| Revision as of 10:29, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 473149103 of page 4-Acetoxy-DiPT for the Chem/Drugbox validation project (updated: 'CAS_number').← Previous edit |
Revision as of 10:29, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{chembox}} taken from revid 463089347 of page 4-Acetoxy-MiPT for the Chem/Drugbox validation project (updated: '').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Chembox |
|
|
| ImageFile = 4-AcO-MiPT_molecular_structure.png |
|
| verifiedrevid = 399318141 |
|
|
|
| ImageSize = |
|
| IUPAC_name = 3-ethyl]-1H-Indol-4-ol acetate |
|
| IUPACName = ethyl]-1H-indol-4-yl] acetate |
|
| image = 4-AcO-DiPT.svg |
|
|
| width = 200 |
|
| OtherNames = |
|
|
| Section1 = {{Chembox Identifiers |
|
| image2 = 4-Acetoxy-DIPT 3D.png |
|
|
|
| CASNo = |
|
|
|
|
⚫ |
| PubChem = |
|
<!--Clinical data--> |
|
|
⚫ |
| ChemSpiderID = 23976075 |
|
| tradename = |
|
|
|
| SMILES = CC(C)N(C)CCc1cc2c1c(ccc2)OC(=O)C |
|
| pregnancy_AU = |
|
|
⚫ |
| InChI = 1/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
|
| pregnancy_US = |
|
|
|
| InChIKey = CIDMXLOVFPIHDS-UHFFFAOYAP |
|
| pregnancy_category = |
|
|
⚫ |
| StdInChI = 1S/C16H22N2O2/c1-11(2)18(4)9-8-13-10-17-14-6-5-7-15(16(13)14)20-12(3)19/h5-7,10-11,17H,8-9H2,1-4H3 |
|
| legal_AU = |
|
|
⚫ |
| StdInChIKey = CIDMXLOVFPIHDS-UHFFFAOYSA-N |
|
| legal_CA = |
|
|
|
}} |
|
| legal_UK = Class A |
|
|
|
| Section2 = {{Chembox Properties |
|
| legal_US = |
|
|
|
| Formula = C<sub>16</sub>H<sub>22</sub>N<sub>2</sub>O<sub>2</sub> |
|
| legal_status = |
|
|
|
| MolarMass = 274.358 |
|
| routes_of_administration = |
|
|
|
| Appearance = |
|
|
|
|
|
| Density = |
|
<!--Pharmacokinetic data--> |
|
|
|
| MeltingPt = |
|
| bioavailability = |
|
|
|
| BoilingPt = |
|
| protein_bound = |
|
|
| metabolism = |
|
| Solubility = |
|
|
}} |
|
| elimination_half-life = |
|
|
|
| Section3 = {{Chembox Hazards |
|
| excretion = |
|
|
|
| MainHazards = |
|
|
|
|
|
| FlashPt = |
|
<!--Identifiers--> |
|
|
|
| Autoignition = |
|
| CAS_number = <!-- blanked - oldvalue: 936015-60-0 --> |
|
|
|
}} |
|
| ATC_prefix = |
|
|
| ATC_suffix = |
|
| ⚫ |
| PubChem = 24801868 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ⚫ |
| ChemSpiderID = 21106240 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| C=18 | H=26 | N=2 | O=2 |
|
|
| molecular_weight = 302.42 g/mol |
|
|
| smiles = CC(C)N(CCc2cnc1cccc(OC(C)=O)c12)C(C)C |
|
| ⚫ |
| InChI = 1/C18H26N2O2/c1-12(2)20(13(3)4)10-9-15-11-19-16-7-6-8-17(18(15)16)22-14(5)21/h6-8,11-13,19H,9-10H2,1-5H3 |
|
|
| InChIKey = ZPAOVGZYDSXCPK-UHFFFAOYAS |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChI = 1S/C18H26N2O2/c1-12(2)20(13(3)4)10-9-15-11-19-16-7-6-8-17(18(15)16)22-14(5)21/h6-8,11-13,19H,9-10H2,1-5H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| ⚫ |
| StdInChIKey = ZPAOVGZYDSXCPK-UHFFFAOYSA-N |
|
|
| melting_point = |
|
|
| melting_high = |
|
|
}} |
|
}} |
