This is an old revision of this page, as edited by Beetstra (talk | contribs) at 09:32, 20 February 2012 (Saving copy of the {{drugbox}} taken from revid 451605616 of page SRT2183 for the Chem/Drugbox validation project (updated: 'ChEMBL').). The present address (URL) is a permanent link to this revision, which may differ significantly from the current revision.
Revision as of 09:32, 20 February 2012 by Beetstra (talk | contribs) (Saving copy of the {{drugbox}} taken from revid 451605616 of page SRT2183 for the Chem/Drugbox validation project (updated: 'ChEMBL').)(diff) ← Previous revision | Latest revision (diff) | Newer revision → (diff)This page contains a copy of the infobox ({{drugbox}}) taken from revid 451605616 of page SRT2183 with values updated to verified values. |
{{Drugbox | Watchedfields = changed | verifiedrevid = 451167855 | IUPAC_name = N-methyl}imidazothiazol-6-yl)phenyl]naphthalene-2-carboxamide | image = SRT2183 skeletal.svg
| tradename = | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = Investigational | routes_of_administration =
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = | ATC_prefix = None | ATC_suffix = | ChEMBL = 403308 | PubChem = 24180126 | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 23315224
| C=27 | H=24 | N=4 | O=2 | S=1 | molecular_weight = 468.570 g/mol | smiles = c1ccc2cc(ccc2c1)C(=O)Nc3ccccc3c4cn5c(csc5n4)CN6CC(C6)O | StdInChI_Ref = | StdInChI = 1S/C27H24N4O2S/c32-22-11-12-30(15-22)14-21-17-34-27-29-25(16-31(21)27)23-7-3-4-8-24(23)28-26(33)20-10-9-18-5-1-2-6-19(18)13-20/h1-10,13,16-17,22,32H,11-12,14-15H2,(H,28,33)/t22-/m1/s1 | StdInChIKey_Ref = | StdInChIKey = MUFSINOSQBMSLE-JOCHJYFZSA-N }}