Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation

This is an old revision of this page, as edited by Beetstra (talk | contribs) at 16:13, 10 January 2012 (Saving copy of the {{drugbox}} taken from revid 456793387 of page Xamoterol for the Chem/Drugbox validation project (updated: 'CAS_number').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

Revision as of 16:13, 10 January 2012 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 456793387 of page Xamoterol for the Chem/Drugbox validation project (updated: 'CAS_number').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)
This page contains a copy of the infobox ({{drugbox}}) taken from revid 456793387 of page Xamoterol with values updated to verified values.

{{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 410175973 | IUPAC_name = N-(2-{amino}ethyl)morpholine-4-carboxamide | image = xamoterol.png

| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = | ATC_prefix = C01 | ATC_suffix = CX07 | PubChem = 155774 | IUPHAR_ligand = 538 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 137213 | UNII_Ref = | UNII = 7HE0JQL703 | KEGG_Ref = | KEGG = D06328 | ChEMBL_Ref = | ChEMBL = 75753

| C=16 | H=25 | N=3 | O=5 | molecular_weight = 339.387 g/mol | smiles = O=C(NCCNCC(O)COc1ccc(O)cc1)N2CCOCC2 | InChI = 1/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | InChIKey = DXPOSRCHIDYWHW-UHFFFAOYAQ | StdInChI_Ref = | StdInChI = 1S/C16H25N3O5/c20-13-1-3-15(4-2-13)24-12-14(21)11-17-5-6-18-16(22)19-7-9-23-10-8-19/h1-4,14,17,20-21H,5-12H2,(H,18,22) | StdInChIKey_Ref = | StdInChIKey = DXPOSRCHIDYWHW-UHFFFAOYSA-N }}