This is an old revision of this page, as edited by Beetstra (talk | contribs) at 14:25, 6 December 2011 (Saving copy of the {{drugbox}} taken from revid 457293128 of page Sivelestat for the Chem/Drugbox validation project (updated: 'CAS_number').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.
Revision as of 14:25, 6 December 2011 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 457293128 of page Sivelestat for the Chem/Drugbox validation project (updated: 'CAS_number').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)This page contains a copy of the infobox ({{drugbox}}) taken from revid 457293128 of page Sivelestat with values updated to verified values. |
{{Drugbox | Verifiedfields = changed | verifiedrevid = 457292162 | IUPAC_name = N-{2-phenyl}sulfonyl)amino]benzoyl}glycine | image = Sivelestat.png | ChEMBL_Ref = | ChEMBL = 76688
| tradename = | Drugs.com = International Drug Names | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Rx-only | routes_of_administration = IV
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number_Ref = | CAS_number = | ATC_prefix = none | ATC_suffix = | ATC_supplemental = | PubChem = 107706 | DrugBank_Ref = | DrugBank = | UNII_Ref = | UNII = DWI62G0P59 | KEGG_Ref = | KEGG = D03788 | ChemSpiderID_Ref = | ChemSpiderID = 96875
| chemical_formula = | C=20 | H=22 | N=2 | O=7 | S=1 | molecular_weight = 434.46 g/mol | smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O | StdInChI_Ref = | StdInChI = 1S/C20H22N2O7S/c1-20(2,3)19(26)29-13-8-10-14(11-9-13)30(27,28)22-16-7-5-4-6-15(16)18(25)21-12-17(23)24/h4-11,22H,12H2,1-3H3,(H,21,25)(H,23,24) | StdInChIKey_Ref = | StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N }}