Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 04:53, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477239151 of page Chlorosulfuric_acid for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 04:54, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 477242439 of page Indigo_dye for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{chembox {{chembox
⚫ | verifiedrevid = 476995653
| Verifiedfields = changed
| Name = Indigo
| Watchedfields = changed
| ImageFile = Indian indigo dye lump.jpg
⚫ | verifiedrevid = 476998652
⚫ | ImageSize = 200px
| Name = Chlorosulfuric acid
| ImageName = Lump of Indian indigo dye
| ImageFile = Chlorosulfuric-acid.png
| ImageFile1 = Indigo.svg
⚫ | ImageSize = 150px
⚫ | ImageSize1 = 200px
| ImageName = Chlorosulfuric acid
⚫ | ImageName1 = Indigo
| ImageFile1 = Chlorosulfuric-acid-3D-balls.png
| OtherNames = 2,2'-Bis(2,3-dihydro-3- oxoindolyliden), Indigotin
⚫ | ImageSize1 = 180px
⚫ | ImageName1 = Chlorosulfuric acid
| IUPACName = Sulfurochloridic acid
| OtherNames = Chlorosulfuric acid,<br>Chlorosulfonic acid,<br>Chlorosulphonic acid,<br>Chlorinesulfonic acid,<br>Chlorinesulphonic acid,<br>Chloridosulfonic acid,<br>Chloridosulphonic acid,<br>Sulfuric chlorohydrin
| Section1 = {{Chembox Identifiers | Section1 = {{Chembox Identifiers
| SMILES = ClS(=O)(=O)O | SMILES = c1ccc2c(c1)C(=O)/C(=C\3/C(=O)c4ccccc4N3)/N2
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 23040 | ChemSpiderID = 4477009
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem = 24638
| UNII = 1G5BK41P4F
| InChI = 1/ClHO3S/c1-5(2,3)4/h(H,2,3,4)
| InChIKey = XTHPWXDJESJLNJ-UHFFFAOYAO | InChIKey = COHYTHOBJLSHDF-BUHFOSPRBQ
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 599552
| StdInChI = 1S/ClHO3S/c1-5(2,3)4/h(H,2,3,4)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+
⚫ | StdInChIKey = XTHPWXDJESJLNJ-UHFFFAOYSA-N
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| CASNo = 7790-94-5
⚫ | StdInChIKey = COHYTHOBJLSHDF-BUHFOSPRSA-N
| CASNo_Ref = {{cascite|changed|??}} | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | RTECS = FX5730000
| UNNumber = 1754 | CASNo = 482-89-3
⚫ | RTECS = DU2988400
| InChI=1/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+
}} }}
| Section2 = {{Chembox Properties | Section2 = {{Chembox Properties
| Formula = HSO<sub>3</sub>Cl | Formula = C<sub>16</sub>H<sub>10</sub>N<sub>2</sub>O<sub>2</sub>
| MolarMass = 116.52 g mol<sup>−1</sup> | MolarMass = 262.27&nbsp;g/mol
| Appearance = colorless liquid that fumes in air | Appearance = dark blue crystalline powder
| Density = 1.753 g cm<sup>−3</sup> | Density = 1.199&nbsp;g/cm<sup>3</sup>
| Solubility = hydrolysis | Solubility = 10g/L (at 25C)
| Solvent = other solvents | MeltingPtCL = 390
| MeltingPtCH = 392
| SolubleOther = reacts with alcohols<br/>soluble in chlorocarbons
| MeltingPt = −80 °C | BoilingPt = decomposes
| BoilingPt = 151–152 °C<br/>({{convert|755|mmHg|abbr=on|disp=or}})
| Viscosity =
| RefractIndex = 1.433
}}
| Section3 = {{Chembox Structure
| MolShape = tetrahedral
| Dipole =
}} }}
| Section7 = {{Chembox Hazards | Section7 = {{Chembox Hazards
| ExternalMSDS = | ExternalMSDS =
| EUClass = Corrosive ('''C''') | EUClass = 207-586-9
| EUIndex = 016-017-00-1 | RPhrases = {{R36/37/38}}
| NFPA-H = 4 | SPhrases = {{S26}}-{{S36}}
| NFPA-F = 0 | FlashPt =
| NFPA-R = 2 | Autoignition =
| NFPA-O = W
| RPhrases = {{R14}}, {{R35}}, {{R37}}
| SPhrases = {{S2}}, {{S26}}, {{S45}}
}} }}
| Section8 = {{Chembox Related | Section8 = {{Chembox Related
| OtherCpds = ]<br/>] | OtherCpds = ]<br />]<br />]
}} }}
}} }}

Revision as of 04:54, 17 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 477242439 of page Indigo_dye with values updated to verified values.
Indigo
Lump of Indian indigo dye
Indigo
Names
Other names 2,2'-Bis(2,3-dihydro-3- oxoindolyliden), Indigotin
Identifiers
CAS Number
3D model (JSmol)
ChEMBL
ChemSpider
RTECS number
  • DU2988400
UNII
InChI
  • InChI=1S/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+Key: COHYTHOBJLSHDF-BUHFOSPRSA-N
  • InChI=1/C16H10N2O2/c19-15-9-5-1-3-7-11(9)17-13(15)14-16(20)10-6-2-4-8-12(10)18-14/h1-8,17-18H/b14-13+Key: COHYTHOBJLSHDF-BUHFOSPRBQ
SMILES
  • c1ccc2c(c1)C(=O)/C(=C\3/C(=O)c4ccccc4N3)/N2
Properties
Chemical formula C16H10N2O2
Molar mass 262.27 g/mol
Appearance dark blue crystalline powder
Density 1.199 g/cm
Boiling point decomposes
Solubility in water 10g/L (at 25C)
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound