| Revision as of 15:38, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 399207460 of page 2-(1-Hexyloxyethyl)-2-devinyl_pyropheophorbide-a for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 03:03, 30 July 2021 edit Citation bot (talk | contribs)Bots5,429,096 edits Add: s2cid. | Use this bot. Report bugs. | Suggested by Abductive | Category:Pharmacology stubs | #UCB_Category 448/606 |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 399205496 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageFile=Photochlor.png |
|
|
⚫ |
| verifiedrevid = 477198133 |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile=Photochlor.png |
| ⚫ |
|IUPACName= |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|OtherNames=Photochlor |
|
|
⚫ |
| IUPACName= |
|
⚫ |
| OtherNames=Photochlor |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = HPPH |
|
| Abbreviations = HPPH |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4589621 |
|
| ChemSpiderID = 4589621 |
|
| InChI = 1/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1 |
|
| InChI = 1/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1 |
|
| InChIKey = ODJVLHDVEGAIAW-NMWXTPPCBI |
|
| InChIKey = ODJVLHDVEGAIAW-NMWXTPPCBI |
|
| SMILES1 = O=C(O)CC6c2nc(cc5c(c(c(cc1c(c(c(n1)cc\3nc4c2CC(=O)\C4=C/3C)CC)C)n5)C(OCCCCCC)C)C)6C |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1 |
|
| StdInChI = 1S/C39H48N4O4/c1-8-10-11-12-15-47-24(7)36-22(5)30-17-29-21(4)26(13-14-35(45)46)38(42-29)27-16-34(44)37-23(6)31(43-39(27)37)18-32-25(9-2)20(3)28(40-32)19-33(36)41-30/h17-19,21,24,26,40-41H,8-16H2,1-7H3,(H,45,46)/b28-19-,29-17-,30-17-,31-18-,32-18-,33-19-,38-27-/t21-,24?,26-/m0/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ODJVLHDVEGAIAW-NMWXTPPCSA-N |
|
| StdInChIKey = ODJVLHDVEGAIAW-NMWXTPPCSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 149402-51-7 --> |
|
|
|
| CASNo=149402-51-7 |
| ⚫ |
| PubChem=5488034 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| SMILES=CCCCCCOC(C)C1=C2C=C3C(=C(C(=CC4=NC5=C(CC(=O)C5=C4C)C6=NC(=CC(=C1C)N2)(6CCC(=O)O)C)N3)CC)C |
|
|
|
| UNII = DOB7Y3RSX0 |
|
⚫ |
| PubChem=5488034 |
|
⚫ |
| SMILES=CCCCCCOC(C)C1=C2C=C3C(=C(C(=CC4=NC5=C(CC(=O)C5=C4C)C6=NC(=CC(=C1C)N2)(6CCC(=O)O)C)N3)CC)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=39|H=48|N=4|O=4 |
|
| C=39 | H=48 | N=4 | O=4 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2-(1-Hexyloxyethyl)-2-devinyl pyropheophorbide-a''' ('''HPPH''') is a photosensitiser chemical that is used in ].<ref>{{cite journal | pmid = 11891727 | year = 2001 | last1 = Lobel | first1 = J | last2 = MacDonald | first2 = IJ | last3 = Ciesielski | first3 = MJ | last4 = Barone | first4 = T | last5 = Potter | first5 = WR | last6 = Pollina | first6 = J | last7 = Plunkett | first7 = RJ | last8 = Fenstermaker | first8 = RA | last9 = Dougherty | first9 = TJ | title = 2-1-hexyloxyethyl-2-devinyl pyropheophorbide-a (HPPH) in a nude rat glioma model: implications for photodynamic therapy | volume = 29 | issue = 5 | pages = 397–405 | journal = Lasers in Surgery and Medicine | doi = 10.1002/lsm.10001 | s2cid = 22578518 }}</ref> |
|
|
|
|
|
It is being developed under the brand name '''Photochlor'''. |
|
|
|
|
|
==Clinical trials== |
|
|
A phase I/II clinical trial started in 1997 for ].<ref></ref> |
|
|
|
|
|
A phase II trial for ] is due to run from 2007 to 2011.<ref></ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
|
|
|
{{DEFAULTSORT:Hexyloxyethyl)-2-devinyl pyropheophorbide-a, 2-(1-}} |
|
|
{{pharma-stub}} |
|
|
|
|
|
] |