| Revision as of 08:47, 24 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Ellagitannin |
Latest revision as of 10:47, 28 December 2024 edit Graeme Bartlett (talk | contribs)Administrators249,755 edits more ids |
| Line 1: |
Line 1: |
|
|
{{DISPLAYTITLE:1-α-''O''-Galloylpunicalagin}} |
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 400996763 |
|
| verifiedrevid = 441141353 |
|
| Name = Punicalagin alpha |
|
| Name = 1-α-''O''-Galloylpunicalagin |
|
| ImageFile = Alpha punicalagin.png |
|
| ImageFile = Alpha punicalagin.png |
|
⚫ |
| ImageName = Chemical structure of 1-α-''O''-galloylpunicalagin |
|
| ImageSize = 200px |
|
| ⚫ |
| ImageName = Chemical structure of punicalagin alpha |
|
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = 1-alpha-O-galloylpunicalagin<!-- <br> --> |
|
| OtherNames = Combreglutinin<br>Teroblongin |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 108906-54-3 |
|
|
| ChemSpiderID = 129561793 |
|
| CASNo_Ref = |
|
|
| CASOther = |
|
| PubChem = 165363817 |
|
|
| StdInChI=1S/C55H32O34/c56-13-1-8(2-14(57)30(13)62)48(75)89-55-47-46(87-51(78)10-4-16(59)31(63)35(67)20(10)21-11(52(79)88-47)5-17(60)32(64)36(21)68)43-19(83-55)7-82-49(76)9-3-15(58)33(65)37(69)22(9)24-28-26-27-29(54(81)86-44(26)41(73)39(24)71)25(40(72)42(74)45(27)85-53(28)80)23-12(50(77)84-43)6-18(61)34(66)38(23)70/h1-6,19,43,46-47,55-74H,7H2/t19?,43-,46-,47+,55?/m1/s1 |
|
| PubChem = |
|
|
|
| StdInChIKey = PMOWTIMRSISLEU-NTBKRYJNSA-N |
|
| SMILES = |
|
|
|
| SMILES = C1C2(3(C(O2)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O3)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7C8=C(C(=C9C2=C8C(=O)OC3=C(C(=C(C4=C(C(=C(C=C4C(=O)O1)O)O)O)C(=C23)C(=O)O9)O)O)O)O)O)O)O |
|
| InChI = |
|
|
| MeSHName = |
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>55</sub>H<sub>32</sub>O<sub>34</sub> |
|
| C=55 | H=32 | O=34 |
|
| MolarMass = 1236.82 g/mol |
|
|
| ExactMass = 1236.077498 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
|
}} |
|
}}'''Punicalagin alpha''' is a ], a type of hydrolysable tannins. |
|
|
|
'''1-α-''O''-Galloylpunicalagin''' is an ] of ] and ], a type of ]. It is found in the pomegranate ('']'') and in '']''.<ref>Combreglutinin, a Hydrolyzable Tannin from Combretum glutinosum. Akino Jossang, Jean-Louis Pousset and Bernard Bodo, J. Nat. Prod., 1994, volume 57, issue 6, pages 732–737, {{doi|10.1021/np50108a008}}</ref> |
|
|
|
|
|
A study in Taiwan showed that punicalagin alpha (1-alpha-O-galloylpunicalagin) induced ] production in a dose-dependent manner in ] cells<ref>http://www.ncbi.nlm.nih.gov/pubmed/18435486 "Tannin 1-alpha-O-galloylpunicalagin induces the calcium-dependent activation of endothelial nitric-oxide synthase via the phosphatidylinositol 3-kinase/Akt pathway in endothelial cells." </ref> as well as inhibited ], ] and ], all of which play roles in cancer growth, so their inhibition points to punicalagins' potential as strong cancer suppressors.{{Fact|date=February 2009}} |
|
A study in Taiwan showed that 1-α-''O''-galloylpunicalagin induced ] production in a dose-dependent manner in ] cells via the ].<ref>{{cite journal | pmid = 18435486 | year = 2008 | last1 = Chen | first1 = LG | last2 = Liu | first2 = YC | last3 = Hsieh | first3 = CW | last4 = Liao | first4 = BC | last5 = Wung | first5 = BS | title = Tannin 1-alpha-O-galloylpunicalagin induces the calcium-dependent activation of endothelial nitric-oxide synthase via the phosphatidylinositol 3-kinase/Akt pathway in endothelial cells | volume = 52 | issue = 10 | pages = 1162–71 | doi = 10.1002/mnfr.200700335 | journal = Molecular Nutrition & Food Research}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{pomegranate ellagitannin}} |
|
{{Ellagitannin}} |
|
|
|
|
|
|
|
{{DEFAULTSORT:Galloylpunicalagin, 1-alpha-O-}} |
| ⚫ |
] |
|
|
|
] |
|
|
] |
|
⚫ |
] |
|
|
|
|
|
{{natural-phenol-stub}} |
|
{{aromatic-stub}} |