Revision as of 14:42, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 457645438 of page 2,2'-Bis(2-indenyl)_biphenyl for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 16:54, 9 June 2024 edit GreenC bot (talk | contribs)Bots2,555,764 edits Move 1 url. Wayback Medic 2.5 per WP:URLREQ#google.com/patents |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 399195889 |
|
| verifiedrevid = 477190074 |
|
|
| Name = 2,2′-Bis(2-indenyl) biphenyl |
|
| ImageFile = Bisindenyl biphenyl.png |
|
| ImageFile = Bisindenyl biphenyl.png |
|
| ImageSize = 200px |
|
| ImageSize = 220 |
|
| IUPACName = 2,2'-Bis-(1''H''-inden-2-yl)-biphenyl |
|
| ImageAlt = Skeletal formula of 2,2'-bis(2-indenyl) biphenyl |
|
|
| ImageFile1 = 2,2'-Bis(2-indenyl)-biphenyl-3D-balls.png |
|
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Ball-and-stick model of the 2,2′-bis(2-indenyl) biphenyl molecule |
|
|
| PIN = 2,2′-Di(1''H''-inden-2-yl)-1,1′-biphenyl |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 9318556 |
|
| ChemSpiderID = 9318556 |
|
| InChI = 1/C30H22/c1-2-10-22-18-25(17-21(22)9-1)27-13-5-7-15-29(27)30-16-8-6-14-28(30)26-19-23-11-3-4-12-24(23)20-26/h1-17,19H,18,20H2 |
|
| InChI = 1/C30H22/c1-2-10-22-18-25(17-21(22)9-1)27-13-5-7-15-29(27)30-16-8-6-14-28(30)26-19-23-11-3-4-12-24(23)20-26/h1-17,19H,18,20H2 |
|
| InChIKey = DGTWDUGCMACYFO-UHFFFAOYAR |
|
| InChIKey = DGTWDUGCMACYFO-UHFFFAOYAR |
|
| SMILES1 = c1cccc\2c1CC(=C/2)/c6ccccc6c5ccccc5\C4=C\c3ccccc3C4 |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C30H22/c1-2-10-22-18-25(17-21(22)9-1)27-13-5-7-15-29(27)30-16-8-6-14-28(30)26-19-23-11-3-4-12-24(23)20-26/h1-17,19H,18,20H2 |
|
| StdInChI = 1S/C30H22/c1-2-10-22-18-25(17-21(22)9-1)27-13-5-7-15-29(27)30-16-8-6-14-28(30)26-19-23-11-3-4-12-24(23)20-26/h1-17,19H,18,20H2 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DGTWDUGCMACYFO-UHFFFAOYSA-N |
|
| StdInChIKey = DGTWDUGCMACYFO-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 152952-99-3 --> |
|
|
| PubChem = |
|
| CASNo = 152952-99-3 |
|
|
| PubChem = 11143444 |
|
| SMILES = C1(C2=C(C3=CC(C=CC=C5)=C5C3)C=CC=C2)=C(C4=CC(C=CC=C6)=C6C4)C=CC=C1 |
|
| SMILES = C1(C2=C(C3=CC(C=CC=C5)=C5C3)C=CC=C2)=C(C4=CC(C=CC=C6)=C6C4)C=CC=C1 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=30 | H=22 |
|
| C=30 | H=22 |
|
| Appearance = |
|
| Appearance = |
Line 27: |
Line 32: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
'''2,2′-Bis(2-indenyl) biphenyl''' is an organic compound with the formula <sub>2</sub>. The compound is the precursor, upon deprotonation, to ansa-metallocene complexes within the area of ]es. |
|
|
|
|
|
Metals studied with 2,2′-bis(2-indenyl) biphenyl include ], ], and ].{{cn|date=December 2016}} The ligand and its complexes have been prepared by the research group of the late ] at ].<ref>{{cite journal | doi=10.1021/om00035a026 | last1 = Ellis |first1=W.W. |last2=Hollis |first2=T.K. |last3=Odenkirk |first3=W. |authorlink3=Bill Odenkirk |last4=Whelan |first4=J. |last5=Ostrander |first5=R. |last6=Rheingold |first6=A.L. |last7=Bosnich |first7=B. |authorlink7=Brice Bosnich |year=1993|title=Synthesis, Structure, and Properties of Chiral Titanium and Zirconium Complexes Bearing Biaryl Strapped Substituted Cyclopentadienyl Ligands |journal=Organometallics|volume=12|pages=4391–4401|issue=11}}</ref> Zirconium and hafnium complexes made from this ligand were found to be active catalysts for the polymerization of the smallest ] – compounds with carbon-carbon double bonds—namely, ] and ].{{fact|date=December 2016}} The use of such complexes in the ] of ] has since been reported, and patented by ].<ref>H. J. Arts, M. Kranenburg, R. H. A. M. Meijers, E. G. Ijpeij, G. J. M. Gruter and F. H. Beijer. ''Indenyl Compounds for the Polymerization of Olefins'' ; Jan. 29, 2002.</ref><ref>{{cite journal|doi=10.1021/jo016040i|author1=E. G. Ijpeij |author2=F. H. Beijer |author3=H. J. Arts |author4=C. Newton |author5=J. G. de Vries |author6=G. J. M. Gruter |year=2002|title=A Suzuki Coupling Based Route to 2,2'-Bis#2-indenyl#biphenyl Derivatives|journal=J. Org. Chem.|volume=67|issue=1|pages=169–176|pmid=11777455|url=https://pure.rug.nl/ws/files/14467493/2002JOrgChemIJpeij.pdf }}</ref> |
|
|
|
|
|
== References== |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Bis(2-indenyl) biphenyl, 2,2'}} |
|
|
] |
|
|
] |
|
|
] |