Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 20:46, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473609756 of page Alnespirone for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit Revision as of 04:35, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477309810 of page Sulfur_dioxide for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{drugbox {{Chembox
| Verifiedfields = changed
| UNII_Ref = {{fdacite|correct|FDA}}
| verifiedrevid = 477162682
| UNII = 34E28BM822
| ImageFile = Sulfur-dioxide-2D.svg
| verifiedrevid = 444427189
| ImageFile_Ref = {{chemboximage|correct|??}}
| IUPAC_name = (+)-4-dihydro-2''H''-chromen-3-yl]-propylamino]butyl]-8-azaspirodecane-7,9-dione
| ImageSize = 160
| image = Alnespirone.svg
| ImageName = Skeletal formula sulfur dioxide with assorted dimensions
| InChI = 1/C26H38N2O4.ClH/c1-3-13-27(20-16-21-22(31-2)9-8-10-23(21)32-19-20)14-6-7-15-28-24(29)17-26(18-25(28)30)11-4-5-12-26;/h8-10,20H,3-7,11-19H2,1-2H3;1H/t20-;/m0./s1
| ImageFile1 = Sulfur-dioxide-3D-vdW.png
| InChIKey = QYFHCFNBYQZGKW-BDQAORGHBQ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | ImageFile1_Ref = {{chemboximage|correct|??}}
| ImageSize1 = 140
| StdInChI = 1S/C26H38N2O4.ClH/c1-3-13-27(20-16-21-22(31-2)9-8-10-23(21)32-19-20)14-6-7-15-28-24(29)17-26(18-25(28)30)11-4-5-12-26;/h8-10,20H,3-7,11-19H2,1-2H3;1H/t20-;/m0./s1
| ImageName1 = Spacefill model of sulfur dioxide
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| IUPACName = Sulfur dioxide
| StdInChIKey = QYFHCFNBYQZGKW-BDQAORGHSA-N
| OtherNames = Sulfurous anhydride<br />
| CAS_number_Ref = {{cascite|correct|??}}
Sulfur(IV) oxide
| CAS_number = <!-- blanked - oldvalue: 143413-68-7 -->
| Section1 = {{Chembox Identifiers
| ATC_prefix = none
| CASNo = 7446-09-5
| ATC_suffix =
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 178132
| PubChem = 1119
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| PubChem_Ref = {{Pubchemcite|correct|pubchem}}
| ChemSpiderID = 8002134
| ChemSpiderID = 1087
| C = 26 | H = 38 | N = 2 | O = 4
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| molecular_weight = 442.589 g/mol
| UNII = 0UZA3422Q4
| smiles = Cl.O=C1N(C(=O)CC2(C1)CCCC2)CCCCN(3Cc4c(OC)cccc4OC3)CCC
| UNII_Ref = {{fdacite|correct|FDA}}
| bioavailability =
| EINECS = 231-195-2
| metabolism =
| UNNumber = 1079, 2037
| elimination_half-life =
| KEGG = D05961
| excretion =
| KEGG_Ref = {{keggcite|correct|kegg}}
| pregnancy_category =
| MeSHName = Sulfur+dioxide
| legal_status =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| routes_of_administration =
| ChEBI = 18422
| ChEMBL = <!-- blanked - oldvalue: 1235997 -->
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| RTECS = WS4550000
| Beilstein = 3535237
| Gmelin = 1443
| SMILES = O=S=O
| StdInChI = 1S/O2S/c1-3-2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| InChI = 1/O2S/c1-3-2
| StdInChIKey = RAHZWNYVWXNFOC-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| InChIKey = RAHZWNYVWXNFOC-UHFFFAOYAT
}}
| Section2 = {{Chembox Properties
| Formula = {{Chem|SO|2}}
| MolarMass = 64.066 g mol<sup>−1</sup>
| ExactMass = 63.961899934 g mol<sup>−1</sup>
| Appearance = Colorless gas
| Density = 2.6288 kg m<sup>−3</sup>
| Solubility = 94 g dm<sup>−3</sup><ref>{{RubberBible87th}}</ref>
| MeltingPtK = 201
| BoilingPtC = −10
| VaporPressure = 237.2 kPa
| pKa = 1.81
| pKb = 12.19
| Viscosity = 0.403 cP (at 0 °C)
}}
| Section3 = {{Chembox Structure
| SpaceGroup = ''C''<sub>2''v''</sub>
| Coordination = Digonal
| MolShape = Dihedral
| Dipole = 1.62 D
}}
| Section4 = {{Chembox Thermochemistry
| DeltaHf = -296.81 kJ mol<sup>−1</sup>
| Entropy = 248.223 J K<sup>−1</sup> mol<sup>−1</sup>
}}
| Section5 = {{Chembox Hazards
| EUIndex = 016-011-00-9
| EUClass = {{Hazchem T}}
| RPhrases = {{R23}}, {{R34}}, {{R50}}
| SPhrases = {{S1/2}}, {{S9}}, {{S26}}, {{S36/37/39}}, {{S45}}
| NFPA-H = 3
| NFPA-F = 0
| NFPA-R = 0
| LD50 = 3000 ppm (30 min inhaled, mouse)
}}
| Section8 = {{Chembox Related
| Function = ] ]s
| OtherFunctn = ]<br/>]
| OtherCpds = ]<br />
]<br />
]<br />
]
}}
}} }}

Revision as of 04:35, 17 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 477309810 of page Sulfur_dioxide with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Skeletal formula sulfur dioxide with assorted dimensions
Spacefill model of sulfur dioxide
Names
IUPAC name Sulfur dioxide
Other names Sulfurous anhydride
Sulfur(IV) oxide
Identifiers
CAS Number
3D model (JSmol)
Beilstein Reference 3535237
ChEBI
ChemSpider
EC Number
  • 231-195-2
Gmelin Reference 1443
KEGG
MeSH Sulfur+dioxide
PubChem CID
RTECS number
  • WS4550000
UNII
UN number 1079, 2037
InChI
  • InChI=1S/O2S/c1-3-2Key: RAHZWNYVWXNFOC-UHFFFAOYSA-N
  • InChI=1/O2S/c1-3-2Key: RAHZWNYVWXNFOC-UHFFFAOYAT
SMILES
  • O=S=O
Properties
Chemical formula SO
2
Molar mass 64.066 g mol
Appearance Colorless gas
Density 2.6288 kg m
Melting point −72 °C; −98 °F; 201 K
Boiling point −10 °C (14 °F; 263 K)
Solubility in water 94 g dm
Vapor pressure 237.2 kPa
Acidity (pKa) 1.81
Basicity (pKb) 12.19
Viscosity 0.403 cP (at 0 °C)
Structure
Space group C2v
Coordination geometry Digonal
Molecular shape Dihedral
Dipole moment 1.62 D
Thermochemistry
Std molar
entropy (S298) 		248.223 J K mol
Std enthalpy of
formation (ΔfH298) 		-296.81 kJ mol
Hazards
NFPA 704 (fire diamond)
NFPA 704 four-colored diamondHealth 3: Short exposure could cause serious temporary or residual injury. E.g. chlorine gasFlammability 0: Will not burn. E.g. waterInstability 0: Normally stable, even under fire exposure conditions, and is not reactive with water. E.g. liquid nitrogenSpecial hazards (white): no code
3 0 0
Lethal dose or concentration (LD, LC):
LD50 (median dose) 3000 ppm (30 min inhaled, mouse)
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). ☒N verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound
  1. Lide, David R., ed. (2006). CRC Handbook of Chemistry and Physics (87th ed.). Boca Raton, Florida: CRC Press. ISBN 0-8493-0487-3.