| Revision as of 13:31, 9 March 2011 editCitation bot 1 (talk | contribs)Bots130,044 editsmNo edit summary← Previous edit |
Latest revision as of 18:41, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Phenols; added Category:4-Hydroxyphenyl compounds using HotCat |
| (35 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{lowercase title}} |
| ⚫ |
{{DISPLAYTITLE:''alpha''-Cyano-4-hydroxycinnamic acid}} |
|
|
{{chembox |
|
{{chembox |
|
|
|Verifiedfields = changed |
| ⚫ |
|Name=α-Cyano-4-hydroxycinnamic acid |
|
|
|
|Watchedfields = changed |
|
|ImageFile=Cyanohydroxycinnamic acid.png |
|
|
|
|verifiedrevid = 446778754 |
|
|ImageSize=200px |
|
|
⚫ |
|Name =α-Cyano-4-hydroxycinnamic acid |
| ⚫ |
|IUPACName=(''E'')-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate |
|
|
|OtherNames=''alpha''-cyano-4-hydroxycinnamic acid<br>''alpha''-cyano-4-hydroxycinnamate<br>2-cyano-4-hydroxycinnamate |
|
|ImageFile =alpha-cyano-4-hydroxycinnamic acid.svg |
|
|
|ImageAlt = Structural formula of α-cyano-4-hydroxycinnamic acid |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
⚫ |
|ImageFile1 = Alpha-Cyano-4-hydroxycinnamic acid 3D spacefill.png |
| ⚫ |
| CASNo=28166-41-8 |
|
|
|
|ImageSize1 = 180 |
|
| PubChem=6931228 |
|
|
|
|ImageAlt1 = Space-filling model of the α-cyano-4-hydroxycinnamic acid molecule |
|
| SMILES=C1=CC(=CC=C1C=C(C#N)C(=O))O |
|
|
⚫ |
|PIN =(2''E'')-2-Cyano-3-(4-hydroxyphenyl)prop-2-enoic acid |
| ⚫ |
}} |
|
|
|
|OtherNames =α-Cyano-''p''-hydroxycinnamic acid<br>2-Cyano-4-hydroxycinnamic acid<br>2-Cyano-3-(4-hydroxyphenyl)-2-propenoic acid<br>2-Cyano-3-(4-hydroxyphenyl)-2-acrylic acid<br>4-Hydroxy-α-cyanocinnamic acid |
| ⚫ |
|Section2= {{Chembox Properties |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
| C=10|H=7|O=3|N=1 |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| Appearance=Yellow powder |
|
|
⚫ |
|CASNo =28166-41-8 |
|
| Density= |
|
|
|
|
|
| MeltingPt=245-250 °C |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| BoilingPt= |
|
|
|
|
|
| Solubility= |
|
|
|
| UNII = NL5EEM9E2G |
|
}} |
|
|
|
|PubChem = 5328791 |
|
|Section3= {{Chembox Hazards |
|
|
|
|ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| MainHazards= |
|
|
|
|ChemSpiderID = 4485953 |
|
| FlashPt= |
|
|
|
|SMILES = c1cc(ccc1/C=C(\C#N)/C(=O)O)O |
|
| Autoignition= |
|
|
|
|InChI = 1/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14)/b8-5+ |
|
}} |
|
|
|
|InChIKey = AFVLVVWMAFSXCK-VMPITWQZBB |
|
|
|StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
|StdInChI = 1S/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14)/b8-5+ |
|
|
|StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
|StdInChIKey = AFVLVVWMAFSXCK-VMPITWQZSA-N |
|
|
|ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
|ChEBI = 64340}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
|C=10 | H=7 | O=3 | N=1 |
|
⚫ |
|Appearance = Yellow powder |
|
|
|MeltingPtC = 245 to 250 |
|
⚫ |
}} |
|
}} |
|
}} |
|
|
|
|
|
'''α-Cyano-4-hydroxycinnamic acid''', also written as '''''alpha''-cyano-4-hydroxycinnamic acid''' and abbreviated '''CHCA''', is a ] derivative and is a member of the ] family. It is used as a matrix for ]s and ] in ] ] analyses.<ref>{{cite journal |title=-α-Cyano-4-hydroxycinnamic acid as a matrix for matrix-assisted laser desorption mass spectrometry |journal=Org. Mass Spectrom. |volume=27 |issue= 2|pages=156–8 |year=1992 |doi=10.1002/oms.1210270217 |author=Beavis, R. C. |last2=Chaudhary |first2=T. |last3=Chait |first3=B. T. }}</ref> |
|
'''α-Cyano-4-hydroxycinnamic acid''', also written as '''''alpha''-cyano-4-hydroxycinnamic acid''' and abbreviated '''CHCA''' or '''HCCA''', is a ] derivative and is a member of the ] family. The ] form is '''α-cyano-4-hydroxycinnamate'''. |
|
|
|
|
|
==Matrix-assisted laser desorption/ionization== |
|
|
α-Cyano-4-hydroxycinnamic acid is used as a matrix for ]s and ] in ] ] analyses.<ref>{{cite journal |title=-α-Cyano-4-hydroxycinnamic acid as a matrix for matrix-assisted laser desorption mass spectrometry |journal=Org. Mass Spectrom. |volume=27 |issue= 2|pages=156–8 |year=1992 |doi=10.1002/oms.1210270217 |author=Beavis, R. C. |last2=Chaudhary |first2=T. |last3=Chait |first3=B. T.}}</ref><ref>{{cite book|author1=Franz Hillenkamp|author2=Jasna Peter-Katalinic|title=MALDI MS: A Practical Guide to Instrumentation, Methods and Applications|url=https://books.google.com/books?id=XZczAQAAQBAJ&pg=PA110|date=3 October 2013|publisher=Wiley|isbn=978-3-527-67373-5|pages=110–}}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
| Line 35: |
Line 50: |
|
|
|
|
|
{{DEFAULTSORT:Cyano-4-hydroxycinnamic acid, alpha-}} |
|
{{DEFAULTSORT:Cyano-4-hydroxycinnamic acid, alpha-}} |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|
|
] |
|