Revision as of 10:49, 9 April 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 448002428 of page Bibrocathol for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey', 'CAS_number').← Previous edit | Revision as of 10:50, 9 April 2012 edit undoBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{chembox}} taken from revid 477165069 of page Bilastine for the Chem/Drugbox validation project (updated: 'CASNo').Next edit → | ||
Line 1: | Line 1: | ||
{{ambox | text = This page contains a copy of the infobox ({{tl| |
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} | ||
{{ |
{{Chembox | ||
| ImageFile = Bilastine.svg | |||
| IUPAC_name = 4,5,6,7-tetrabromo-2-hydroxy-1,3,2-benzodioxabismole | |||
| ImageSize = 200px | |||
| image = Bibrocathol structure.svg | |||
| IUPACName = 2--1-piperidinyl}ethyl)phenyl]-2-methylpropanoic acid | |||
| OtherNames = | |||
<!--Clinical data--> | |||
| Section1 = {{Chembox Identifiers | |||
| tradename = | |||
⚫ | | CASNo = <!-- blanked - oldvalue: 202189-78-4 --> | ||
| Drugs.com = {{drugs.com|international|bibrocathol}} | |||
⚫ | | CASNo_Ref = {{cascite|correct|}} | ||
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | |||
⚫ | | UNII = PA1123N395 | ||
| pregnancy_US = <!-- A / B / C / D / X --> | |||
⚫ | | PubChem = 185460 | ||
| pregnancy_category = | |||
⚫ | | ChemSpiderID = 161234 | ||
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | |||
| SMILES = O=C(O)C(c1ccc(cc1)CCN4CCC(c2nc3ccccc3n2CCOCC)CC4)(C)C | |||
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | |||
| InChI = 1/C28H37N3O3/c1-4-34-20-19-31-25-8-6-5-7-24(25)29-26(31)22-14-17-30(18-15-22)16-13-21-9-11-23(12-10-21)28(2,3)27(32)33/h5-12,22H,4,13-20H2,1-3H3,(H,32,33) | |||
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | |||
| InChIKey = ACCMWZWAEFYUGZ-UHFFFAOYAW | |||
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | |||
| StdInChI = 1S/C28H37N3O3/c1-4-34-20-19-31-25-8-6-5-7-24(25)29-26(31)22-14-17-30(18-15-22)16-13-21-9-11-23(12-10-21)28(2,3)27(32)33/h5-12,22H,4,13-20H2,1-3H3,(H,32,33) | |||
| legal_status = | |||
⚫ | | StdInChIKey = ACCMWZWAEFYUGZ-UHFFFAOYSA-N | ||
| routes_of_administration = Topical (eye ointment) | |||
}} | |||
| Section2 = {{Chembox Properties | |||
<!--Pharmacokinetic data--> | |||
| C=28|H=37|N=3|O=3 | |||
| bioavailability = | |||
| Appearance = | |||
| protein_bound = | |||
| |
| Density = | ||
| MeltingPt = | |||
| elimination_half-life = | |||
| |
| BoilingPt = | ||
| Solubility = | |||
}} | |||
<!--Identifiers--> | |||
| Section3 = {{Chembox Hazards | |||
⚫ | | |
||
| |
| MainHazards = | ||
| |
| FlashPt = | ||
| Autoignition = | |||
| StdInChI = 1S/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3 | |||
}} | |||
⚫ | | StdInChIKey = |
||
| Section5 = {{Chembox Pharmacology | |||
⚫ | | PubChem = |
||
| |
| AdminRoutes = | ||
| Bioavail = | |||
⚫ | | ChemSpiderID = |
||
| Metabolism = | |||
⚫ | | |
||
| HalfLife = | |||
⚫ | | UNII = |
||
| ProteinBound = | |||
| ChEMBL = 44875 | |||
| Excretion = | |||
| Legal_status = | |||
<!--Chemical data--> | |||
| Legal_US = | |||
| chemical_formula = | |||
| Legal_UK = | |||
| C=6 | H=1 | Bi=1 | Br=4 | O=3 | |||
| Legal_AU = | |||
| molecular_weight = 650.675 g/mol | |||
| Legal_CA = | |||
| smiles = O1Oc2c(Br)c(Br)c(Br)c(Br)c2O1 | |||
| PregCat = | |||
| InChI = 1/C6H2Br4O2.Bi.H2O/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h11-12H;;1H2/q;+3;/p-3/rC6HBiBr4O3/c8-1-2(9)4(11)6-5(3(1)10)13-7(12)14-6/h12H | |||
| PregCat_AU = | |||
| InChIKey = VTAVFIZOZUAKKE-AJXSUKGNAS | |||
| PregCat_US = }} | |||
| synonyms = Bibrocathin<br>Tetrabromopyrocatechol bismuth | |||
}} | }} |
Revision as of 10:50, 9 April 2012
This page contains a copy of the infobox ({{chembox}}) taken from revid 477165069 of page Bilastine with values updated to verified values. |
{{Chembox | ImageFile = Bilastine.svg | ImageSize = 200px | IUPACName = 2--1-piperidinyl}ethyl)phenyl]-2-methylpropanoic acid | OtherNames = | Section1 = ! colspan=2 style="background: #f8eaba; text-align: center;" |Identifiers
|-
|
3D model (JSmol)|
|-
|
|-
|
PubChem CID|
|-
| UNII
|
|-
| colspan="2" |
InChI- InChI=1S/C28H37N3O3/c1-4-34-20-19-31-25-8-6-5-7-24(25)29-26(31)22-14-17-30(18-15-22)16-13-21-9-11-23(12-10-21)28(2,3)27(32)33/h5-12,22H,4,13-20H2,1-3H3,(H,32,33)Key: ACCMWZWAEFYUGZ-UHFFFAOYSA-N
- InChI=1/C28H37N3O3/c1-4-34-20-19-31-25-8-6-5-7-24(25)29-26(31)22-14-17-30(18-15-22)16-13-21-9-11-23(12-10-21)28(2,3)27(32)33/h5-12,22H,4,13-20H2,1-3H3,(H,32,33)Key: ACCMWZWAEFYUGZ-UHFFFAOYAW
|-
| colspan="2" |
SMILES- O=C(O)C(c1ccc(cc1)CCN4CCC(c2nc3ccccc3n2CCOCC)CC4)(C)C
|- | Section2 = ! colspan=2 style="background: #f8eaba; text-align: center;" |Properties
|-
|
Chemical formula| C28H37N3O3
|- | Molar mass
| 463.622 g·mol
|- | Section3 = | Section5 = }}