| Revision as of 20:06, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 453490276 of page Adafenoxate for the Chem/Drugbox validation project (updated: 'CASNo').← Previous edit |
Revision as of 20:06, 16 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 472597743 of page Adalimumab for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 456482049 |
|
|
| image = Adalimumab structure.png |
|
|
|
|
|
<!--Monoclonal antibody data--> |
|
|
| type = mab |
|
|
| mab_type = mab |
|
|
| source = u |
|
|
| target = ] |
|
|
|
|
|
<!--Clinical data--> |
|
|
| tradename = Humira |
|
|
| Drugs.com = {{drugs.com|monograph|adalimumab}} |
|
|
| MedlinePlus = a603010 |
|
|
| pregnancy_AU = C |
|
|
| pregnancy_US = B |
|
|
| legal_UK = POM |
|
|
| legal_US = Rx-only |
|
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = 64% (subcutaneous), 0% (]) |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = 10–20 days. |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 331731-18-1 |
|
|
| ATC_prefix = L04 |
|
|
| ATC_suffix = AB04 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
⚫ |
| ChemSpiderID = NA |
|
⚫ |
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00051 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = B8VQU4C05J |
|
| UNII = FYS6T7F842 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
| ⚫ |
| verifiedrevid = 443843182 |
|
|
|
| KEGG = D02597 |
|
|ImageFile=Adafenoxate.png |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|ImageSize=200px |
|
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1201580 --> |
|
|IUPACName=2-(4-chlorophenoxy)acetic acid 2-(1-adamantylamino)ethyl ester |
|
|
|
| C=6428 | H=9912 | N=1694 | O=1987 | S=46 |
|
|OtherNames= |
|
|
|
| molecular_weight = 144190.3 g/mol |
|
|Section1={{Chembox Identifiers |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 58080 |
|
|
| InChI = 1/C20H26ClNO3/c21-17-1-3-18(4-2-17)25-13-19(23)24-6-5-22-20-10-14-7-15(11-20)9-16(8-14)12-20/h1-4,14-16,22H,5-13H2 |
|
|
| InChIKey = PLSMXIQMWYSHIV-UHFFFAOYAK |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C20H26ClNO3/c21-17-1-3-18(4-2-17)25-13-19(23)24-6-5-22-20-10-14-7-15(11-20)9-16(8-14)12-20/h1-4,14-16,22H,5-13H2 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChIKey = PLSMXIQMWYSHIV-UHFFFAOYSA-N |
|
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 82168-26-1 --> |
|
| ⚫ |
| PubChem=64517 |
|
|
| SMILES = Clc4ccc(OCC(=O)OCCNC13CC2CC(CC(C1)C2)C3)cc4 |
|
|
}} |
|
|
|Section2={{Chembox Properties |
|
|
| Formula=C<sub>20</sub>H<sub>26</sub>ClNO<sub>3</sub> |
|
|
| MolarMass=363.87834 |
|
|
| Appearance= |
|
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
|
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
|
}} |
|
|
}} |
|
}} |
