| Revision as of 16:31, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 413093172 of page 1,8-Diaminonaphthalene for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 20:51, 22 February 2024 edit Maxim Masiutin (talk | contribs)Extended confirmed users, IP block exemptions, Pending changes reviewers31,043 edits Add: bibcode, issue. | Use this tool. Report bugs. | #UCB_Gadget |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 413090959 |
|
| verifiedrevid = 477206675 |
|
|ImageFile=1,8-Diaminonaphthalene.png |
|
|
|
| ImageFile=Chemical structural formula of 1,8-diaminonaphthalene.svg |
|
|ImageSize= |
|
| ImageSize= 150px |
|
|IUPACName=naphthalene-1,8-diamine |
|
| PIN=Naphthalene-1,8-diamine |
|
|OtherNames= |
|
|
|
| OtherNames= Deltamin, 1,8-Naphthalenediamine |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 61381 |
|
| ChemSpiderID = 61381 |
|
| InChI = 1/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2 |
|
| InChI = 1/C10H10N2/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,11-12H2 |
| Line 18: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YFOOEYJGMMJJLS-UHFFFAOYSA-N |
|
| StdInChIKey = YFOOEYJGMMJJLS-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 479-27-6 --> |
|
|
|
| CASNo=479-27-6 |
| ⚫ |
| PubChem=68067 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=C1=CC2=C(C(=C1)N)C(=CC=C2)N |
|
|
|
| UNII = IKA7029YH9 |
|
⚫ |
| PubChem=68067 |
|
⚫ |
| SMILES=C1=CC2=C(C(=C1)N)C(=CC=C2)N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>10</sub>N<sub>2</sub> |
|
| Formula=C{{sub|10}}H{{sub|10}}N{{sub|2}} |
|
| MolarMass=158.1998 |
|
| MolarMass=158.1998 |
|
⚫ |
}} |
|
| Appearance= |
|
|
⚫ |
|Section8={{Chembox Related |
|
| Density= |
|
|
⚫ |
| OtherFunction_label = ]s |
|
| MeltingPt= |
|
|
⚫ |
| OtherFunction = ]<br />] |
|
| BoilingPt= |
|
|
⚫ |
}} |
|
| Solubility= |
|
| ⚫ |
}} |
|
|
|Section3={{Chembox Hazards |
|
|
| MainHazards= |
|
|
| FlashPt= |
|
|
| Autoignition= |
|
| ⚫ |
}} |
|
| ⚫ |
| Section8 = {{Chembox Related |
|
| ⚫ |
| Function = ]s |
|
| ⚫ |
| OtherFunctn = ]<br />] |
|
|
}} |
|
|
}} |
|
}} |
|
|
|
|
|
'''1,8-Diaminonaphthalene''' is an ] with the formula C{{sub|10}}H{{sub|6}}(NH{{sub|2}}){{sub|2}}. It is one of several ]ic ]s. It is a colorless solid that darkens in air due to oxidation. It is a precursor to commercial pigments.<ref name=Ullmann>{{Ullmann|first1=Gerald|last1=Booth|title=Naphthalene Derivatives|year=2005|doi10.1002/14356007.a17_009}}.</ref> |
|
|
|
|
|
==Synthesis and reactions== |
|
|
] |
|
|
It is prepared by reduction of 1,8-dinitronaphthalene, which in turn is obtained as a mixture of isomers by nitration of 1-nitronaphthalene. |
|
|
|
|
|
Upon treatment with ] derivatives, the diamine converts to phthaloperinones.<ref>{{cite journal |doi=10.1021/ol201973w|title=Green Synthesis of Polycyclic Benzimidazole Derivatives and Organic Semiconductors|year=2011|last1=Mamada|first1=Masashi|last2=PéRez-BolíVar|first2=César|last3=Anzenbacher|first3=Pavel|journal=Organic Letters|volume=13|issue=18|pages=4882–4885|pmid=21863817|s2cid=32185653 |url=https://scholarworks.bgsu.edu/chem_pub/145}}</ref> The derivative from phthalic anhydride itself, Solvent Orange 60, is a useful orange pigment. It is a precursor to ]. This compound used to produce perimidines by various aldehydes.<ref>{{cite journal|last=F.K. Behbahani, F.M.Golchin|doi=10.1016/j.jtusci.2015.10.004|title=A new catalyst for the synthesis of 2-substituted perimidines catalysed by FePO4|journal=Journal of Taibah University for Science|year=2017|volume=11|issue=1 |pages=85–89|s2cid=98648448|doi-access=free|bibcode=2017JTUS...11...85B |url=https://zenodo.org/records/3593823/files/A%20new%20catalyst%20for%20the%20synthesis%20of%202%20substituted%20perimidines%20catalysed%20by%20FePO4(1).pdf}}</ref> |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Diaminonaphthalene, 1, 8-}} |
|
|
] |
|
|
] |