Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox: Difference between revisions - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation Browse history interactively← Previous editNext edit →Content deleted Content addedVisualWikitext
Revision as of 11:51, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457098671 of page Zonisamide for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit Revision as of 11:52, 20 February 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 460077547 of page Zosuquidar for the Chem/Drugbox validation project (updated: 'CAS_number').Next edit →
Line 1: Line 1:
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} {{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Verifiedfields = changed
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 410880949 | verifiedrevid = 431677972
| IUPAC_name = (2''R'')-&#x200b;1-&#x200b;{4-&#x200b;&#x200b;cyclopropa&#x200b;&#x200b;&#x200b;annulen-&#x200b;6-&#x200b;yl}-&#x200b;3-&#x200b;(quinolin-&#x200b;5-&#x200b;yloxy)&#x200b;propan-&#x200b;2-&#x200b;ol
| IUPAC_name = benzoisoxazol-3-ylmethanesulfonamide
| image = Zonisamide.svg | image = Zosuquidar.svg
| width = 250px


<!--Clinical data--> <!--Clinical data-->
| tradename = Zonegran | tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| Drugs.com = {{drugs.com|monograph|zonisamide}}
| pregnancy_US = <!-- A / B / C / D / X -->
| MedlinePlus = a603008
| pregnancy_US = C | pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_status = Rx-only
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| routes_of_administration = Oral
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = ? | bioavailability =
| protein_bound = 40% | protein_bound =
| metabolism = ] | metabolism =
| elimination_half-life = 105 hours in ]s, 63 hours in ] | elimination_half-life =
| excretion = ] | excretion =


<!--Identifiers--> <!--Identifiers-->
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 68291-97-4 | CAS_number = <!-- blanked - oldvalue: 167354-41-8 -->
| ATC_prefix = N03 | ATC_prefix = none
| ATC_suffix = AX15 | ATC_suffix =
| PubChem = 5734 | PubChem = 153997
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00909 | DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5532 | ChemSpiderID = 24599682
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 459384H98V | UNII = AB5K82X98Y
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00538 | KEGG = D06387
| ChEBI_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEBI = 10127 | ChEMBL = 444172
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 750


<!--Chemical data--> <!--Chemical data-->
| C=8 | H=8 | N=2 | O=3 | S=1 | C=32 | H=31 | F=2 | N=3 | O=2
| molecular_weight = 212.227 g/mol | molecular_weight = 527.61 g/mol
| smiles = Cl.Cl.Cl.FC4(F)3c1ccccc1C(c2c(cccc2)34)N5CCN(CC5)C(O)COc7c6cccnc6ccc7
| smiles = O=S(=O)(N)Cc2noc1ccccc12
| InChI = 1/C8H8N2O3S/c9-14(11,12)5-7-6-3-1-2-4-8(6)13-10-7/h1-4H,5H2,(H2,9,11,12)
| InChIKey = UBQNRHZMVUUOMG-UHFFFAOYAZ
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C8H8N2O3S/c9-14(11,12)5-7-6-3-1-2-4-8(6)13-10-7/h1-4H,5H2,(H2,9,11,12) | StdInChI = 1S/C32H31F2N3O2/c33-32(34)29-22-7-1-3-9-24(22)31(25-10-4-2-8-23(25)30(29)32)37-17-15-36(16-18-37)19-21(38)20-39-28-13-5-12-27-26(28)11-6-14-35-27/h1-14,21,29-31,38H,15-20H2/t21-,29-,30+,31-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = UBQNRHZMVUUOMG-UHFFFAOYSA-N | StdInChIKey = IHOVFYSQUDPMCN-DBEBIPAYSA-N
| melting_point = 162
}} }}

Revision as of 11:52, 20 February 2012

This page contains a copy of the infobox ({{drugbox}}) taken from revid 460077547 of page Zosuquidar with values updated to verified values.
WikiProject Chemicals/Chembox validation/VerifiedDataSandbox
Clinical data
ATC code
  • none
Identifiers
IUPAC name
  • (2R)-​1-​{4-​​cyclopropa​​​annulen-​6-​yl}-​3-​(quinolin-​5-​yloxy)​propan-​2-​ol
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
Chemical and physical data
FormulaC32H31F2N3O2
Molar mass527.61 g/mol g·mol
3D model (JSmol)
SMILES
  • Cl.Cl.Cl.FC4(F)3c1ccccc1C(c2c(cccc2)34)N5CCN(CC5)C(O)COc7c6cccnc6ccc7
InChI
  • InChI=1S/C32H31F2N3O2/c33-32(34)29-22-7-1-3-9-24(22)31(25-10-4-2-8-23(25)30(29)32)37-17-15-36(16-18-37)19-21(38)20-39-28-13-5-12-27-26(28)11-6-14-35-27/h1-14,21,29-31,38H,15-20H2/t21-,29-,30+,31-/m1/s1
  • Key:IHOVFYSQUDPMCN-DBEBIPAYSA-N
  (what is this?)  (verify)