| Revision as of 16:46, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456498248 of page 10-Deacetylbaccatin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 13:09, 2 June 2020 edit Fswitzer4 (talk | contribs)Extended confirmed users10,572 editsm Validated CAS and added FDA UNII |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
| ⚫ |
| verifiedrevid = 456497308 |
|
|
|ImageFile=Deacetylbaccatin.png |
|
| Name = 10-Deacetylbaccatin III |
|
⚫ |
| verifiedrevid = 477208680 |
| ⚫ |
|ImageSize=200px |
|
|
|
| ImageFile=Deacetylbaccatin.png |
| ⚫ |
|IUPACName=<small> (''2aR,4S,4aS,6R,9S,11S,12S,12aR,12bS'')- 12b-(Acetyloxy)-12-(benzoyloxy)- 1,2a,3,4,4a,6,9,10,11,12,12a,12b- dodecahydro-4,6,9,11-tetrahydroxy- 4a,8,13,13-tetramethyl-7,11-methano- ''5H''-cyclodeca(3,4)benz(1,2-b) oxet-5-one</small> |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames=10-Deacetylbaccatin III<br>10-Deacetylbaccatine III |
|
|
|
| ImageFile1 = 10-Deacetylbaccatin-III-3D-balls.png |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageSize1 = 200 |
| ⚫ |
| CASNo_Ref = {{cascite|changed|??}} |
|
|
|
| ImageAlt1 = 10-Deacetylbaccatin III molecule |
|
| CASNo = <!-- blanked - oldvalue: 32981-86-5 --> |
|
|
⚫ |
| IUPACName=<small> (2a''R'',4''S'',4a''S'',6''R'',9''S'',11''S'',12''S'',12a''R'',12b''S'')-12b-(Acetyloxy)-12-(benzoyloxy)-1,2a,3,4,4a,6,9,10,11,12,12a,12b-dodecahydro-4,6,9,11-tetrahydroxy-4a,8,13,13-tetramethyl-7,11-methano-5''H''-cyclodeca(3,4)benz(1,2-b)oxet-5-one</small> |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
⚫ |
| OtherNames=10-Deacetylbaccatin III<br>10-Deacetylbaccatine III |
|
⚫ |
|Section1={{Chembox Identifiers |
|
⚫ |
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo=32981-86-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4K6EWW2Z45 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 393912 |
|
| ChEMBL = 393912 |
|
| PubChem=154272 |
|
| PubChem=154272 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 135935 |
|
| ChemSpiderID = 135935 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| Line 21: |
Line 27: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = YWLXLRUDGLRYDR-ZHPRIASZSA-N |
|
| StdInChIKey = YWLXLRUDGLRYDR-ZHPRIASZSA-N |
|
| SMILES=CC1=C2C(C(=O)C3 (C(CC4C(C3C(C(C2(C)C)(CC1O)O) OC(=O)C5=CC=CC=C5)(CO4) OC(=O)C)O)C)O |
|
| SMILES = CC1=C2C(C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1O)O)OC(=O)C5=CC=CC=C5)(CO4)OC(=O)C)O)C)O |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>29</sub>H<sub>36</sub>O<sub>10</sub> |
|
| Formula=C<sub>29</sub>H<sub>36</sub>O<sub>10</sub> |
|
| MolarMass=544.59 |
|
| MolarMass=544.59 g/mol |
|
| Appearance= |
|
| Appearance= colorless solid |
|
| Density= |
|
| Density= |
|
|
| MeltingPtC= 234 |
|
| MeltingPt= |
|
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility=insoluble |
|
|
| SolubleOther = soluble in ] |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''10-Deacetylbaccatins''' are a series of closely related natural ]s isolated from the yew tree (Genera '']''). 10-Deacetylbaccatin III is a precursor to the anti-cancer drug ] (Taxotere). |
|
|
|
|
|
] converts 10-deacetylbaccatin to ]: |
|
|
:acetyl-CoA + 10-deacetylbaccatin III {{eqm}} CoA + baccatin III |
|
|
|
|
|
==External links== |
|
|
* {{PubChem|6712096}} - 7-Epi-10-Deacetylbaccatin III |
|
|
* {{PubChem|9872117}} - 10-Deacetylbaccatin V |
|
|
* {{PubChem|5316348}} - 10-Deacetylbaccatin VI |
|
|
* {{PubChem|5317065}} - 13-Epi-10-Deacetylbaccatin III |
|
|
* {{PubChem|15957452}} - 13--2-debenzoyl-2-(4-methoxybenzoxyl)-10-deacetylbaccatin III |
|
|
* {{PubChem|15957458}} - 10-''N'',''N''-Dimethylglycyl-13--10-deacetylbaccatin III |
|
|
|
|
|
{{DEFAULTSORT:Deacetylbaccatin, 10-}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{pharma-stub}} |
|
|
{{ketone-stub}} |