Revision as of 15:41, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444167483 of page 2,3-Dihydroxy-3-methylpentanoic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 20:55, 30 December 2023 edit KormiSK (talk | contribs)Extended confirmed users923 edits +pagesTag: Visual edit |
Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 434223591 |
|
| verifiedrevid = 477198728 |
|
|ImageFile=2,3-Dihydroxy-3-methylpentanoic acid.png |
|
| ImageFile=2,3-Dihydroxy-3-methylpentanoic acid.svg |
|
|ImageSize=180px |
|
| ImageSize=180px |
|
|IUPACName=2,3-dihydroxy-3-methylpentanoic acid |
|
| PIN=2,3-Dihydroxy-3-methylpentanoic acid |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 7 |
|
| ChemSpiderID = 7 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
Line 18: |
Line 18: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = PDGXJDXVGMHUIR-UHFFFAOYSA-N |
|
| StdInChIKey = PDGXJDXVGMHUIR-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 562-43-6 --> |
|
|
|
| CASNo=562-43-6 |
|
| PubChem=8 |
|
|
| SMILES=CCC(C)(C(C(=O)O)O)O |
|
| PubChem=8 |
|
|
| SMILES=CCC(C)(C(C(=O)O)O)O |
|
| MeSHName=2,3-dihydroxy-3-methylpentanoic+acid |
|
| MeSHName=2,3-dihydroxy-3-methylpentanoic+acid |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>6</sub>H<sub>12</sub>O<sub>4</sub> |
|
| Formula=C<sub>6</sub>H<sub>12</sub>O<sub>4</sub> |
|
| MolarMass=148.16 g/mol |
|
| MolarMass=148.16 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2,3-Dihydroxy-3-methylpentanoic acid''' is an intermediate in the metabolism of ]. |
|
|
|
|
|
== Metabolism == |
|
|
2,3-Dihydroxy-3-methylpentanoate is synthesized by the action of ] with subsequent reduction from ] through ]:<ref name=":0">{{Cite book |last=Voet |first=Donald |title=Biochemistry |last2=Voet |first2=Judith G. |date=2011 |publisher=Wiley |isbn=978-0-470-91745-9 |edition=4. |location=Hoboken, NJ |pages=1074{{--}}1075}}</ref> |
|
|
|
|
|
: α-aceto-α-hydroxybutyrate → 3-hydroxy-2-keto-3-methylpentanoate |
|
|
|
|
|
: 3-hydroxy-2-keto-3-methylpentanoate + NAD(P)H → 2,3-dihydroxy-3-methylpentanoate + NAD(P)<sup>+</sup> |
|
|
|
|
|
It is then processed by the action of ], which results in ] and water:<ref name=":0" /> |
|
|
|
|
|
: 2,3-dihydroxy-3-methylpentanoate → 2-keto-3-methylvalerate + H<sub>2</sub>O |
|
|
] of 2-keto-3-methylvalerate yields isoleucine. |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{organic-compound-stub}} |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Dihydroxy-3-methylpentanoic acid, 2,3-}} |
|
|
] |
|
|
] |
|
|
] |