| Revision as of 10:45, 17 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 465948585 of page AL-37350A for the Chem/Drugbox validation project (updated: 'ChEMBL').← Previous edit |
Revision as of 10:45, 17 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 469716802 of page AM-087 for the Chem/Drugbox validation project (updated: 'ChEMBL').Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 462572977 |
|
| verifiedrevid = 462653342 |
|
| IUPAC_name = (''S'')-(+)-1-(2-Aminopropyl)-8,9-dihydropyranoindole |
|
| IUPAC_name = (6aR,10aR)-3-(2-methyl-6-bromohex-2-yl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzochromen-1-ol |
|
| image = AL-37350A_structure.png |
|
| image = AM-087.png |
|
| width = 140 |
|
| width = 240 |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = |
|
|
| pregnancy_US = |
|
|
| pregnancy_category = |
|
|
| legal_AU = |
|
|
| legal_CA = |
|
|
| legal_UK = |
|
|
| legal_US = |
|
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
| Line 28: |
Line 19: |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = |
|
| CAS_number = |
|
| ATC_prefix = |
|
| ChEMBL = 199561 |
|
| ATC_suffix = |
|
| PubChem = 10717065 |
|
| ChEMBL = 133455 |
|
|
| PubChem = 10331436 |
|
|
| IUPHAR_ligand = 160 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8506896 |
|
| ChemSpiderID = 8892405 |
|
|
| InChI = 1/C23H33BrO2/c1-15-8-9-18-17(12-15)21-19(25)13-16(14-20(21)26-23(18,4)5)22(2,3)10-6-7-11-24/h8,13-14,17-18,25H,6-7,9-12H2,1-5H3/t17-,18-/m1/s1 |
|
| SMILES = O2c1ccc3c(c1CCC2)c(cn3)C(N)C |
|
|
|
| InChIKey = RJPGJHLVEUSRRA-QZTJIDSGBN |
|
| InChI = 1/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1 |
|
|
| InChIKey = VVHJUSGIUWQPIT-VIFPVBQEBB |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C14H18N2O/c1-9(15)7-10-8-16-12-4-5-13-11(14(10)12)3-2-6-17-13/h4-5,8-9,16H,2-3,6-7,15H2,1H3/t9-/m0/s1 |
|
| StdInChI = 1S/C23H33BrO2/c1-15-8-9-18-17(12-15)21-19(25)13-16(14-20(21)26-23(18,4)5)22(2,3)10-6-7-11-24/h8,13-14,17-18,25H,6-7,9-12H2,1-5H3/t17-,18-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VVHJUSGIUWQPIT-VIFPVBQESA-N |
|
| StdInChIKey = RJPGJHLVEUSRRA-QZTJIDSGSA-N |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=14 | H=18 | N=2 | O=1 |
|
| C=23 | H=33 | Br=1 | O=2 |
|
| molecular_weight = 230.305 g/mol |
|
| molecular_weight = 421.410 g/mol |
|
| smiles = CC(N)Cc3cnc2ccc1OCCCc1c23 |
|
| smiles = CC3(C)C1CC=C(C)CC1c2c(O)cc(C(C)(C)CCCCBr)cc2O3 |
|
| melting_point = |
|
|
| melting_high = |
|
|
}} |
|
}} |
