| Revision as of 05:09, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 465527277 of page Aldrin for the Chem/Drugbox validation project (updated: '').← Previous edit |
Revision as of 05:09, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 473937862 of page Alefacept for the Chem/Drugbox validation project (updated: 'DrugBank', 'ChEMBL').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
| Watchedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 454571745 |
|
| verifiedrevid = 458276146 |
|
|
| IUPAC_name = 1-92-LFA-3 (Antigen) (human) fusion protein with immunoglobin G1 (human hinge CH2-CH3γ1-chain) dimer |
|
| Name = Aldrin |
|
|
|
| image = |
|
| ImageFile = Aldrin.svg |
|
|
|
|
|
| ImageSize = 200px |
|
|
|
<!--Clinical data--> |
|
| ImageName = Aldrin |
|
|
|
| tradename = |
|
| ImageFile1 = Aldrin-from-xtal-3D-balls.png |
|
|
|
| Drugs.com = {{drugs.com|monograph|alefacept}} |
|
| IUPACName = 1,2,3,4,10,10-Hexachloro-<br />1,4,4a,5,8,8a-hexahydro-<br />1,4:5,8-dimethanonaphthalene |
|
|
|
| MedlinePlus = a603011 |
|
| Section1 = {{Chembox Identifiers |
|
|
|
| pregnancy_AU = C |
|
| InChI = 1/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2/t4-,5+,6+,7-,10+,11- |
|
|
|
| pregnancy_US = B |
|
| InChIKey = QBYJBZPUGVGKQQ-SJJAEHHWBI |
|
|
|
| legal_US = Rx-only |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
| routes_of_administration = ], ] |
|
| StdInChI = 1S/C12H8Cl6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-7H,3H2/t4-,5+,6+,7-,10+,11- |
|
|
|
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
|
|
<!--Pharmacokinetic data--> |
|
| StdInChIKey = QBYJBZPUGVGKQQ-SJJAEHHWSA-N |
|
|
|
| bioavailability = 63% (]) |
| ⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
|
| protein_bound = |
|
| CASNo = 309-00-2 |
|
|
|
| metabolism = |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| elimination_half-life = ~270 hours |
| ⚫ |
| UNII = OZE3CLY605 |
|
|
|
| excretion = |
|
| SMILES = ClC4(Cl)2(Cl)C(/Cl)=C(/Cl)4(Cl)3\1C(/C=C/1)23 |
|
|
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
<!--Identifiers--> |
| ⚫ |
| ChemSpiderID=10292747 |
|
|
⚫ |
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 222535-22-0 |
|
|
| ATC_prefix = L04 |
|
|
| ATC_suffix = AA15 |
|
|
| PubChem = |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
|
| DrugBank = DB00092 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
⚫ |
| UNII = ELK3V90G6C |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C07552 |
|
| KEGG = D02800 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
}} |
|
|
|
| ChEMBL = <!-- blanked - oldvalue: 1201571 --> |
|
| Section2 = {{Chembox Properties |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|C=12|H=8|Cl=6 |
|
|
⚫ |
| ChemSpiderID = NA |
|
| MeltingPt = 104 °C |
|
|
|
|
|
| VaporPressure = 7.5 × 10<sup>−5</sup> mmHg @ 20 °C |
|
|
|
<!--Chemical data--> |
|
}} |
|
|
|
| C=2306 | H=3594 | N=610 | O=694 | S=26 |
|
| Section7 = {{Chembox Hazards |
|
|
|
| molecular_weight = 51801.1 g/mol |
|
| NFPA-H = 2 |
|
|
| NFPA-F = |
|
|
| NFPA-R = |
|
|
}} |
|
|
}} |
|
}} |
