| Revision as of 15:12, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 446633810 of page 2-Aminomuconic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 15:33, 17 September 2023 edit KoIobok (talk | contribs)Extended confirmed users1,350 edits Changed Category:Amino acids to Category:Alpha-Amino acids |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 446632726 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ImageFile = Aminomuconic acid.png |
|
|
⚫ |
| verifiedrevid = 477194597 |
| ⚫ |
| ImageSize = 200px |
|
|
⚫ |
| ImageFile = Aminomuconic acid.png |
| ⚫ |
| ImageName = Skeletal formula of 2-aminomuconic acid |
|
|
⚫ |
| ImageSize = 200px |
| ⚫ |
| ImageFile1 = 2-Aminomuconic-acid-3D-balls.png |
|
|
⚫ |
| ImageName = Skeletal formula of 2-aminomuconic acid |
| ⚫ |
| ImageSize1 = 220px |
|
|
⚫ |
| ImageFile1 = 2-Aminomuconic-acid-3D-balls.png |
| ⚫ |
| ImageName1 = Ball-and-stick model of 2-aminomuconic acid |
|
|
⚫ |
| ImageSize1 = 220px |
| ⚫ |
| IUPACName = (2''Z'',4''E'')-2-Aminohexa-2,4-dienedioic acid |
|
|
⚫ |
| ImageName1 = Ball-and-stick model of 2-aminomuconic acid |
| ⚫ |
| OtherNames = |
|
|
⚫ |
| PIN = (2''Z'',4''E'')-2-Aminohexa-2,4-dienedioic acid |
|
⚫ |
| OtherNames = |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 4548-99-6 --> |
|
|
|
| CASNo = 4548-99-6 |
| ⚫ |
| PubChem=5459864 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9PX3G8GFQ7 |
|
⚫ |
| PubChem = 5459864 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4573610 |
|
| ChemSpiderID = 4573610 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
| Line 21: |
Line 25: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZRHONLCTYUYMIQ-TZFCGSKZSA-N |
|
| StdInChIKey = ZRHONLCTYUYMIQ-TZFCGSKZSA-N |
|
| SMILES=C(=C\C(=O)O)/C=C(/C(=O)O)\N |
|
| SMILES = C(=C\C(=O)O)/C=C(/C(=O)O)\N |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| Formula = |
|
| Formula=C<sub>6</sub>H<sub>7</sub>NO<sub>4</sub> |
|
|
|
| C=6 | H=7 | N=1 | O=4 |
|
| MolarMass=157.12 g/mol |
|
| MolarMass=157.12 g/mol |
|
| Appearance= |
|
|
| Density= |
|
| Appearance= |
|
|
| Density= 1.461 g/mL |
|
| MeltingPt= |
|
|
| BoilingPt= |
|
| MeltingPt= |
|
|
| BoilingPtC= 368.4 |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''2-Aminomuconic acid''' is an intermediate in the metabolism of ].<ref>{{cite journal | vauthors = He Z, Spain J | title = Preparation of 2-aminomuconate from 2-aminophenol by coupled enzymatic dioxygenation and dehydrogenation reactions | journal = Journal of Industrial Microbiology & Biotechnology | volume = 23 | issue = 2 | pages = 138–142 | date = August 1999 | pmid = 10510494 | doi = 10.1038/sj.jim.2900705 | s2cid = 1091252 | doi-access = free }}</ref> |
|
|
|
|
|
== See also == |
|
|
*] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Amino acid metabolism intermediates}} |
|
|
|
|
|
{{DEFAULTSORT:Aminomuconic acid, 2-}} |
|
|
] |
|
|
] |
|
|
|
|
|
{{alkene-stub}} |