Misplaced Pages

Δ-Tocopherol: Difference between revisions

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 20:51, 7 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref') per Chem/Drugbox validation (rep← Previous edit Latest revision as of 03:44, 12 January 2025 edit undoDavemck (talk | contribs)Extended confirmed users121,142 editsm rmv duplicate parmTag: Manual revert 
(30 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{DISPLAYTITLE:''delta''-Tocopherol}} {{DISPLAYTITLE:δ-Tocopherol}}
{{chembox {{chembox
| Verifiedfields = changed
| verifiedrevid = 443563737 | verifiedrevid = 443565389
|Reference=<ref> at ]</ref> | Reference = <ref> at ]</ref>
|Name=δ-Tocopherol | Name = δ-Tocopherol
|ImageFile=Delta-tocopherol.png | ImageFile = Delta-tocopherol.png
|ImageSize=200px
| ImageClass = skin-invert-image
|IUPACName=(2''R'')-2,8-Dimethyl-2--6-chromanol
| ImageSize = 200px
|OtherNames=
| PIN = (2''R'')-2,8-Dimethyl-2--2''H''-1-benzopyran-6-ol
| OtherNames =
|Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 83144 | ChemSpiderID = 83144
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
Line 20: Line 22:
| StdInChIKey = GZIFEOYASATJEH-VHFRWLAGSA-N | StdInChIKey = GZIFEOYASATJEH-VHFRWLAGSA-N
| CASNo_Ref = {{cascite|correct|CAS}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=119-13-1 | CASNo = 119-13-1
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| PubChem=92094
| ChEMBL = 1451395
| ChEBI_Ref = {{ebicite|correct|EBI}}
| PubChem = 92094
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 47772 | ChEBI = 47772
| SMILES = Oc2cc(c1O(CCc1c2)(C)CCC(C)CCC(C)CCCC(C)C)C | SMILES = Oc2cc(c1O(CCc1c2)(C)CCC(C)CCC(C)CCCC(C)C)C
}} }}
|Section2={{Chembox Properties |Section2={{Chembox Properties
| Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub> | Formula=C<sub>27</sub>H<sub>46</sub>O<sub>2</sub>
| MolarMass=402.65 g/mol | MolarMass=402.65 g/mol
| Appearance= | Appearance=
| Density= | Density=
| MeltingPt= | MeltingPt=
| BoilingPt= | BoilingPt=
| Solubility= | Solubility=
}} }}
|Section3={{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt= | FlashPt=
| AutoignitionPt =
| Autoignition=
}} }}
}} }}


'''δ-Tocopherol''' is one of the chemical ]s that is considered ]. As a food additive, it has ] E309. '''δ-Tocopherol''' (''delta''-tocopherol) is a ] and one of the ]s that is considered ]. As a ], it has ] E309.<ref name="foodgov">{{cite web |title=Approved additives and E numbers |url=https://www.food.gov.uk/business-guidance/approved-additives-and-e-numbers |access-date=11 March 2022}}</ref>

See the main article ] for more information.


==See also== ==See also==
* ] * ]
* ]
* ] * ]
* ]


==References== ==References==
Line 58: Line 60:
{{Vitamin}} {{Vitamin}}


] ]
]

]
Δ-Tocopherol: Difference between revisions Add topic