Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:46, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473513948 of page Acemetacin for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit Revision as of 19:46, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 466628188 of page Acenaphthene for the Chem/Drugbox validation project (updated: 'KEGG').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| Watchedfields = changed | Verifiedfields = changed
| verifiedrevid = 443309694 | verifiedrevid = 456662235
| ImageFileL1 = Acenaphthene.svg
| IUPAC_name = 2-acetyl]oxyacetic acid
| ImageSizeL1 = 120px
| image = acemetacin.svg
| ImageAltL1 = Skeletal formula

| ImageFileR1 = Acenaphthene-3D-balls.png
<!--Clinical data-->
| tradename = | ImageSizeR1 = 120px
| ImageAltR1 = Ball-and-stick model
| Drugs.com = {{drugs.com|international|acemetacin}}
| IUPACName = 1,2-Dihydroacenaphthylene
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| OtherNames = 1,8-Ethylenenaphthalene<br/>''peri''-Ethylenenaphthalene<br/>Naphthyleneethylene
| pregnancy_US = <!-- A / B / C / D / X -->
| Section1 = {{Chembox Identifiers
| pregnancy_category =
| InChIKey = CWRYPZZKDGJXCA-UHFFFAOYAW
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| SMILES1 = c1cc2cccc3c2c(c1)CC3
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = POM
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = <!-- blanked - oldvalue: 53164-05-9 -->
| ATC_prefix = M01
| ATC_suffix = AB11
| PubChem = 1981
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 1904
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5V141XK28X
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01582
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 189171

<!--Chemical data-->
| C=21 | H=18 | Cl=1 | N=1 | O=6
| molecular_weight = 415.82372 g/mol
| smiles = Clc1ccc(cc1)C(=O)n3c2ccc(OC)cc2c(c3C)CC(=O)OCC(=O)O
| InChI = 1/C21H18ClNO6/c1-12-16(10-20(26)29-11-19(24)25)17-9-15(28-2)7-8-18(17)23(12)21(27)13-3-5-14(22)6-4-13/h3-9H,10-11H2,1-2H3,(H,24,25)
| InChIKey = FSQKKOOTNAMONP-UHFFFAOYAI
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H18ClNO6/c1-12-16(10-20(26)29-11-19(24)25)17-9-15(28-2)7-8-18(17)23(12)21(27)13-3-5-14(22)6-4-13/h3-9H,10-11H2,1-2H3,(H,24,25) | StdInChI = 1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FSQKKOOTNAMONP-UHFFFAOYSA-N | StdInChIKey = CWRYPZZKDGJXCA-UHFFFAOYSA-N
| CASNo = 83-32-9
| CASNo_Ref = {{cascite|correct|CAS}}
| EINECS = 201-469-6
| PubChem = 6734
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = V8UT1GAC5Y
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 22154
| SMILES = c2cc1cccc3c1c(c2)CC3
| InChI = 1/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2
| RTECS = AB1000000
| UNNumber = 3077
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 6478
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = <!-- blanked - oldvalue: C19312 -->
}}
| Section2 = {{Chembox Properties
| C=12 | H=10
| Appearance = White or pale yellow crystalline powder
| Density = 1.024 g/cm<sup>3</sup>
| MeltingPtC = 93.4
| BoilingPtC = 279
| Solubility = 0.4 mg/100 ml
| Solubility1 = slight
| Solvent1 = ethanol
| Solubility2 = slight
| Solvent2 = chloroform
| Solubility3 = very soluble
| Solvent3 = benzene
| Solubility4 = soluble
| Solvent4 = acetic acid
| Density = 1.222
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| EUIndex = Not listed
| NFPA-H = 2
| NFPA-F = 1
| NFPA-R = 1
| NFPA-O =
| RPhrases =
| SPhrases =
| FlashPt = 135 °C
| Autoignition = >450 °C
}}
}} }}

Revision as of 19:46, 16 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 466628188 of page Acenaphthene with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Skeletal formula
Ball-and-stick model
Names
IUPAC name 1,2-Dihydroacenaphthylene
Other names 1,8-Ethylenenaphthalene
peri-Ethylenenaphthalene
Naphthyleneethylene
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChemSpider
EC Number
  • 201-469-6
PubChem CID
RTECS number
  • AB1000000
UNII
UN number 3077
InChI
  • InChI=1S/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2Key: CWRYPZZKDGJXCA-UHFFFAOYSA-N
  • InChI=1/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2Key: CWRYPZZKDGJXCA-UHFFFAOYAW
SMILES
  • c2cc1cccc3c1c(c2)CC3
  • c1cc2cccc3c2c(c1)CC3
Properties
Chemical formula C12H10
Molar mass 154.212 g·mol
Appearance White or pale yellow crystalline powder
Density 1.222
Melting point 93.4 °C (200.1 °F; 366.5 K)
Boiling point 279 °C (534 °F; 552 K)
Solubility in water 0.4 mg/100 ml
Solubility in ethanol slight
Solubility in chloroform slight
Solubility in benzene very soluble
Solubility in acetic acid soluble
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 2: Intense or continued but not chronic exposure could cause temporary incapacitation or possible residual injury. E.g. chloroformFlammability 1: Must be pre-heated before ignition can occur. Flash point over 93 °C (200 °F). E.g. canola oilInstability 1: Normally stable, but can become unstable at elevated temperatures and pressures. E.g. calciumSpecial hazards (white): no code
2 1 1
Flash point 135 °C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound