Revision as of 20:51, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (rep← Previous edit |
Latest revision as of 03:44, 12 January 2025 edit undoDavemck (talk | contribs)Extended confirmed users121,142 editsm rmv duplicate parmTag: Manual revert |
(30 intermediate revisions by 19 users not shown) |
Line 1: |
Line 1: |
|
{{DISPLAYTITLE:''delta''-Tocopherol}} |
|
{{DISPLAYTITLE:δ-Tocopherol}} |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 443563737 |
|
| verifiedrevid = 443565389 |
|
|Reference=<ref> at ]</ref> |
|
| Reference = <ref> at ]</ref> |
|
|Name=δ-Tocopherol |
|
| Name = δ-Tocopherol |
|
|ImageFile=Delta-tocopherol.png |
|
| ImageFile = Delta-tocopherol.png |
⚫ |
|ImageSize=200px |
|
|
|
| ImageClass = skin-invert-image |
⚫ |
|IUPACName=(2''R'')-2,8-Dimethyl-2--6-chromanol |
|
|
⚫ |
| ImageSize = 200px |
⚫ |
|OtherNames= |
|
|
⚫ |
| PIN = (2''R'')-2,8-Dimethyl-2--2''H''-1-benzopyran-6-ol |
|
⚫ |
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 83144 |
|
| ChemSpiderID = 83144 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
Line 20: |
Line 22: |
|
| StdInChIKey = GZIFEOYASATJEH-VHFRWLAGSA-N |
|
| StdInChIKey = GZIFEOYASATJEH-VHFRWLAGSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=119-13-1 |
|
| CASNo = 119-13-1 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
⚫ |
| PubChem=92094 |
|
|
|
| ChEMBL = 1451395 |
⚫ |
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| PubChem = 92094 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 47772 |
|
| ChEBI = 47772 |
|
| SMILES = Oc2cc(c1O(CCc1c2)(C)CCC(C)CCC(C)CCCC(C)C)C |
|
| SMILES = Oc2cc(c1O(CCc1c2)(C)CCC(C)CCC(C)CCCC(C)C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub> |
|
| Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub> |
|
| MolarMass=402.65 g/mol |
|
| MolarMass=402.65 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''δ-Tocopherol''' is one of the chemical ]s that is considered ]. As a food additive, it has ] E309. |
|
'''δ-Tocopherol''' (''delta''-tocopherol) is a ] and one of the ]s that is considered ]. As a ], it has ] E309.<ref name="foodgov">{{cite web |title=Approved additives and E numbers |url=https://www.food.gov.uk/business-guidance/approved-additives-and-e-numbers |access-date=11 March 2022}}</ref> |
|
|
|
|
See the main article ] for more information. |
|
|
|
|
|
|
==See also== |
|
==See also== |
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
|
==References== |
|
==References== |
Line 58: |
Line 60: |
|
{{Vitamin}} |
|
{{Vitamin}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
] |
|