| Revision as of 17:06, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 473305971 of page 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 00:00, 15 February 2022 edit 150.148.14.139 (talk)No edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 413104503 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 477211525 |
|
| ImageFile1 = 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine.svg |
|
| ImageFile1 = 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine.svg |
|
| ImageSize1 = 230px |
|
| ImageSize1 = 200px |
|
⚫ |
| PIN = 1-propan-2-amine |
|
| ImageFile2 = |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| ImageSize2 = 200px |
|
|
| IUPACName = (''RS'')-2--1-methyl-ethylamine |
|
| ⚫ |
| OtherNames = 1-propan-2-amine |
|
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| InChI = 1/C13H20FNO2/c1-9(15)6-11-8-12(16-2)10(4-5-14)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3 |
|
| InChI = 1/C13H20FNO2/c1-9(15)6-11-8-12(16-2)10(4-5-14)7-13(11)17-3/h7-9H,4-6,15H2,1-3H3 |
|
| SMILES1 = COc1cc(CC(C)N)c(cc1CCF)OC |
|
| SMILES1 = COc1cc(CC(C)N)c(cc1CCF)OC |
| Line 18: |
Line 16: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = QLENKWFQUHHBKZ-UHFFFAOYSA-N |
|
| StdInChIKey = QLENKWFQUHHBKZ-UHFFFAOYSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 121649-01-2 --> |
|
| CASNo = 121649-01-2 |
|
|
| UNII = 72UT55MXE3 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID=21106293 |
|
| ChemSpiderID=21106293 |
|
| PubChem = |
|
| PubChem = 14201982 |
|
| SMILES = C1(=CC(=C(C=C1CC(C)N)OC)CCF)OC |
|
| SMILES = C1(=CC(=C(C=C1CC(C)N)OC)CCF)OC |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=13|H=20|N=1|O=2|F=1 |
|
| Formula = C<sub>13</sub>H<sub>20</sub>NO<sub>2</sub>F |
|
|
| MolarMass = 241.31 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
| Line 32: |
Line 31: |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = }} |
|
| Solubility = }} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = }} |
|
| AutoignitionPt = }} |
|
}} |
|
}} |
|
|
|
|
|
''' 2,5-Dimethoxy-4-(2-fluoroethyl)amphetamine''' ('''DOEF'''; also known as '''dimethoxyfluoroethylamphetamine''') is a lesser-known ] and member of the ].<ref>{{cite journal | doi = 10.1016/S0040-4039(00)82391-6| title = Synthesis of 1-[2′,5′-dimethoxy-4′-(β-fluoroethyl)phenyl]-2-aminopropane:studies related to 18F-labeled serotonin receptor ligands| journal = Tetrahedron Letters| volume = 29| issue = 50| pages = 6537–6539| year = 1988| last1 = Gerdes| first1 = John M.| last2 = Mathis| first2 = Chester A.| last3 = Shulgin| first3 = Alexander T.}}</ref><ref>{{cite journal | doi = 10.1002/dta.413| pmid = 22374819| title = Fluorine in psychedelic phenethylamines| journal = Drug Testing and Analysis| volume = 4| issue = 7–8| pages = 577–590| year = 2012| last1 = Trachsel| first1 = Daniel}}</ref> DOEF was first synthesized by ]. In his book '']'', the dosage range is listed as 2–3.5 mg, and the duration is listed as 12–16 hours.<ref></ref> Very little data exists about the pharmacological properties, metabolism, and toxicity of DOEF. |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Hallucinogens}} |
|
|
|
|
|
{{DEFAULTSORT:Dimethoxy-4-fluoroethylamphetamine, 2,5-}} |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{Psychoactive-stub}} |