Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation

This is an old revision of this page, as edited by Beetstra (talk | contribs) at 11:23, 21 November 2011 (Saving copy of the {{drugbox}} taken from revid 461468732 of page Pralatrexate for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

Revision as of 11:23, 21 November 2011 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 461468732 of page Pralatrexate for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CAS_number').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)
This page contains a copy of the infobox ({{drugbox}}) taken from revid 461468732 of page Pralatrexate with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 400859808 | IUPAC_name = N-(4-{1-but-3-yn-1-yl}benzoyl)-L-glutamic acid | image = Pralatrexate.png

| tradename = | Drugs.com = Monograph | licence_US = Pralatrexate | pregnancy_AU = | pregnancy_US = | pregnancy_category = D | legal_AU = | legal_CA = | legal_UK = | legal_US = Rx-only | legal_status = | routes_of_administration = Intravenous

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref = | CAS_number = | ATC_prefix = L01 | ATC_suffix = BA05 | PubChem = 148121 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 130578 | UNII_Ref = | UNII = A8Q8I19Q20 | ChEMBL_Ref = | ChEMBL = | C=23 | H=23 | N=7 | O=5 | molecular_weight = 477.47 g/mol | smiles = O=C(O)(NC(=O)c1ccc(cc1)C(CC#C)Cc2nc3c(nc2)nc(nc3N)N)CCC(=O)O | InChI = 1/C23H23N7O5/c1-2-3-14(10-15-11-26-20-18(27-15)19(24)29-23(25)30-20)12-4-6-13(7-5-12)21(33)28-16(22(34)35)8-9-17(31)32/h1,4-7,11,14,16H,3,8-10H2,(H,28,33)(H,31,32)(H,34,35)(H4,24,25,26,29,30)/t14?,16-/m0/s1 | InChIKey = OGSBUKJUDHAQEA-WMCAAGNKBV | StdInChI_Ref = | StdInChI = 1S/C23H23N7O5/c1-2-3-14(10-15-11-26-20-18(27-15)19(24)29-23(25)30-20)12-4-6-13(7-5-12)21(33)28-16(22(34)35)8-9-17(31)32/h1,4-7,11,14,16H,3,8-10H2,(H,28,33)(H,31,32)(H,34,35)(H4,24,25,26,29,30)/t14?,16-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = OGSBUKJUDHAQEA-WMCAAGNKSA-N }}