| Revision as of 10:46, 9 April 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{chembox}} taken from revid 411565925 of page Betamethasone_17-valerate for the Chem/Drugbox validation project (updated: 'ChEBI', 'StdInChI', 'StdInChIKey', 'CASNo').← Previous edit |
Revision as of 10:47, 9 April 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,084 edits Saving copy of the {{drugbox}} taken from revid 482537657 of page Betamethasone_dipropionate for the Chem/Drugbox validation project (updated: 'ChEBI', 'StdInChI', 'StdInChIKey', 'ChEMBL', 'CAS_...Next edit → |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
{{chembox |
|
{{Drugbox |
|
⚫ |
| IUPAC_name = phenanthren-17-yl] propanoate |
|
|ImageFile=Betamethasone 17-Valerate.png |
|
|
|
| image = Betamethasone_dipropionate.png |
|
|ImageSize=200px |
|
|
|
|
| ⚫ |
|IUPACName=phenanthren-17-yl] pentanoate |
|
|
|
<!--Clinical data--> |
|
|OtherNames= |
|
|
|
| tradename = |
|
|Section1={{Chembox Identifiers |
|
|
|
| Drugs.com = {{drugs.com|monograph|betamethasone}} |
| ⚫ |
| ChemSpiderID = 15673 |
|
|
|
| pregnancy_category = |
| ⚫ |
| InChI = 1/C27H37FO6/c1-5-6-7-23(33)34-27(22(32)15-29)16(2)12-20-19-9-8-17-13-18(30)10-11-24(17,3)26(19,28)21(31)14-25(20,27)4/h10-11,13,16,19-21,29,31H,5-9,12,14-15H2,1-4H3/t16-,19-,20-,21-,24-,25-,26-,27-/m0/s1 |
|
|
|
| legal_status = |
|
| InChIKey = SNHRLVCMMWUAJD-SUYDQAKGBY |
|
|
|
| routes_of_administration = topical |
| ⚫ |
| CASNo = <!-- blanked - oldvalue: 2152-44-5 --> |
|
|
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
|
<!--Pharmacokinetic data--> |
|
| ChEMBL = 1497 |
|
|
|
| bioavailability = |
| ⚫ |
| ChEBI = 31277 |
|
|
|
| protein_bound = |
| ⚫ |
| StdInChI = 1S/C27H37FO6/c1-5-6-7-23(33)34-27(22(32)15-29)16(2)12-20-19-9-8-17-13-18(30)10-11-24(17,3)26(19,28)21(31)14-25(20,27)4/h10-11,13,16,19-21,29,31H,5-9,12,14-15H2,1-4H3/t16-,19-,20-,21-,24-,25-,26-,27-/m0/s1 |
|
|
|
| metabolism = |
| ⚫ |
| StdInChIKey = SNHRLVCMMWUAJD-SUYDQAKGSA-N |
|
|
|
| elimination_half-life = |
| ⚫ |
| PubChem=16533 |
|
|
|
|
| ⚫ |
| SMILES = O=C(O3(C(=O)CO)2(C(O)4(F)/1(\C(=C/C(=O)\C=C\1)CC42C3C)C)C)CCCC |
|
|
|
<!--Identifiers--> |
|
}} |
|
|
|
| CAS_number = <!-- blanked - oldvalue: 5593-20-4 --> |
|
|Section2={{Chembox Properties |
|
|
|
| ATC_prefix = |
|
| Formula=C<sub>27</sub>H<sub>37</sub>FO<sub>6</sub> |
|
|
|
| ATC_suffix = |
|
| MolarMass=476.58 g/mol |
|
|
|
| ATC_supplemental = |
|
| Appearance= |
|
|
⚫ |
| ChEBI = 31276 |
|
| Density= |
|
|
⚫ |
| StdInChI = 1S/C28H37FO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1 |
|
| MeltingPt= |
|
|
⚫ |
| StdInChIKey = CIWBQSYVNNPZIQ-XYWKZLDCSA-N |
|
| BoilingPt= |
|
|
⚫ |
| PubChem = 21800 |
|
| Solubility= |
|
|
|
| DrugBank = |
|
}} |
|
|
⚫ |
| ChemSpiderID = 20490 |
|
|Section3={{Chembox Hazards |
|
|
⚫ |
| ChEMBL = <!-- blanked - oldvalue: 1200384 --> |
|
| MainHazards= |
|
|
|
| C=28 | H=37 | F=1 | O=7 |
|
| FlashPt= |
|
|
|
| molecular_weight = 504.59 g/mol |
|
| Autoignition= |
|
|
⚫ |
| smiles = O=C(OCC(=O)3(OC(=O)CC)2(C(O)4(F)/1(\C(=C/C(=O)\C=C\1)CC42C3C)C)C)CC |
|
}} |
|
|
⚫ |
| InChI = 1/C28H37FO7/c1-6-23(33)35-15-22(32)28(36-24(34)7-2)16(3)12-20-19-9-8-17-13-18(30)10-11-25(17,4)27(19,29)21(31)14-26(20,28)5/h10-11,13,16,19-21,31H,6-9,12,14-15H2,1-5H3/t16-,19-,20-,21-,25-,26-,27-,28-/m0/s1 |
|
|
| InChIKey = CIWBQSYVNNPZIQ-XYWKZLDCBG |
|
|
| synonyms = Betamethasone-17,21-dipropionate |
|
}} |
|
}} |
