Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 05:16, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 469596217 of page Alizapride for the Chem/Drugbox validation project (updated: '').← Previous edit Revision as of 05:16, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 474899983 of page Alizarin for the Chem/Drugbox validation project (updated: '').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{chembox
| Watchedfields = changed
| verifiedrevid = 443375159 | verifiedrevid = 443375249
| IUPAC_name = ''N''--6-methoxy-1''H''-benzotriazole-5-carboxamide
| Name = Alizarin
| image = Alizapride.svg
⚫ | ImageFile1_Ref = {{chemboximage|correct|??}}
| image2 = 3D Alizapride.png
| ImageFile1 = Alizaryna.svg

| ImageName1 = Skeletal formula of alizarin
<!--Clinical data-->
| ImageFile2 = Alizarin-3D-balls.png
| tradename =
| ImageName2 = Ball-and-stick model of alizarin
| Drugs.com = {{drugs.com|international|alizapride}}
| ImageFile3 = Alizarin-sample.jpg
| pregnancy_category =
| legal_status = Rx-only | ImageSize3 = 160px
| ImageName3 = Sample of alizarin
| routes_of_administration = ], ], ]
| IUPACName = 1,2-dihydroxy-9,10-anthracenedione

| OtherNames = 1,2-Dihydroxyanthraquinone, Turkey red, Mordant red 11, Alizarin B, Alizarin red
<!--Pharmacokinetic data-->
| Section1 = {{Chembox Identifiers
| bioavailability =
⚫ | ChEBI_Ref = {{ebicite|correct|EBI}}
| metabolism =
| ChEBI = 16866
| elimination_half-life = 3 hours
| SMILES = O=C2c1ccccc1C(=O)c3c2ccc(O)c3O
| excretion = ]
⚫ | UNII_Ref = {{fdacite|correct|FDA}}

⚫ | UNII = 60MEW57T9G
<!--Identifiers-->
⚫ | CASNo_Ref = {{cascite|correct|CAS}}
⚫ | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 59338-93-1
| ATC_prefix = A03
| ATC_suffix = FA05
⚫ | PubChem = 43008
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01425
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID = 39202
⚫ | UNII_Ref = {{fdacite|correct|FDA}}
⚫ | UNII = P55703ZRZY
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07102 | KEGG = C01474
| InChI = 1/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18H
| InChIKey = RGCKGOZRHPZPFP-UHFFFAOYAG
⚫ | PubChem = 6293
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 290194 | ChEMBL = 55814

<!--Chemical data-->
⚫ | C=16 | H=21 | N=5 | O=2
| molecular_weight = 315.37 g/mol
| smiles = O=C(c2cc1nnnc1cc2OC)NCC3N(C\C=C)CCC3
| InChI = 1/C16H21N5O2/c1-3-6-21-7-4-5-11(21)10-17-16(22)12-8-13-14(19-20-18-13)9-15(12)23-2/h3,8-9,11H,1,4-7,10H2,2H3,(H,17,22)(H,18,19,20)
| InChIKey = KSEYRUGYKHXGFW-UHFFFAOYAP
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H21N5O2/c1-3-6-21-7-4-5-11(21)10-17-16(22)12-8-13-14(19-20-18-13)9-15(12)23-2/h3,8-9,11H,1,4-7,10H2,2H3,(H,17,22)(H,18,19,20) | StdInChI = 1S/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18H
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KSEYRUGYKHXGFW-UHFFFAOYSA-N | StdInChIKey = RGCKGOZRHPZPFP-UHFFFAOYSA-N
| CASNo = 72-48-0
⚫ | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
⚫ | ChemSpiderID=6056
| CASNo_Ref = {{cascite|correct|CAS}}
| RTECS =
}}
| Section2 = {{Chembox Properties
⚫ | C = 14 | H = 8 | O = 4
| Appearance = orange-red crystals or powder
| Density = 1.540 g/cm<sup>3</sup>
| Solubility = slightly to sparingly soluble
| MeltingPt = 279–83 °C
| BoilingPt = 430 °C
| pKa = 6.94
}}
| Section7 = {{Chembox Hazards
| ExternalMSDS =
| MainHazards =
| FlashPt =
| RPhrases = {{R36}} {{R37}} {{R38}}
| SPhrases = {{S26}} {{S36}}
}}
| Section8 = {{Chembox Related
| OtherCpds = ], ]
}}
}} }}

Revision as of 05:16, 17 February 2012

This page contains a copy of the infobox ({{chembox}}) taken from revid 474899983 of page Alizarin with values updated to verified values.
Alizarin
Skeletal formula of alizarin
Ball-and-stick model of alizarin
Sample of alizarin
Names
IUPAC name 1,2-dihydroxy-9,10-anthracenedione
Other names 1,2-Dihydroxyanthraquinone, Turkey red, Mordant red 11, Alizarin B, Alizarin red
Identifiers
CAS Number
3D model (JSmol)
ChEBI
ChEMBL
ChemSpider
KEGG
PubChem CID
UNII
InChI
  • InChI=1S/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18HKey: RGCKGOZRHPZPFP-UHFFFAOYSA-N
  • InChI=1/C14H8O4/c15-10-6-5-9-11(14(10)18)13(17)8-4-2-1-3-7(8)12(9)16/h1-6,15,18HKey: RGCKGOZRHPZPFP-UHFFFAOYAG
SMILES
  • O=C2c1ccccc1C(=O)c3c2ccc(O)c3O
Properties
Chemical formula C14H8O4
Molar mass 240.214 g·mol
Appearance orange-red crystals or powder
Density 1.540 g/cm
Melting point 279–83 °C
Boiling point 430 °C
Solubility in water slightly to sparingly soluble
Acidity (pKa) 6.94
Related compounds
Except where otherwise noted, data are given for materials in their standard state (at 25 °C , 100 kPa). checkY verify (what is  ?) Infobox references
Tracking categories (test):
Chemical compound