Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 19:47, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 471544750 of page Acepromazine for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 19:48, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 447576927 of page Aceprometazine for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| verifiedrevid = 443363336 | verifiedrevid = 443364752
| IUPAC_name = 1-{10--10''H''-phenothiazin-2-yl}ethanone | IUPAC_name = 1-{10--10''H''-phenothiazin-2-yl}ethanone
| image = Acepromazine.svg | image = Aceprometazine.svg


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| pregnancy_category = Contraindicated<br>Passes into ]
| Drugs.com = {{drugs.com|international|acepromazine}}
| legal_status = not approved for use in cattle | legal_status = Rx-only
| routes_of_administration = ], ], oral | routes_of_administration = Oral


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = 6.6L/kg, high volume of distribution | bioavailability =
| protein_bound =
⚫ | elimination_half-life = 3 hours in horses
| metabolism = ]
| excretion = found in equine urine up to 96 hours after dosage
⚫ | elimination_half-life =
| excretion = ] and fecal


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number = 13461-01-3
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 61-00-7 | ATC_prefix = none
| ATC_prefix = N05 | ATC_suffix =
| ATC_suffix = AA04 | PubChem = 26035
| PubChem = 6077
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01614 | DrugBank = DB01615
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5852 | ChemSpiderID = 24249
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 54EJ303F0R | UNII = 984N9YTM4Y
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07065
| ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 44932 | ChEBI = 53770
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 39560


<!--Chemical data--> <!--Chemical data-->
| C=19 | H=22 | N=2 | O=1 | S=1 | C=19 | H=22 | N=2 | O=1 | S=1
| molecular_weight = 326.456 g/mol | molecular_weight = 326.456 g/mol
| smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CCCN(C)C)C | smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CC(N(C)C)C)C
| InChI = 1/C19H22N2OS/c1-14(22)15-9-10-19-17(13-15)21(12-6-11-20(2)3)16-7-4-5-8-18(16)23-19/h4-5,7-10,13H,6,11-12H2,1-3H3 | InChI = 1/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3
| InChIKey = NOSIYYJFMPDDSA-UHFFFAOYAJ | InChIKey = XLOQNFNTQIRSOX-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H22N2OS/c1-14(22)15-9-10-19-17(13-15)21(12-6-11-20(2)3)16-7-4-5-8-18(16)23-19/h4-5,7-10,13H,6,11-12H2,1-3H3 | StdInChI = 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NOSIYYJFMPDDSA-UHFFFAOYSA-N | StdInChIKey = XLOQNFNTQIRSOX-UHFFFAOYSA-N
}} }}

Revision as of 19:48, 16 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 447576927 of page Aceprometazine with values updated to verified values.

{{Drugbox | verifiedrevid = 443364752 | IUPAC_name = 1-{10--10H-phenothiazin-2-yl}ethanone | image = Aceprometazine.svg

| tradename = | pregnancy_category = Contraindicated
Passes into breast milk | legal_status = Rx-only | routes_of_administration = Oral

| bioavailability = | protein_bound = | metabolism = Hepatic | elimination_half-life = | excretion = Renal and fecal

| CASNo_Ref = | CAS_number = 13461-01-3 | ATC_prefix = none | ATC_suffix = | PubChem = 26035 | DrugBank_Ref = | DrugBank = DB01615 | ChemSpiderID_Ref = | ChemSpiderID = 24249 | UNII_Ref = | UNII = 984N9YTM4Y | ChEBI_Ref = | ChEBI = 53770

| C=19 | H=22 | N=2 | O=1 | S=1 | molecular_weight = 326.456 g/mol | smiles = O=C(c2cc1N(c3c(Sc1cc2)cccc3)CC(N(C)C)C)C | InChI = 1/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 | InChIKey = XLOQNFNTQIRSOX-UHFFFAOYAZ | StdInChI_Ref = | StdInChI = 1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 | StdInChIKey_Ref = | StdInChIKey = XLOQNFNTQIRSOX-UHFFFAOYSA-N }}

Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions Add topic