| Revision as of 07:36, 7 December 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 edits added Category:Resorcinols using HotCat← Previous edit |
Latest revision as of 19:08, 16 September 2023 edit undoInnerstream (talk | contribs)Autopatrolled, Extended confirmed users4,071 editsNo edit summary |
| (32 intermediate revisions by 23 users not shown) |
| Line 1: |
Line 1: |
|
|
{{lowercase title}} |
|
{{chembox |
|
{{chembox |
|
|
| verifiedrevid = 401016194 |
| ⚫ |
| Name = Psi-tectorigenin |
|
|
|
| Name = ψ-Tectorigenin |
| ⚫ |
| ImageFile = Psi-tectorigenin.PNG |
|
|
⚫ |
| ImageFile = Psi-tectorigenin.svg |
|
| ImageSize = 200px |
|
| ImageSize = 220px |
| ⚫ |
| IUPACName = 5,7-dihydroxy-3-(4-hydroxyphenyl)-8-methoxychromen-4-one |
|
|
⚫ |
| ImageFile1 = Psi-tectorigenin-3D-balls.png |
| ⚫ |
| OtherNames = Isotectorigenin<br>Pseudotectorigenin<br>5,7,4'-Trihydroxy-8-methoxyisoflavone |
|
|
|
| ImageSize1 = 220 |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageAlt1 = Psi-Tectorigenin molecule |
|
|
| IUPACName = 4′,5,7-Trihydroxy-8-methoxyisoflavone |
|
⚫ |
| SystematicName = 5,7-Dihydroxy-3-(4-hydroxyphenyl)-8-methoxy-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames = Isotectorigenin<br>Pseudotectorigenin |
|
⚫ |
|Section1={{Chembox Identifiers |
|
| CASNo = 13111-57-4 |
|
| CASNo = 13111-57-4 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII = 8HXB4THX7F |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| PubChem = 5353911 |
|
| PubChem = 5353911 |
|
|
| ChEMBL = 242741 |
|
| Beilstein = |
|
| Beilstein = |
|
| SMILES = COC1=C(C=C(C2=C1OC=C(C2=O)C3=CC=C(C=C3)O)O)O |
|
| SMILES = COC1=C(C=C(C2=C1OC=C(C2=O)C3=CC=C(C=C3)O)O)O |
|
|
| ChemSpiderID = 4510255 |
|
|
| StdInChI = 1S/C16H12O6/c1-21-15-12(19)6-11(18)13-14(20)10(7-22-16(13)15)8-2-4-9(17)5-3-8/h2-7,17-19H,1H3 |
|
|
| StdInChIKey = UYLQOGTYNFVQQX-UHFFFAOYSA-N |
|
|
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=16 | H=12 | O=6 |
|
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>6</sub> |
|
|
| MolarMass = 300.26 g/mol |
|
|
| ExactMass = 300.063388 |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 20: |
Line 32: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
'''Psi-tectorigenin''' is an ], a type of flavonoid. It can be isolated from ''] sp''<ref></ref>, '']'', '']'' and '']'' sp. No. 644<ref></ref>. |
|
|
|
|
|
|
|
'''ψ-Tectorigenin''' is an ], a type of flavonoid. It can be isolated from '']'', '']''. It can also be isolated from the bacterium ''] sp'',<ref>{{cite journal | pmid = 1917707 | year = 1991 | last1 = Imoto | first1 = M | last2 = Shimura | first2 = N | last3 = Umezawa | first3 = K | title = Inhibition of epidermal growth factor-induced activation of phospholipase C by psi-tectorigenin | volume = 44 | issue = 8 | pages = 915–7 | journal = The Journal of Antibiotics | doi=10.7164/antibiotics.44.915| doi-access = free }}</ref> and from the mold '']'' sp. No. 644.<ref></ref> |
| ⚫ |
==References== |
|
|
|
|
|
|
==See also== |
|
|
* ], a related favonoid |
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{isoflavone}} |
|
{{isoflavone}} |
|
|
|
|
|
|
{{DEFAULTSORT:Tectorigenin, psi-}} |
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{Aromatic-stub}} |