93.4 °C (200.1 °F; 366.5 K) | ||
Boiling point | 279 °C (534 °F; 552 K) | ||
Solubility in water | 0.4 mg/100 ml | ||
Solubility in ethanol | slight | ||
Solubility in chloroform | slight | ||
Solubility in benzene | very soluble | ||
Solubility in acetic acid | soluble | ||
Hazards | |||
NFPA 704 (fire diamond) | 2 1 1 | ||
Flash point | 135 °C | ||
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). N verify (what is ?) Infobox references |
Chemical compound