Misplaced Pages

2,2-Dimethoxy-2-phenylacetophenone: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 15:26, 27 September 2010 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers from ChemSpider, CommonChemistry and FDA for the Chem/Drugbox validation project - Updated: ChemSpiderID InChI SMILES InChIKey.← Previous edit Latest revision as of 14:26, 8 September 2022 edit undoMigfab008 (talk | contribs)Extended confirmed users20,379 editsNo edit summary 
(32 intermediate revisions by 17 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Use dmy dates|date=September 2022}}
{{Chembox {{Chembox
| Watchedfields = changed | Watchedfields = changed
| verifiedrevid = 377457533 | verifiedrevid = 477209762
| ImageFile = DMPA.png | ImageFile = DMPA.png
| ImageSize = 200px | ImageSize = 200px
| ImageAlt = | ImageAlt =
| IUPACName = 2,2-Dimethoxy-2-phenylacetophenone | PIN = 2,2-Dimethoxy-1,2-diphenylethan-1-one
| OtherNames = 2,2-Dimethoxy-2-phenylacetophenone<br />α,α-Dimethoxy-α-phenylacetophenone<br />Benzil α,α-dimethyl acetal
| PIN =
|Section1={{Chembox Identifiers
| OtherNames = α,α-Dimethoxy-α-phenylacetophenone, Benzil α,α-dimethyl acetal
| Abbreviations = DMPA
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| Abbreviations = DMPA
| ChemSpiderID = 81777 | ChemSpiderID = 81777
| InChI = 1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3 | InChI = 1/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3
| InChIKey = KWVGIHKZDCUPEU-UHFFFAOYAK | InChIKey = KWVGIHKZDCUPEU-UHFFFAOYAK
| CASNo_Ref = {{cascite}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| CASNo = 24650-42-8 | ChEMBL = 364734
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| PubChem = 90571
| StdInChI = 1S/C16H16O3/c1-18-16(19-2,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12H,1-2H3
| SMILES = O=C(c1ccccc1)C(OC)(OC)c2ccccc2
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KWVGIHKZDCUPEU-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 24650-42-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1DK0094V28
| PubChem = 90571
| SMILES = O=C(c1ccccc1)C(OC)(OC)c2ccccc2
}} }}
| Section2 = {{Chembox Properties |Section2={{Chembox Properties
| C = 16 | O = 3 | H = 16 | C=16 | O=3 | H=16
| MolarMass = | MolarMass =
| Appearance = | Appearance =
| Density = | Density =
| MeltingPt = | MeltingPt =
| BoilingPt = | BoilingPt =
| Solubility = }} | Solubility = }}
| Section3 = {{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards = | MainHazards =
| FlashPt = | FlashPt =
| Autoignition = }} | AutoignitionPt = }}
}} }}
'''2,2-Dimethoxy-2-phenylacetophenone''' is a ], which is used to initialize radical ] e.g. in the preparation of ].<ref>{{Cite journal | title = Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo |vauthors=Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE | journal = Biosens Bioelectron | year = 2008 | volume = 23 | issue = 10 | pages = 1458–65 | doi=10.1016/j.bios.2008.01.012|pmid=18304798}}</ref> Under the influence of light the molecule will form radicals which initiate the radical polymerization. It can also be used as an initiator in the process of making an ].

'''2,2-Dimethoxy-2-phenylacetophenone''' is a photoinitiator, which is used to initialise radical polymerisation e.g. in the preparation of ].<ref>{{Cite journal | title = Percutaneous fiber-optic sensor for chronic glucose monitoring in vivo | author = Liao KC, Hogen-Esch T, Richmond FJ, Marcu L, Clifton W, Loeb GE | journal = Biosens Bioelectron | year = 2008 | volume = 23 | issue = 10 | pages = 1458–65}}</ref>


== References == == References ==
{{reflist}} {{reflist}}


{{DEFAULTSORT:Dimethoxy-2-phenylacetophenone, 2,2-}} {{DEFAULTSORT:Dimethoxy-2-phenylacetophenone, 2, 2-}}
] ]
] ]


{{ketone-stub}} {{ketone-stub}}