Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
< Misplaced Pages:WikiProject Chemicals | Chembox validation

This is an old revision of this page, as edited by Beetstra (talk | contribs) at 13:47, 10 January 2012 (Saving copy of the {{drugbox}} taken from revid 456547335 of page Trandolapril for the Chem/Drugbox validation project (updated: 'DrugBank').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.

Revision as of 13:47, 10 January 2012 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 456547335 of page Trandolapril for the Chem/Drugbox validation project (updated: 'DrugBank').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)
This page contains a copy of the infobox ({{drugbox}}) taken from revid 456547335 of page Trandolapril with values updated to verified values.

{{Drugbox | Verifiedfields = changed | verifiedrevid = 438851573 | IUPAC_name = (2S,3aR,7aS)-1-amino}propanoyl]-octahydro-1H-indole-2-carboxylic acid | image = Trandolapril.svg | width2 = 150

| tradename = Mavik | Drugs.com = Monograph | MedlinePlus = a697010 | pregnancy_US = D | legal_status = Rx-only | routes_of_administration = Oral

| bioavailability = | protein_bound = Trandolapril 80%
(independent of concentration)
Trandolaprilat 65 to 94%
(concentration-dependent) | metabolism = Hepatic | elimination_half-life = 6 hours (trandolapril)
10 hours (trandolaprilat) | excretion = Fecal and renal

| CASNo_Ref = | CAS_number_Ref = | CAS_number = 87679-37-6 | ATC_prefix = C09 | ATC_suffix = AA10 | PubChem = 5484727 | DrugBank_Ref = | DrugBank = DB00519 | ChemSpiderID_Ref = | ChemSpiderID = 4588590 | UNII_Ref = | UNII = 1T0N3G9CRC | KEGG_Ref = | KEGG = D00383 | ChEMBL_Ref = | ChEMBL = 1519

| C=24 | H=34 | N=2 | O=5 | molecular_weight = 430.537 g/mol | smiles = O=C(OCC)(N(C(=O)N1(C(=O)O)C2CCCC12)C)CCc3ccccc3 | InChI = 1/C24H34N2O5/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29)/t16-,18+,19-,20-,21-/m0/s1 | InChIKey = VXFJYXUZANRPDJ-WTNASJBWBX | StdInChI_Ref = | StdInChI = 1S/C24H34N2O5/c1-3-31-24(30)19(14-13-17-9-5-4-6-10-17)25-16(2)22(27)26-20-12-8-7-11-18(20)15-21(26)23(28)29/h4-6,9-10,16,18-21,25H,3,7-8,11-15H2,1-2H3,(H,28,29)/t16-,18+,19-,20-,21-/m0/s1 | StdInChIKey_Ref = | StdInChIKey = VXFJYXUZANRPDJ-WTNASJBWSA-N }}

Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox Add topic